diff --git a/includes/AutoLoader.php b/includes/AutoLoader.php index d6332fd9a64..de1838006aa 100644 --- a/includes/AutoLoader.php +++ b/includes/AutoLoader.php @@ -52,6 +52,8 @@ $wgAutoloadLocalClasses = array( 'ConstantDependency' => 'includes/CacheDependency.php', 'CreativeCommonsRdf' => 'includes/Metadata.php', 'Credits' => 'includes/Credits.php', + 'CSSJanus' => 'includes/CSSJanus.php', + 'CSSMin' => 'includes/CSSMin.php', 'DBABagOStuff' => 'includes/BagOStuff.php', 'DependencyWrapper' => 'includes/CacheDependency.php', 'DiffHistoryBlob' => 'includes/HistoryBlob.php', @@ -161,6 +163,7 @@ $wgAutoloadLocalClasses = array( 'MediaWiki' => 'includes/Wiki.php', 'MemCachedClientforWiki' => 'includes/memcached-client.php', 'Message' => 'includes/Message.php', + 'MessageBlobStore' => 'includes/MessageBlobStore.php', 'MessageCache' => 'includes/MessageCache.php', 'MimeMagic' => 'includes/MimeMagic.php', 'MWException' => 'includes/Exception.php', @@ -194,6 +197,12 @@ $wgAutoloadLocalClasses = array( 'RegexlikeReplacer' => 'includes/StringUtils.php', 'ReplacementArray' => 'includes/StringUtils.php', 'Replacer' => 'includes/StringUtils.php', + 'ResourceLoader' => 'includes/ResourceLoader.php', + 'ResourceLoaderContext' => 'includes/ResourceLoaderContext.php', + 'ResourceLoaderFileModule' => 'includes/ResourceLoaderModule.php', + 'ResourceLoaderModule' => 'includes/ResourceLoaderModule.php', + 'ResourceLoaderSiteModule' => 'includes/ResourceLoaderModule.php', + 'ResourceLoaderStartUpModule' => 'includes/ResourceLoaderModule.php', 'ReverseChronologicalPager' => 'includes/Pager.php', 'Revision' => 'includes/Revision.php', 'RevisionDelete' => 'includes/RevisionDelete.php', diff --git a/includes/CSSJanus.php b/includes/CSSJanus.php new file mode 100644 index 00000000000..86d52b0be15 --- /dev/null +++ b/includes/CSSJanus.php @@ -0,0 +1,313 @@ + '`TMP`', + 'nonAscii' => '[\200-\377]', + 'unicode' => '(?:(?:\\[0-9a-f]{1,6})(?:\r\n|\s)?)', + 'num' => '(?:[0-9]*\.[0-9]+|[0-9]+)', + 'unit' => '(?:em|ex|px|cm|mm|in|pt|pc|deg|rad|grad|ms|s|hz|khz|%)', + 'body_selector' => 'body\s*{\s*', + 'direction' => 'direction\s*:\s*', + 'escape' => null, + 'nmstart' => null, + 'nmchar' => null, + 'ident' => null, + 'quantity' => null, + 'possibly_negative_quantity' => null, + 'color' => null, + 'url_special_chars' => '[!#$%&*-~]', + 'valid_after_uri_chars' => '[\'\"]?\s*', + 'url_chars' => null, + 'lookahead_not_open_brace' => null, + 'lookahead_not_closing_paren' => null, + 'lookahead_for_closing_paren' => null, + 'lookbehind_not_letter' => '(? '[^\}]*?', + 'noflip_annotation' => '\/\*\s*@noflip\s*\*\/', + + 'noflip_single' => null, + 'noflip_class' => null, + 'comment' => '/\/\*[^*]*\*+([^\/*][^*]*\*+)*\//', + 'body_direction_ltr' => null, + 'body_direction_rtl' => null, + 'left' => null, + 'right' => null, + 'left_in_url' => null, + 'right_in_url' => null, + 'ltr_in_url' => null, + 'rtl_in_url' => null, + 'cursor_east' => null, + 'cursor_west' => null, + 'four_notation_quantity' => null, + 'four_notation_color' => null, + 'bg_horizontal_percentage' => null, + 'bg_horizontal_percentage_x' => null, + ); + + /** + * Build patterns we can't define above because they depend on other patterns. + */ + private static function buildPatterns() { + if ( !is_null( self::$patterns['escape'] ) ) { + // Patterns have already been built + return; + } + $patterns =& self::$patterns; + $patterns['escape'] = "(?:{$patterns['unicode']}|\\[^\r\n\f0-9a-f])"; + $patterns['nmstart'] = "(?:[_a-z]|{$patterns['nonAscii']}|{$patterns['escape']})"; + $patterns['nmchar'] = "(?:[_a-z0-9-]|{$patterns['nonAscii']}|{$patterns['escape']})"; + $patterns['ident'] = "-?{$patterns['nmstart']}{$patterns['nmchar']}*"; + $patterns['quantity'] = "{$patterns['num']}(?:\s*{$patterns['unit']}|{$patterns['ident']})?"; + $patterns['possibly_negative_quantity'] = "((?:-?{$patterns['quantity']})|(?:inherit|auto))"; + $patterns['color'] = "(#?{$patterns['nmchar']}+)"; + $patterns['url_chars'] = "(?:{$patterns['url_special_chars']}|{$patterns['nonAscii']}|{$patterns['escape']})*"; + $patterns['lookahead_not_open_brace'] = "(?!({$patterns['nmchar']}|\r?\n|\s|#|\:|\.|\,|\+|>)*?{)"; + $patterns['lookahead_not_closing_paren'] = "(?!{$patterns['url_chars']}?{$patterns['valid_after_uri_chars']}\))"; + $patterns['lookahead_for_closing_paren'] = "(?={$patterns['url_chars']}?{$patterns['valid_after_uri_chars']}\))"; + + $patterns['noflip_single'] = "/({$patterns['noflip_annotation']}{$patterns['lookahead_not_open_brace']}[^;}]+;?)/i"; + $patterns['noflip_class'] = "/({$patterns['noflip_annotation']}{$patterns['chars_within_selector']}})/i"; + $patterns['body_direction_ltr'] = "/({$patterns['body_selector']}{$patterns['chars_within_selector']}{$patterns['direction']})ltr/i"; + $patterns['body_direction_rtl'] = "/({$patterns['body_selector']}{$patterns['chars_within_selector']}{$patterns['direction']})rtl/i"; + $patterns['left'] = "/{$patterns['lookbehind_not_letter']}(left){$patterns['lookahead_not_closing_paren']}{$patterns['lookahead_not_open_brace']}/i"; + $patterns['right'] = "/{$patterns['lookbehind_not_letter']}(right){$patterns['lookahead_not_closing_paren']}{$patterns['lookahead_not_open_brace']}/i"; + $patterns['left_in_url'] = "/{$patterns['lookbehind_not_letter']}(left){$patterns['lookahead_for_closing_paren']}/i"; + $patterns['right_in_url'] = "/{$patterns['lookbehind_not_letter']}(right){$patterns['lookahead_for_closing_paren']}/i"; + $patterns['ltr_in_url'] = "/{$patterns['lookbehind_not_letter']}(ltr){$patterns['lookahead_for_closing_paren']}/i"; + $patterns['rtl_in_url'] = "/{$patterns['lookbehind_not_letter']}(rtl){$patterns['lookahead_for_closing_paren']}/i"; + $patterns['cursor_east'] = "/{$patterns['lookbehind_not_letter']}([ns]?)e-resize/"; + $patterns['cursor_west'] = "/{$patterns['lookbehind_not_letter']}([ns]?)w-resize/"; + $patterns['four_notation_quantity'] = "/{$patterns['possibly_negative_quantity']}(\s+){$patterns['possibly_negative_quantity']}(\s+){$patterns['possibly_negative_quantity']}(\s+){$patterns['possibly_negative_quantity']}/i"; + $patterns['four_notation_color'] = "/(-color\s*:\s*){$patterns['color']}(\s+){$patterns['color']}(\s+){$patterns['color']}(\s+){$patterns['color']}/i"; + // The two regexes below are parenthesized differently then in the original implementation to make the + // callback's job more straightforward + $patterns['bg_horizontal_percentage'] = "/(background(?:-position)?\s*:\s*[^%]*?)({$patterns['num']})(%\s*(?:{$patterns['quantity']}|{$patterns['ident']}))/"; + $patterns['bg_horizontal_percentage_x'] = "/(background-position-x\s*:\s*)({$patterns['num']})(%)/"; + } + + /** + * Transform an LTR stylesheet to RTL + * @param string $css Stylesheet to transform + * @param bool $swapLtrRtlInURL If true, swap 'ltr' and 'rtl' in URLs + * @param bool $swapLeftRightInURL If true, swap 'left' and 'right' in URLs + * @return Transformed stylesheet + */ + public static function transform( $css, $swapLtrRtlInURL = false, $swapLeftRightInURL = false ) { + // We wrap tokens in ` , not ~ like the original implementation does. + // This was done because ` is not a legal character in CSS and can only + // occur in URLs, where we escape it to %60 before inserting our tokens. + $css = str_replace( '`', '%60', $css ); + + self::buildPatterns(); + + // Tokenize single line rules with /* @noflip */ + $noFlipSingle = new CSSJanus_Tokenizer( self::$patterns['noflip_single'], '`NOFLIP_SINGLE`' ); + $css = $noFlipSingle->tokenize( $css ); + + // Tokenize class rules with /* @noflip */ + $noFlipClass = new CSSJanus_Tokenizer( self::$patterns['noflip_class'], '`NOFLIP_CLASS`' ); + $css = $noFlipClass->tokenize( $css ); + + // Tokenize comments + $comments = new CSSJanus_Tokenizer( self::$patterns['comment'], '`C`' ); + $css = $comments->tokenize( $css ); + + // LTR->RTL fixes start here + $css = self::fixBodyDirection( $css ); + if ( $swapLtrRtlInURL ) { + $css = self::fixLtrRtlInURL( $css ); + } + if ( $swapLeftRightInURL ) { + $css = self::fixLeftRightInURL( $css ); + } + $css = self::fixLeftAndRight( $css ); + $css = self::fixCursorProperties( $css ); + $css = self::fixFourPartNotation( $css ); + $css = self::fixBackgroundPosition( $css ); + + // Detokenize stuff we tokenized before + $css = $comments->detokenize( $css ); + $css = $noFlipClass->detokenize( $css ); + $css = $noFlipSingle->detokenize( $css ); + return $css; + } + + /** + * Replace direction: ltr; with direction: rtl; and vice versa, but *only* + * those inside a body { .. } selector. + * + * Unlike the original implementation, this function doesn't suffer from + * the bug causing "body\n{\ndirection: ltr;\n}" to be missed. + * See http://code.google.com/p/cssjanus/issues/detail?id=15 + */ + private static function fixBodyDirection( $css ) { + $css = preg_replace( self::$patterns['body_direction_ltr'], + '$1' . self::$patterns['tmpToken'], $css ); + $css = preg_replace( self::$patterns['body_direction_rtl'], '$1ltr', $css ); + $css = str_replace( self::$patterns['tmpToken'], 'rtl', $css ); + return $css; + } + + /** + * Replace 'ltr' with 'rtl' and vice versa in background URLs + */ + private static function fixLtrRtlInURL( $css ) { + $css = preg_replace( self::$patterns['ltr_in_url'], self::$patterns['tmpToken'], $css ); + $css = preg_replace( self::$patterns['rtl_in_url'], 'ltr', $css ); + $css = str_replace( self::$patterns['tmpToken'], 'rtl', $css ); + return $css; + } + + /** + * Replace 'left' with 'right' and vice versa in background URLs + */ + private static function fixLeftRightInURL( $css ) { + $css = preg_replace( self::$patterns['left_in_url'], self::$patterns['tmpToken'], $css ); + $css = preg_replace( self::$patterns['right_in_url'], 'left', $css ); + $css = str_replace( self::$patterns['tmpToken'], 'right', $css ); + return $css; + } + + /** + * Flip rules like left: , padding-right: , etc. + */ + private static function fixLeftAndRight( $css ) { + $css = preg_replace( self::$patterns['left'], self::$patterns['tmpToken'], $css ); + $css = preg_replace( self::$patterns['right'], 'left', $css ); + $css = str_replace( self::$patterns['tmpToken'], 'right', $css ); + return $css; + } + + /** + * Flip East and West in rules like cursor: nw-resize; + */ + private static function fixCursorProperties( $css ) { + $css = preg_replace( self::$patterns['cursor_east'], + '$1' . self::$patterns['tmpToken'], $css ); + $css = preg_replace( self::$patterns['cursor_west'], '$1e-resize', $css ); + $css = str_replace( self::$patterns['tmpToken'], 'w-resize', $css ); + return $css; + } + + /** + * Swap the second and fourth parts in four-part notation rules like + * padding: 1px 2px 3px 4px; + * + * Unlike the original implementation, this function doesn't suffer from + * the bug where whitespace is not preserved when flipping four-part rules + * and four-part color rules with multiple whitespace characters between + * colors are not recognized. + * See http://code.google.com/p/cssjanus/issues/detail?id=16 + */ + private static function fixFourPartNotation( $css ) { + $css = preg_replace( self::$patterns['four_notation_quantity'], '$1$2$7$4$5$6$3', $css ); + $css = preg_replace( self::$patterns['four_notation_color'], '$1$2$3$8$5$6$7$4', $css ); + return $css; + } + + /** + * Flip horizontal background percentages. + */ + private static function fixBackgroundPosition( $css ) { + $css = preg_replace_callback( self::$patterns['bg_horizontal_percentage'], + array( 'self', 'calculateNewBackgroundPosition' ), $css ); + $css = preg_replace_callback( self::$patterns['bg_horizontal_percentage_x'], + array( 'self', 'calculateNewBackgroundPosition' ), $css ); + return $css; + } + + /** + * Callback for calculateNewBackgroundPosition() + */ + private static function calculateNewBackgroundPosition( $matches ) { + return $matches[1] . ( 100 - $matches[2] ) . $matches[3]; + } +} + +/** + * Utility class used by CSSJanus that tokenizes and untokenizes things we want + * to protect from being janused. + * @author Roan Kattouw + */ +class CSSJanus_Tokenizer { + private $regex, $token; + private $originals; + + /** + * Constructor + * @param $regex string Regular expression whose matches to replace by a token. + * @param $token string Token + */ + public function __construct( $regex, $token ) { + $this->regex = $regex; + $this->token = $token; + $this->originals = array(); + } + + /** + * Replace all occurrences of $regex in $str with a token and remember + * the original strings. + * @param $str string String to tokenize + * @return string Tokenized string + */ + public function tokenize( $str ) { + return preg_replace_callback( $this->regex, array( $this, 'tokenizeCallback' ), $str ); + } + + private function tokenizeCallback( $matches ) { + $this->originals[] = $matches[0]; + return $this->token; + } + + /** + * Replace tokens with their originals. If multiple strings were tokenized, it's important they be + * detokenized in exactly the SAME ORDER. + * @param string $str String previously run through tokenize() + * @return string Original string + */ + public function detokenize( $str ) { + // PHP has no function to replace only the first occurrence or to + // replace occurrences of the same string with different values, + // so we use preg_replace_callback() even though we don't really need a regex + return preg_replace_callback( '/' . preg_quote( $this->token, '/' ) . '/', + array( $this, 'detokenizeCallback' ), $str ); + } + + private function detokenizeCallback( $matches ) { + $retval = current( $this->originals ); + next( $this->originals ); + return $retval; + } + +} \ No newline at end of file diff --git a/includes/CSSMin.php b/includes/CSSMin.php new file mode 100644 index 00000000000..e088114893b --- /dev/null +++ b/includes/CSSMin.php @@ -0,0 +1,100 @@ +[^\?\)\:]*)\??[^\)]*[\'"]?\)/'; + $files = array(); + if ( preg_match_all( $pattern, $source, $matches, PREG_OFFSET_CAPTURE | PREG_SET_ORDER ) ) { + foreach ( $matches as $match ) { + $file = ( isset( $path ) ? rtrim( $path, '/' ) . '/' : '' ) . "{$match['file'][0]}"; + // Only proceed if we can access the file + if ( file_exists( $file ) ) { + $files[] = $file; + } + } + } + return $files; + } + + /** + * Remaps CSS URL paths and automatically embeds data URIs for URL rules preceded by an /* @embed * / comment + * + * @param $source string CSS data to remap + * @param $path string File path where the source was read from + * @return string Remapped CSS data + */ + public static function remap( $source, $path ) { + $pattern = '/((?\s*\/\*\s*\@embed\s*\*\/)(?[^\;\}]*))?url\([\'"]?(?[^\?\)\:]*)\??[^\)]*[\'"]?\)(?[^;]*)[\;]?/'; + $offset = 0; + while ( preg_match( $pattern, $source, $match, PREG_OFFSET_CAPTURE, $offset ) ) { + // Shortcuts + $embed = $match['embed'][0]; + $rule = $match['rule'][0]; + $extra = $match['extra'][0]; + $file = "{$path}/{$match['file'][0]}"; + // Only proceed if we can access the file + if ( file_exists( $file ) ) { + // Add version parameter as a time-stamp in ISO 8601 format, using Z for the timezone, meaning GMT + $url = "{$file}?" . gmdate( 'Y-m-d\TH:i:s\Z', round( filemtime( $file ), -2 ) ); + // Detect when URLs were preceeded with embed tags, and also verify file size is below the limit + if ( $match['embed'][1] > 0 && filesize( $file ) < self::EMBED_SIZE_LIMIT ) { + // If we ever get to PHP 5.3, we should use the Fileinfo extension instead of mime_content_type + $type = mime_content_type( $file ); + // Strip off any trailing = symbols (makes browsers freak out) + $data = rtrim( base64_encode( file_get_contents( $file ) ), '=' ); + // Build 2 CSS properties; one which uses a base64 encoded data URI in place of the @embed + // comment to try and retain line-number integrity , and the other with a remapped an versioned + // URL and an Internet Explorer hack making it ignored in all browsers that support data URIs + $replacement = "{$rule}url(data:{$type};base64,{$data}){$extra};{$rule}url({$url}){$extra}!ie;"; + } else { + // Build a CSS property with a remapped and versioned URL + $replacement = "{$embed}{$rule}url({$url}){$extra};"; + } + // Perform replacement on the source + $source = substr_replace( $source, $replacement, $match[0][1], strlen( $match[0][0] ) ); + // Move the offset to the end of the replacement in the source + $offset = $match[0][1] + strlen( $replacement ); + continue; + } + // Move the offset to the end of the match, leaving it alone + $offset = $match[0][1] + strlen( $match[0][0] ); + } + return $source; + } + + /** + * Removes whitespace from CSS data + * + * @param $source string CSS data to minify + * @return string Minified CSS data + */ + public static function minify( $css ) { + return trim( + str_replace( + array( '; ', ': ', ' {', '{ ', ', ', '} ', ';}' ), + array( ';', ':', '{', '{', ',', '}', '}' ), + preg_replace( array( '/\s+/', '/\/\*.*?\*\//s' ), array( ' ', '' ), $css ) + ) + ); + } +} \ No newline at end of file diff --git a/includes/ChangesList.php b/includes/ChangesList.php index 99003639d0d..dfd2b93e293 100644 --- a/includes/ChangesList.php +++ b/includes/ChangesList.php @@ -601,13 +601,13 @@ class EnhancedChangesList extends ChangesList { * @return String */ public function beginRecentChangesList() { - global $wgStylePath, $wgStyleVersion; + global $wgStylePath, $wgStyleVersion, $wgOut; $this->rc_cache = array(); $this->rcMoveIndex = 0; $this->rcCacheIndex = 0; $this->lastdate = ''; $this->rclistOpen = false; - $script = Html::linkedScript( $wgStylePath . "/common/enhancedchanges.js?$wgStyleVersion" ); + $wgOut->addModules( 'mediawiki.legacy.enhancedchanges' ); return $script; } /** diff --git a/includes/DefaultSettings.php b/includes/DefaultSettings.php index b1055302f6b..7d9a9ec27cd 100644 --- a/includes/DefaultSettings.php +++ b/includes/DefaultSettings.php @@ -1628,6 +1628,19 @@ $wgUseETag = false; */ $wgClockSkewFudge = 5; +/** + * Maximum time in seconds to cache resources served by the resource loader on + * the client side (e.g. in the browser cache). + */ +$wgResourceLoaderClientMaxage = 30*24*60*60; // 30 days + +/** + * Maximum time in seconds to cache resources served by the resource loader on + * the server side. This means Squid/Varnish but also any other public proxy + * cache between the client and MediaWiki. + */ +$wgResourceLoaderServerMaxage = 30*24*60*60; // 30 days + /** @} */ # end of cache settings /************************************************************************//** @@ -2190,26 +2203,6 @@ $wgUseSiteJs = true; /** Use the site's Cascading Style Sheets (CSS)? */ $wgUseSiteCss = true; -/** - * Version of jQuery to use. Currently available versions are 1.3.2 and 1.4.2 . - * Other versions can be installed by hand at your own risk, see - * http://www.mediawiki.org/wiki/Manual:$wgJQueryVersion - */ -$wgJQueryVersion = '1.4.2'; - -/** - * Use a minified version of jQuery. If enabled, jquery-versionnumber.min.js - * will be used instead of jquery-versionnumber.js . It is recommended you only - * disable this for debugging purposes. - */ -$wgJQueryMinified = true; - -/** - * Include jQuery on every page served by MediaWiki. You can disable this if - * your user/site-wide JS doesn't need it and you want to save bandwidth. - */ -$wgJQueryOnEveryPage = true; - /** * Set to false to disable application of access keys and tooltips, * eg to avoid keyboard conflicts with system keys or as a low-level diff --git a/includes/EditPage.php b/includes/EditPage.php index e3c8b621c5f..df54af83b33 100644 --- a/includes/EditPage.php +++ b/includes/EditPage.php @@ -318,11 +318,11 @@ class EditPage { $this->preview = true; } - $wgOut->addScriptFile( 'edit.js' ); + $wgOut->addModules( 'mediawiki.legacy.edit' ); if ( $wgUser->getOption( 'uselivepreview', false ) ) { $wgOut->includeJQuery(); - $wgOut->addScriptFile( 'preview.js' ); + $wgOut->addModules( 'mediawiki.legacy.preview' ); } // Bug #19334: textarea jumps when editing articles in IE8 $wgOut->addStyle( 'common/IE80Fixes.css', 'screen', 'IE 8' ); @@ -2108,7 +2108,7 @@ HTML * @return string */ static function getEditToolbar() { - global $wgStylePath, $wgContLang, $wgLang; + global $wgStylePath, $wgContLang, $wgLang, $wgOut; /** @@ -2244,8 +2244,11 @@ HTML array_map( array( 'Xml', 'encodeJsVar' ), $params ) ); $script .= "addButton($paramList);\n"; } - $toolbar .= Html::inlineScript( "\n$script\n" ); - + + $wgOut->addScript( Html::inlineScript( + "if ( mediaWiki !== undefined ) { mediaWiki.loader.using( 'mediawiki.legacy.edit', function() { $script } ); }" + ) ); + $toolbar .= "\n"; wfRunHooks( 'EditPageBeforeEditToolbar', array( &$toolbar ) ); diff --git a/includes/HTMLForm.php b/includes/HTMLForm.php index 9e8e82fb3dc..9239d4da6ac 100644 --- a/includes/HTMLForm.php +++ b/includes/HTMLForm.php @@ -158,7 +158,7 @@ class HTMLForm { global $wgOut, $wgStylePath; - $wgOut->addScriptFile( "$wgStylePath/common/htmlform.js" ); + $wgOut->addModules( 'mediawiki.legacy.htmlform' ); } /** diff --git a/includes/HistoryPage.php b/includes/HistoryPage.php index 2a8e193f974..e328e9187e6 100644 --- a/includes/HistoryPage.php +++ b/includes/HistoryPage.php @@ -81,7 +81,7 @@ class HistoryPage { $wgOut->setRobotPolicy( 'noindex,nofollow' ); $wgOut->setSyndicated( true ); $wgOut->setFeedAppendQuery( 'action=history' ); - $wgOut->addScriptFile( 'history.js' ); + $wgOut->addModules( array( 'mediawiki.legacy.history' ) ); $logPage = SpecialPage::getTitleFor( 'Log' ); $logLink = $this->skin->link( diff --git a/includes/ImagePage.php b/includes/ImagePage.php index c760f1ed7a7..91fd25db136 100644 --- a/includes/ImagePage.php +++ b/includes/ImagePage.php @@ -147,7 +147,7 @@ class ImagePage extends Article { $collapse = htmlspecialchars( Xml::escapeJsString( wfMsg( 'metadata-collapse' ) ) ); $wgOut->addHTML( Xml::element( 'h2', array( 'id' => 'metadata' ), wfMsg( 'metadata' ) ) . "\n" ); $wgOut->addWikiText( $this->makeMetadataTable( $formattedMetadata ) ); - $wgOut->addScriptFile( 'metadata.js' ); + $wgOut->addModules( array( 'mediawiki.legacy.metadata' ) ); $wgOut->addHTML( "\n" ); } diff --git a/includes/JSMin.php b/includes/JSMin.php index e9106a4d9ca..9b42ca0ba33 100644 --- a/includes/JSMin.php +++ b/includes/JSMin.php @@ -60,8 +60,11 @@ class JSMin { // -- Public Static Methods -------------------------------------------------- public static function minify( $js ) { + wfProfileIn( __METHOD__ ); $jsmin = new JSMin( $js ); - return $jsmin->min(); + $ret = $jsmin->min(); + wfProfileOut( __METHOD__ ); + return $ret; } // -- Public Instance Methods ------------------------------------------------ diff --git a/includes/Linker.php b/includes/Linker.php index f466519c73b..e1ebbbe58b4 100644 --- a/includes/Linker.php +++ b/includes/Linker.php @@ -1328,16 +1328,7 @@ class Linker { '
' . '

' . $title . "

\n" . $toc - # no trailing newline, script should not be wrapped in a - # paragraph - . "\n
" - . Html::inlineScript( - 'if (window.showTocToggle) {' - . ' var tocShowText = "' . Xml::escapeJsString( wfMsg( 'showtoc' ) ) . '";' - . ' var tocHideText = "' . Xml::escapeJsString( wfMsg( 'hidetoc' ) ) . '";' - . ' showTocToggle();' - . ' } ' ) - . "\n"; + . "\n\n"; } /** diff --git a/includes/LocalisationCache.php b/includes/LocalisationCache.php index 12925b68cd4..ff96c1f7d04 100644 --- a/includes/LocalisationCache.php +++ b/includes/LocalisationCache.php @@ -621,6 +621,9 @@ class LocalisationCache { } } $this->store->finishWrite(); + + # Clear out the MessageBlobStore + MessageBlobStore::clear(); wfProfileOut( __METHOD__ ); } diff --git a/includes/MessageBlobStore.php b/includes/MessageBlobStore.php new file mode 100644 index 00000000000..8fc72d04ba5 --- /dev/null +++ b/includes/MessageBlobStore.php @@ -0,0 +1,329 @@ +insert( 'msg_resource', array( + 'mr_lang' => $lang, + 'mr_resource' => $module, + 'mr_blob' => $blob, + 'mr_timestamp' => $dbw->timestamp() + ), + __METHOD__, + array( 'IGNORE' ) + ); + if ( $success ) { + if ( $dbw->affectedRows() == 0 ) { + // Blob was already present, fetch it + $blob = $dbr->selectField( 'msg_resource', 'mr_blob', array( + 'mr_resource' => $module, + 'mr_lang' => $lang, + ), + __METHOD__ + ); + } else { + // Update msg_resource_links + $rows = array(); + $mod = ResourceLoader::getModule( $module ); + foreach ( $mod->getMessages() as $key ) { + $rows[] = array( + 'mrl_resource' => $module, + 'mrl_message' => $key + ); + } + $dbw->insert( 'msg_resource_links', $rows, + __METHOD__, array( 'IGNORE' ) + ); + } + } + return $blob; + } + + /** + * Update all message blobs for a given module. + * @param $module string Module name + * @param $lang string Language code (optional) + * @return mixed If $lang is set, the new message blob for that language is returned if present. Otherwise, null is returned. + */ + public static function updateModule( $module, $lang = null ) { + $retval = null; + + // Find all existing blobs for this module + $dbw = wfGetDb( DB_MASTER ); + $res = $dbw->select( 'msg_resource', array( 'mr_lang', 'mr_blob' ), + array( 'mr_resource' => $module ), + __METHOD__ + ); + + // Build the new msg_resource rows + $newRows = array(); + $now = $dbw->timestamp(); + // Save the last-processed old and new blobs for later + $oldBlob = $newBlob = null; + foreach ( $res as $row ) { + $oldBlob = $row->mr_blob; + $newBlob = self::generateMessageBlob( $module, $row->mr_lang ); + if ( $row->mr_lang === $lang ) { + $retval = $newBlob; + } + $newRows[] = array( + 'mr_resource' => $module, + 'mr_lang' => $row->mr_lang, + 'mr_blob' => $newBlob, + 'mr_timestamp' => $now + ); + } + + $dbw->replace( 'msg_resource', + array( array( 'mr_resource', 'mr_lang' ) ), + $newRows, __METHOD__ + ); + + // Figure out which messages were added and removed + $oldMessages = array_keys( FormatJson::decode( $oldBlob, true ) ); + $newMessages = array_keys( FormatJson::decode( $newBlob, true ) ); + $added = array_diff( $newMessages, $oldMessages ); + $removed = array_diff( $oldMessages, $newMessages ); + + // Delete removed messages, insert added ones + if ( $removed ) { + $dbw->delete( 'msg_resource_links', array( + 'mrl_resource' => $module, + 'mrl_message' => $removed + ), __METHOD__ + ); + } + $newLinksRows = array(); + foreach ( $added as $message ) { + $newLinksRows[] = array( + 'mrl_resource' => $module, + 'mrl_message' => $message + ); + } + if ( $newLinksRows ) { + $dbw->insert( 'msg_resource_links', $newLinksRows, __METHOD__, + array( 'IGNORE' ) // just in case + ); + } + + return $retval; + } + + /** + * Update a single message in all message blobs it occurs in. + * @param $key string Message key + */ + public static function updateMessage( $key ) { + $dbw = wfGetDb( DB_MASTER ); + + // Keep running until the updates queue is empty. + // Due to update conflicts, the queue might not be emptied + // in one iteration. + $updates = null; + do { + $updates = self::getUpdatesForMessage( $key, $updates ); + foreach ( $updates as $key => $update ) { + // Update the row on the condition that it + // didn't change since we fetched it by putting + // the timestamp in the WHERE clause. + $success = $dbw->update( 'msg_resource', + array( 'mr_blob' => $update['newBlob'], + 'mr_timestamp' => $dbw->timestamp() ), + array( 'mr_resource' => $update['resource'], + 'mr_lang' => $update['lang'], + 'mr_timestamp' => $update['timestamp'] ), + __METHOD__ + ); + + // Only requeue conflicted updates. + // If update() returned false, don't retry, for + // fear of getting into an infinite loop + if ( !( $success && $dbw->affectedRows() == 0 ) ) { + // Not conflicted + unset( $updates[$key] ); + } + } + } while ( count( $updates ) ); + + // No need to update msg_resource_links because we didn't add + // or remove any messages, we just changed their contents. + } + + public static function clear() { + // TODO: Give this some more thought + // TODO: Is TRUNCATE better? + $dbw = wfGetDb( DB_MASTER ); + $dbw->delete( 'msg_resource', '*', __METHOD__ ); + $dbw->delete( 'msg_resource_links', '*', __METHOD__ ); + } + + /** + * Create an update queue for updateMessage() + * @param $key string Message key + * @param $prevUpdates array Updates queue to refresh or null to build a fresh update queue + * @return array Updates queue + */ + private static function getUpdatesForMessage( $key, $prevUpdates = null ) { + $dbw = wfGetDb( DB_MASTER ); + if ( is_null( $prevUpdates ) ) { + // Fetch all blobs referencing $key + $res = $dbw->select( + array( 'msg_resource', 'msg_resource_links' ), + array( 'mr_resource', 'mr_lang', 'mr_blob', 'mr_timestamp' ), + array( 'mrl_message' => $key, 'mr_resource=mrl_resource' ), + __METHOD__ + ); + } else { + // Refetch the blobs referenced by $prevUpdates + + // Reorganize the (resource, lang) pairs in the format + // expected by makeWhereFrom2d() + $twoD = array(); + foreach ( $prevUpdates as $update ) { + $twoD[$update['resource']][$update['lang']] = true; + } + + $res = $dbw->select( 'msg_resource', + array( 'mr_resource', 'mr_lang', 'mr_blob', 'mr_timestamp' ), + $dbw->makeWhereFrom2d( $twoD, 'mr_resource', 'mr_lang' ), + __METHOD__ + ); + } + + // Build the new updates queue + $updates = array(); + foreach ( $res as $row ) { + $updates[] = array( + 'resource' => $row->mr_resource, + 'lang' => $row->mr_lang, + 'timestamp' => $row->mr_timestamp, + 'newBlob' => self::reencodeBlob( $row->mr_blob, + $key, $row->mr_lang ) + ); + } + return $updates; + } + + /** + * Reencode a message blob with the updated value for a message + * @param $blob string Message blob (JSON object) + * @param $key string Message key + * @param $lang string Language code + * @return Message blob with $key replaced with its new value + */ + private static function reencodeBlob( $blob, $key, $lang ) { + $decoded = FormatJson::decode( $blob, true ); + $decoded[$key] = wfMsgExt( $key, array( 'language' => $lang ) ); + return FormatJson::encode( $decoded ); + } + + /** + * Get the message blobs for a set of modules from the database. + * Modules whose blobs are not in the database are silently dropped. + * @param $modules array Array of module names + * @param $lang string Language code + * @return array Array mapping module names to blobs + */ + private static function getFromDB( $modules, $lang ) { + $retval = array(); + $dbr = wfGetDB( DB_SLAVE ); + $res = $dbr->select( 'msg_resource', array( 'mr_blob', 'mr_resource', 'mr_timestamp' ), + array( 'mr_resource' => $modules, 'mr_lang' => $lang ), + __METHOD__ + ); + foreach ( $res as $row ) { + $module = ResourceLoader::getModule( $row->mr_resource ); + if ( !$module ) { + // This shouldn't be possible + throw new MWException( __METHOD__ . ' passed an invalid module name' ); + } + if ( array_keys( FormatJson::decode( $row->mr_blob, true ) ) !== $module->getMessages() ) { + $retval[$row->mr_resource] = self::updateModule( $row->mr_resource, $lang ); + } else { + $retval[$row->mr_resource] = $row->mr_blob; + } + } + return $retval; + } + + /** + * Generate the message blob for a given module in a given language. + * @param $module string Module name + * @param $lang string Language code + * @return string JSON object + */ + private static function generateMessageBlob( $module, $lang ) { + $mod = ResourceLoader::getModule( $module ); + $messages = array(); + foreach ( $mod->getMessages() as $key ) { + $messages[$key] = wfMsgExt( $key, array( 'language' => $lang ) ); + } + return FormatJson::encode( $messages ); + } +} diff --git a/includes/MessageCache.php b/includes/MessageCache.php index bf2d7bd1a36..db18b1d5a94 100644 --- a/includes/MessageCache.php +++ b/includes/MessageCache.php @@ -411,7 +411,7 @@ class MessageCache { return; } - list( , $code ) = $this->figureMessage( $title ); + list( $msg, $code ) = $this->figureMessage( $title ); $cacheKey = wfMemcKey( 'messages', $code ); $this->load( $code ); @@ -451,6 +451,10 @@ class MessageCache { $sidebarKey = wfMemcKey( 'sidebar', $code ); $parserMemc->delete( $sidebarKey ); } + + // Update the message in the message blob store + global $wgContLang; + MessageBlobStore::updateMessage( $wgContLang->lcfirst( $msg ) ); wfRunHooks( "MessageCacheReplace", array( $title, $text ) ); @@ -807,7 +811,7 @@ class MessageCache { } public function figureMessage( $key ) { - global $wgContLanguageCode; + global $wgContLanguageCode, $wgContLang; $pieces = explode( '/', $key ); if( count( $pieces ) < 2 ) return array( $key, $wgContLanguageCode ); diff --git a/includes/OutputPage.php b/includes/OutputPage.php index 343a352c1d3..8154d033e46 100644 --- a/includes/OutputPage.php +++ b/includes/OutputPage.php @@ -24,6 +24,7 @@ class OutputPage { var $mCategoryLinks = array(), $mCategories = array(), $mLanguageLinks = array(); var $mScripts = '', $mLinkColours, $mPageLinkTitle = '', $mHeadItems = array(); + var $mModules = array(), $mModuleScripts = array(), $mModuleStyles = array(), $mModuleMessages = array(); var $mInlineMsg = array(); var $mTemplateIds = array(); @@ -224,6 +225,78 @@ class OutputPage { return $this->mScripts . $this->getHeadItems(); } + /** + * Get the list of modules to include on this page + * @return array of module names + */ + public function getModules() { + return $this->mModules; + } + + /** + * Add one or more modules recognized by the resource loader. Modules added + * through this function will be loaded by the resource loader when the + * page loads. + * @param $module mixed Module name (string) or array of module names + */ + public function addModules( $modules ) { + $this->mModules = array_merge( $this->mModules, (array)$modules ); + } + + /** + * Get the list of module JS to include on this page + * @return array of module names + */ + public function getModuleScripts() { + return $this->mModuleScripts; + } + + /** + * Add only JS of one or more modules recognized by the resource loader. Module + * scripts added through this function will be loaded by the resource loader when + * the page loads. + * @param $module mixed Module name (string) or array of module names + */ + public function addModuleScripts( $modules ) { + $this->mModuleScripts = array_merge( $this->mModuleScripts, (array)$modules ); + } + + /** + * Get the list of module CSS to include on this page + * @return array of module names + */ + public function getModuleStyles() { + return $this->mModuleStyles; + } + + /** + * Add only CSS of one or more modules recognized by the resource loader. Module + * styles added through this function will be loaded by the resource loader when + * the page loads. + * @param $module mixed Module name (string) or array of module names + */ + public function addModuleStyles( $modules ) { + $this->mModuleStyles = array_merge( $this->mModuleStyles, (array)$modules ); + } + + /** + * Get the list of module messages to include on this page + * @return array of module names + */ + public function getModuleMessages() { + return $this->mModuleMessages; + } + + /** + * Add only messages of one or more modules recognized by the resource loader. + * Module messages added through this function will be loaded by the resource + * loader when the page loads. + * @param $module mixed Module name (string) or array of module names + */ + public function addModuleMessages( $modules ) { + $this->mModuleMessages = array_merge( $this->mModuleMessages, (array)$modules ); + } + /** * Get all header items in a string * @@ -1095,6 +1168,7 @@ class OutputPage { } $this->mNoGallery = $parserOutput->getNoGallery(); $this->mHeadItems = array_merge( $this->mHeadItems, $parserOutput->getHeadItems() ); + $this->addModules( $parserOutput->getModules() ); // Versioning... foreach ( (array)$parserOutput->mTemplateIds as $ns => $dbks ) { if ( isset( $this->mTemplateIds[$ns] ) ) { @@ -1528,24 +1602,27 @@ class OutputPage { } $sk = $wgUser->getSkin(); - + + // Add base resources + $this->addModules( array( 'mediawiki.legacy.wikibits' ) ); + + // Add various resources if required if ( $wgUseAjax ) { - $this->addScriptFile( 'ajax.js' ); + $this->addModules( 'mediawiki.legacy.ajax' ); wfRunHooks( 'AjaxAddScript', array( &$this ) ); if( $wgAjaxWatch && $wgUser->isLoggedIn() ) { - $this->includeJQuery(); - $this->addScriptFile( 'ajaxwatch.js' ); + $this->addModules( 'mediawiki.legacy.ajaxwatch' ); } if ( $wgEnableMWSuggest && !$wgUser->getOption( 'disablesuggest', false ) ) { - $this->addScriptFile( 'mwsuggest.js' ); + $this->addModules( 'mediawiki.legacy.mwsuggest' ); } } if( $wgUser->getBoolOption( 'editsectiononrightclick' ) ) { - $this->addScriptFile( 'rightclickedit.js' ); + $this->addModules( 'mediawiki.legacy.rightclickedit' ); } if( $wgUniversalEditButton ) { @@ -1568,9 +1645,6 @@ class OutputPage { } } - if ( $wgJQueryOnEveryPage ) { - $this->includeJQuery(); - } # Buffer output; final headers may depend on later processing ob_start(); @@ -1975,8 +2049,7 @@ class OutputPage { $data['messages'][$message] = wfMsg( $message ); } $this->addScript( Html::inlineScript( 'var passwordSecurity=' . FormatJson::encode( $data ) ) ); - $this->addScriptFile( 'password.js' ); - $this->addStyle( 'common/password.css' ); + $this->addModules( 'mediawiki.legacy.password' ); } /** @deprecated */ @@ -2145,9 +2218,9 @@ class OutputPage { $ret .= Html::element( 'title', null, $this->getHTMLTitle() ) . "\n"; $ret .= implode( "\n", array( - $this->getHeadLinks(), + $this->getHeadLinks( $sk ), $this->buildCssLinks(), - $this->getHeadScripts( $sk ) . $this->getHeadItems(), + $this->getHeadItems(), ) ); if ( $sk->usercss ) { $ret .= Html::inlineStyle( $sk->usercss ); @@ -2199,34 +2272,70 @@ class OutputPage { return $ret; } - + + static function makeResourceLoaderLink( $skin, $modules, $only ) { + global $wgUser, $wgLang, $wgRequest, $wgScriptPath; + // TODO: Should this be a static function of ResourceLoader instead? + $query = array( + 'modules' => implode( '|', array_unique( (array) $modules ) ), + 'lang' => $wgLang->getCode(), + 'debug' => $wgRequest->getBool( 'debug' ) && $wgRequest->getVal( 'debug' ) !== 'false', + 'skin' => $wgUser->getSkin()->getSkinName(), + 'only' => $only, + ); + // Automatically select style/script elements + if ( $only === 'styles' ) { + return Html::linkedStyle( wfAppendQuery( $wgScriptPath . '/load.php', $query ) ); + } else { + return Html::linkedScript( wfAppendQuery( $wgScriptPath . '/load.php', $query ) ); + } + } + /** * Gets the global variables and mScripts; also adds userjs to the end if - * enabled + * enabled. Despite the name, these scripts are no longer put in the + * but at the bottom of the * * @param $sk Skin object to use * @return String: HTML fragment */ function getHeadScripts( Skin $sk ) { - global $wgUser, $wgRequest, $wgJsMimeType, $wgUseSiteJs; - global $wgStylePath, $wgStyleVersion; - - $scripts = Skin::makeGlobalVariablesScript( $sk->getSkinName() ) . "\n"; - $scripts .= Html::linkedScript( "{$wgStylePath}/common/wikibits.js?$wgStyleVersion" ); - - // add site JS if enabled - if( $wgUseSiteJs ) { - $jsCache = $wgUser->isLoggedIn() ? '&smaxage=0' : ''; - $this->addScriptFile( - Skin::makeUrl( - '-', - "action=raw$jsCache&gen=js&useskin=" . - urlencode( $sk->getSkinName() ) - ) + global $wgUser, $wgRequest, $wgJsMimeType; + global $wgStylePath, $wgStyleVersion, $wgUseSiteJs; + + // Statup - this will immediately load jquery and mediawiki modules + $scripts = self::makeResourceLoaderLink( $sk, 'startup', 'scripts' ); + // Configuration + $scripts .= Skin::makeGlobalVariablesScript( $sk->getSkinName() ) . "\n"; + // Support individual script requests in debug mode + if ( $wgRequest->getBool( 'debug' ) && $wgRequest->getVal( 'debug' ) !== 'false' ) { + // Scripts + foreach ( $this->getModuleScripts() as $name ) { + $scripts .= self::makeResourceLoaderLink( $sk, $name, 'scripts' ); + } + // Messages + foreach ( $this->getModuleMessages() as $name ) { + $scripts .= self::makeResourceLoaderLink( $sk, $name, 'messages' ); + } + } else { + // Scripts + if ( count( $this->getModuleScripts() ) ) { + $scripts .= self::makeResourceLoaderLink( $sk, $this->getModuleScripts(), 'scripts' ); + } + // Messages + if ( count( $this->getModuleMessages() ) ) { + $scripts .= self::makeResourceLoaderLink( $sk, $this->getModuleMessages(), 'messages' ); + } + } + if ( $this->getModules() ) { + // Modules - let the client calculate dependencies and batch requests as it likes + $modules = FormatJson::encode( $this->getModules() ); + $scripts .= Html::inlineScript( + "if ( mediaWiki !== undefined ) { mediaWiki.loader.load( {$modules} ); }" ); } - - // add user JS if enabled + // TODO: User Scripts should be included using the resource loader + // Add user JS if enabled if( $this->isUserJsAllowed() && $wgUser->isLoggedIn() ) { $action = $wgRequest->getVal( 'action', 'view' ); if( $this->mTitle && $this->mTitle->isJsSubpage() && $sk->userCanPreview( $action ) ) { @@ -2234,12 +2343,8 @@ class OutputPage { $this->addInlineScript( $wgRequest->getText( 'wpTextbox1' ) ); } else { $userpage = $wgUser->getUserPage(); - $names = array( 'common', $sk->getSkinName() ); - foreach( $names as $name ) { - $scriptpage = Title::makeTitleSafe( - NS_USER, - $userpage->getDBkey() . '/' . $name . '.js' - ); + foreach( array( 'common', $sk->getSkinName() ) as $name ) { + $scriptpage = Title::makeTitleSafe( NS_USER, $userpage->getDBkey() . '/' . $name . '.js' ); if ( $scriptpage && $scriptpage->exists() && ( $scriptpage->getLength() > 0 ) ) { $userjs = $scriptpage->getLocalURL( 'action=raw&ctype=' . $wgJsMimeType ); $this->addScriptFile( $userjs, $scriptpage->getLatestRevID() ); @@ -2247,8 +2352,14 @@ class OutputPage { } } } - $scripts .= "\n" . $this->mScripts; + // This should be at the bottom of the body - below ALL other scripts + $scripts .= Html::inlineScript( "if ( mediaWiki !== undefined ) { mediaWiki.loader.go(); }" ); + // Add site JS if enabled + if ( $wgUseSiteJs ) { + $scripts .= self::makeResourceLoaderLink( $sk, 'sitejs', 'scripts' ); + } + return $scripts; } @@ -2296,8 +2407,8 @@ class OutputPage { /** * @return string HTML tag links to be put in the header. */ - public function getHeadLinks() { - global $wgFeed; + public function getHeadLinks( $sk ) { + global $wgFeed, $wgRequest; // Ideally this should happen earlier, somewhere. :P $this->addDefaultMeta(); @@ -2367,6 +2478,17 @@ class OutputPage { } } + // Support individual script requests in debug mode + if ( $wgRequest->getBool( 'debug' ) && $wgRequest->getVal( 'debug' ) !== 'false' ) { + foreach ( $this->getModuleStyles() as $name ) { + $tags[] = self::makeResourceLoaderLink( $sk, $name, 'styles' ); + } + } else { + if ( count( $this->getModuleStyles() ) ) { + $tags[] = self::makeResourceLoaderLink( $sk, $this->getModuleStyles(), 'styles' ); + } + } + return implode( "\n", $tags ); } @@ -2637,20 +2759,10 @@ class OutputPage { * @param $modules Array: list of jQuery modules which should be loaded * @return Array: the list of modules which were not loaded. * @since 1.16 + * @deprecated No longer needed as of 1.17 */ public function includeJQuery( $modules = array() ) { - global $wgStylePath, $wgStyleVersion, $wgJQueryVersion, $wgJQueryMinified; - - $supportedModules = array( /** TODO: add things here */ ); - $unsupported = array_diff( $modules, $supportedModules ); - - $min = $wgJQueryMinified ? '.min' : ''; - $url = "$wgStylePath/common/jquery-$wgJQueryVersion$min.js?$wgStyleVersion"; - if ( !$this->mJQueryDone ) { - $this->mJQueryDone = true; - $this->mScripts = Html::linkedScript( $url ) . "\n" . $this->mScripts; - } - return $unsupported; + return array(); } } diff --git a/includes/ProtectionForm.php b/includes/ProtectionForm.php index 655b0be538e..807cdc2f710 100644 --- a/includes/ProtectionForm.php +++ b/includes/ProtectionForm.php @@ -330,14 +330,14 @@ class ProtectionForm { * @return String: HTML form */ function buildForm() { - global $wgUser, $wgLang; + global $wgUser, $wgLang, $wgOut; $mProtectreasonother = Xml::label( wfMsg( 'protectcomment' ), 'wpProtectReasonSelection' ); $mProtectreason = Xml::label( wfMsg( 'protect-otherreason' ), 'mwProtect-reason' ); $out = ''; if( !$this->disabled ) { - $out .= $this->buildScript(); + $wgOut->addModules( 'mediawiki.legacy.protect' ); $out .= Xml::openElement( 'form', array( 'method' => 'post', 'action' => $this->mTitle->getLocalUrl( 'action=protect' ), 'id' => 'mw-Protect-Form', 'onsubmit' => 'ProtectionForm.enableUnchainedInputs(true)' ) ); @@ -508,8 +508,8 @@ class ProtectionForm { } if ( !$this->disabled ) { - $out .= Xml::closeElement( 'form' ) . - $this->buildCleanupScript(); + $out .= Xml::closeElement( 'form' ); + $wgOut->addScript( $this->buildCleanupScript() ); } return $out; @@ -572,12 +572,7 @@ class ProtectionForm { return $msg; } } - - function buildScript() { - global $wgStylePath, $wgStyleVersion; - return Html::linkedScript( "$wgStylePath/common/protect.js?$wgStyleVersion.1" ); - } - + function buildCleanupScript() { global $wgRestrictionLevels, $wgGroupPermissions; $script = 'var wgCascadeableLevels='; @@ -597,7 +592,7 @@ class ProtectionForm { $encOptions = Xml::encodeJsVar( $options ); $script .= "ProtectionForm.init($encOptions)"; - return Html::inlineScript( $script ); + return Html::inlineScript( "if ( mediaWiki !== undefined ) { mediaWiki.loader.using( 'mediawiki.legacy.protect', function() { {$script} } ); }" ); } /** diff --git a/includes/RawPage.php b/includes/RawPage.php index 03cb4a15213..3787617026f 100644 --- a/includes/RawPage.php +++ b/includes/RawPage.php @@ -78,10 +78,6 @@ class RawPage { $this->mGen = $gen; if( is_null( $smaxage ) ) $smaxage = $wgSquidMaxage; if($ctype == '') $ctype = 'text/css'; - } elseif( $gen == 'js' ) { - $this->mGen = $gen; - if( is_null( $smaxage ) ) $smaxage = $wgSquidMaxage; - if($ctype == '') $ctype = $wgJsMimeType; } else { $this->mGen = false; } @@ -169,8 +165,6 @@ class RawPage { $sk->initPage( $wgOut ); if( $this->mGen == 'css' ) { return $sk->generateUserStylesheet(); - } else if( $this->mGen == 'js' ) { - return $sk->generateUserJs(); } } else { return $this->getArticleText(); diff --git a/includes/ResourceLoader.php b/includes/ResourceLoader.php new file mode 100644 index 00000000000..b59d6019ca7 --- /dev/null +++ b/includes/ResourceLoader.php @@ -0,0 +1,339 @@ + 'resources/foo/foo.js', + * // List of scripts or lists of scripts to include based on the current language + * 'locales' => array( + * 'en-gb' => 'resources/foo/locales/en-gb.js', + * ), + * // Script or list of scripts to include only when in debug mode + * 'debug' => 'resources/foo/debug.js', + * // If this module is going to be loaded before the mediawiki module is ready such as jquery or the mediawiki + * // module itself, it can be included without special loader wrapping - this will also limit the module to not be + * // able to specify needs, custom loaders, styles, themes or messages (any of the options below) - raw scripts + * // get registered as 'ready' after the mediawiki module is ready, so they can be named as dependencies + * 'raw' => false, + * // Modules or list of modules which are needed and should be used when generating loader code + * 'needs' => 'resources/foo/foo.js', + * // Script or list of scripts which will cause loader code to not be generated - if you are doing something fancy + * // with your dependencies this gives you a way to use custom registration code + * 'loader' => 'resources/foo/loader.js', + * // Style-sheets or list of style-sheets to include + * 'style' => 'resources/foo/foo.css', + * // List of style-sheets or lists of style-sheets to include based on the skin - if no match is found for current + * // skin, 'default' is used - if default doesn't exist nothing is added + * 'themes' => array( + * 'default' => 'resources/foo/themes/default/foo.css', + * 'vector' => 'resources/foo/themes/vector.foo.css', + * ), + * // List of keys of messages to include + * 'messages' => array( 'foo-hello', 'foo-goodbye' ), + * // Subclass of ResourceLoaderModule to use for custom modules + * 'class' => 'ResourceLoaderSiteJSModule', + * ) ); + * @example + * // Responds to a resource loading request + * ResourceLoader::respond( $wgRequest, $wgServer . $wgScriptPath . '/load.php' ); + */ +class ResourceLoader { + + /* Protected Static Members */ + + // @var array list of module name/ResourceLoaderModule object pairs + protected static $modules = array(); + + /* Protected Static Methods */ + + /** + * Runs text through a filter, caching the filtered result for future calls + * + * @param {string} $filter name of filter to run + * @param {string} $data text to filter, such as JavaScript or CSS text + * @param {string} $file path to file being filtered, (optional: only required for CSS to resolve paths) + * @return {string} filtered data + */ + protected static function filter( $filter, $data ) { + global $wgMemc; + // For empty or whitespace-only things, don't do any processing + if ( trim( $data ) === '' ) { + return $data; + } + + // Try memcached + $key = wfMemcKey( 'resourceloader', 'filter', $filter, md5( $data ) ); + $cached = $wgMemc->get( $key ); + if ( $cached !== false && $cached !== null ) { + return $cached; + } + + // Run the filter + try { + switch ( $filter ) { + case 'minify-js': + $result = JSMin::minify( $data ); + break; + case 'minify-css': + $result = CSSMin::minify( $data ); + break; + case 'flip-css': + $result = CSSJanus::transform( $data, true, false ); + break; + default: + // Don't cache anything, just pass right through + return $data; + } + } catch ( Exception $exception ) { + throw new MWException( 'Filter threw an exception: ' . $exception->getMessage() ); + } + + // Save to memcached + $wgMemc->set( $key, $result ); + return $result; + } + + /* Static Methods */ + + /** + * Registers a module with the ResourceLoader system. + * + * Note that registering the same object under multiple names is not supported and may silently fail in all + * kinds of interesting ways. + * + * @param {mixed} $name string of name of module or array of name/object pairs + * @param {ResourceLoaderModule} $object module object (optional when using multiple-registration calling style) + * @return {boolean} false if there were any errors, in which case one or more modules were not registered + * + * @todo We need much more clever error reporting, not just in detailing what happened, but in bringing errors to + * the client in a way that they can easily see them if they want to, such as by using FireBug + */ + public static function register( $name, ResourceLoaderModule $object = null ) { + // Allow multiple modules to be registered in one call + if ( is_array( $name ) && !isset( $object ) ) { + foreach ( $name as $key => $value ) { + self::register( $key, $value ); + } + return; + } + // Disallow duplicate registrations + if ( isset( self::$modules[$name] ) ) { + // A module has already been registered by this name + throw new MWException( 'Another module has already been registered as ' . $name ); + } + // Attach module + self::$modules[$name] = $object; + $object->setName( $name ); + } + + /** + * Gets a map of all modules and their options + * + * @return {array} array( modulename => ResourceLoaderModule ) + */ + public static function getModules() { + return self::$modules; + } + + /** + * Get the ResourceLoaderModule object for a given module name + * @param $name string Module name + * @return mixed ResourceLoaderModule or null if not registered + */ + public static function getModule( $name ) { + return isset( self::$modules[$name] ) ? self::$modules[$name] : null; + } + + /** + * Gets registration code for all modules, except pre-registered ones listed in self::$preRegisteredModules + * + * The $lang, $skin and $debug parameters are used to calculate the last modified timestamps for each + * module. + * @param $lang string Language code + * @param $skin string Skin name + * @param $debug bool Debug mode flag + * @return {string} JavaScript code for registering all modules with the client loader + */ + public static function getModuleRegistrations( ResourceLoaderContext $context ) { + $scripts = ''; + $registrations = array(); + foreach ( self::$modules as $name => $module ) { + // Support module loader scripts + if ( ( $loader = $module->getLoaderScript() ) !== false ) { + $scripts .= $loader; + } + // Automatically register module + else { + // Modules without dependencies pass two arguments (name, timestamp) to mediaWiki.loader.register() + if ( !count( $module->getDependencies() ) ) { + $registrations[] = array( $name, $module->getModifiedTime( $context ) ); + } + // Modules with dependencies pass three arguments (name, timestamp, dependencies) to mediaWiki.loader.register() + else { + $registrations[] = array( $name, $module->getModifiedTime( $context ), $module->getDependencies() ); + } + } + } + return $scripts . "mediaWiki.loader.register( " . FormatJson::encode( $registrations ) . " );"; + } + + /** + * Get the highest modification time of all modules, based on a given combination of language code, + * skin name and debug mode flag. + * @param $lang string Language code + * @param $skin string Skin name + * @param $debug bool Debug mode flag + * @return int UNIX timestamp + */ + public static function getHighestModifiedTime( ResourceLoaderContext $context ) { + $time = 1; // wfTimestamp() treats 0 as 'now', so that's not a suitable choice + foreach ( self::$modules as $module ) { + $time = max( $time, $module->getModifiedTime( $context ) ); + } + return $time; + } + + /* Methods */ + + /* + * Outputs a response to a resource load-request, including a content-type header + * + * @param {WebRequest} $request web request object to respond to + * @param {string} $server web-accessible path to script server + * + * $options format: + * array( + * 'lang' => [string: language code, optional, code of default language by default], + * 'skin' => [string: name of skin, optional, name of default skin by default], + * 'dir' => [string: 'ltr' or 'rtl', optional, direction of lang by default], + * 'debug' => [boolean: true to include debug-only scripts, optional, false by default], + * 'only' => [string: 'scripts', 'styles' or 'messages', optional, if set only get part of the requested module] + * ) + */ + public static function respond( ResourceLoaderContext $context ) { + // Split requested modules into two groups, modules and missing + $modules = array(); + $missing = array(); + foreach ( $context->getModules() as $name ) { + if ( isset( self::$modules[$name] ) ) { + $modules[] = $name; + } else { + $missing[] = $name; + } + } + + // Calculate the mtime and caching maxages for this request. We need this, 304 or no 304 + $mtime = 1; + $maxage = PHP_INT_MAX; + $smaxage = PHP_INT_MAX; + foreach ( $modules as $name ) { + $mtime = max( $mtime, self::$modules[$name]->getModifiedTime( $context ) ); + $maxage = min( $maxage, self::$modules[$name]->getClientMaxage() ); + $smaxage = min( $smaxage, self::$modules[$name]->getServerMaxage() ); + } + header( 'Last-Modified: ' . wfTimestamp( TS_RFC2822, $mtime ) ); + $expires = wfTimestamp( TS_RFC2822, min( $maxage, $smaxage ) + time() ); + header( "Cache-Control: public, maxage=$maxage, s-maxage=$smaxage" ); + header( "Expires: $expires" ); + + // Check if there's an If-Modified-Since header and respond with a 304 Not Modified if possible + $ims = $context->getRequest()->getHeader( 'If-Modified-Since' ); + if ( $ims !== false && wfTimestamp( TS_UNIX, $ims ) == $mtime ) { + header( 'HTTP/1.0 304 Not Modified' ); + header( 'Status: 304 Not Modified' ); + return; + } + + // Use output buffering + ob_start(); + + // Pre-fetch blobs + $blobs = $context->shouldIncludeMessages() ? + MessageBlobStore::get( $modules, $context->getLanguage() ) : array(); + + // Generate output + foreach ( $modules as $name ) { + // Scripts + $scripts = ''; + if ( $context->shouldIncludeScripts() ) { + $scripts .= self::$modules[$name]->getScript( $context ); + } + // Styles + $styles = ''; + if ( + $context->shouldIncludeStyles() && + ( $styles .= self::$modules[$name]->getStyle( $context ) ) !== '' + ) { + if ( $context->getDirection() == 'rtl' ) { + $styles = self::filter( 'flip-css', $styles ); + } + $styles = $context->getDebug() ? $styles : self::filter( 'minify-css', $styles ); + } + // Messages + $messages = isset( $blobs[$name] ) ? $blobs[$name] : '{}'; + // Output + if ( $context->getOnly() === 'styles' ) { + echo $styles; + } else if ( $context->getOnly() === 'scripts' ) { + echo $scripts; + } else if ( $context->getOnly() === 'messages' ) { + echo "mediaWiki.msg.set( $messages );\n"; + } else { + $styles = Xml::escapeJsString( $styles ); + echo "mediaWiki.loader.implement( '$name', function() {{$scripts}},\n'$styles',\n$messages );\n"; + } + } + // Update the status of script-only modules + if ( $context->getOnly() === 'scripts' && !in_array( 'startup', $modules ) ) { + $statuses = array(); + foreach ( $modules as $name ) { + $statuses[$name] = 'ready'; + } + $statuses = FormatJson::encode( $statuses ); + echo "mediaWiki.loader.state( $statuses );"; + } + // Register missing modules + if ( $context->shouldIncludeScripts() ) { + foreach ( $missing as $name ) { + echo "mediaWiki.loader.register( '$name', null, 'missing' );\n"; + } + } + // Output the appropriate header + if ( $context->getOnly() === 'styles' ) { + header( 'Content-Type: text/css' ); + } else { + header( 'Content-Type: text/javascript' ); + if ( $context->getDebug() ) { + ob_end_flush(); + } else { + echo self::filter( 'minify-js', ob_get_clean() ); + } + } + } +} + +// FIXME: Temp hack +require_once "$IP/resources/Resources.php"; \ No newline at end of file diff --git a/includes/ResourceLoaderContext.php b/includes/ResourceLoaderContext.php new file mode 100644 index 00000000000..36d9cea6545 --- /dev/null +++ b/includes/ResourceLoaderContext.php @@ -0,0 +1,113 @@ +request = $request; + $this->server = $server; + // Interperet request + $this->modules = explode( '|', $request->getVal( 'modules' ) ); + $this->language = $request->getVal( 'lang' ); + $this->direction = $request->getVal( 'dir' ); + $this->skin = $request->getVal( 'skin' ); + $this->debug = $request->getVal( 'debug' ) === 'true' || $request->getBool( 'debug' ); + $this->only = $request->getVal( 'only' ); + // Fallback on system defaults + if ( !$this->language ) { + $this->language = $wgLang->getCode(); + } + if ( !$this->direction ) { + $this->direction = Language::factory( $this->language )->getDir(); + } + if ( !$this->skin ) { + $this->skin = $wgDefaultSkin; + } + } + + public function getRequest() { + return $this->request; + } + + public function getServer() { + return $this->server; + } + + public function getModules() { + return $this->modules; + } + + public function getLanguage() { + return $this->language; + } + + public function getDirection() { + return $this->direction; + } + + public function getSkin() { + return $this->skin; + } + + public function getDebug() { + return $this->debug; + } + + public function getOnly() { + return $this->only; + } + + public function shouldIncludeScripts() { + return is_null( $this->only ) || $this->only === 'scripts'; + } + + public function shouldIncludeStyles() { + return is_null( $this->only ) || $this->only === 'styles'; + } + + public function shouldIncludeMessages() { + return is_null( $this->only ) || $this->only === 'messages'; + } + + public function getHash() { + return isset( $this->hash ) ? + $this->hash : $this->hash = implode( '|', array( $this->language, $this->skin, $this->debug ) ); + } +} \ No newline at end of file diff --git a/includes/ResourceLoaderModule.php b/includes/ResourceLoaderModule.php new file mode 100644 index 00000000000..874c01773d6 --- /dev/null +++ b/includes/ResourceLoaderModule.php @@ -0,0 +1,695 @@ +name; + } + + /** + * Set this module's name. This is called by ResourceLodaer::register() + * when registering the module. Other code should not call this. + * @param $name string Name + */ + public function setName( $name ) { + $this->name = $name; + } + + /** + * The maximum number of seconds to cache this module for in the + * client-side (browser) cache. Override this only if you have a good + * reason not to use $wgResourceLoaderClientMaxage. + * @return int Cache maxage in seconds + */ + public function getClientMaxage() { + global $wgResourceLoaderClientMaxage; + return $wgResourceLoaderClientMaxage; + } + + /** + * The maximum number of seconds to cache this module for in the + * server-side (Squid / proxy) cache. Override this only if you have a + * good reason not to use $wgResourceLoaderServerMaxage. + * @return int Cache maxage in seconds + */ + public function getServerMaxage() { + global $wgResourceLoaderServerMaxage; + return $wgResourceLoaderServerMaxage; + } + + /** + * Get all JS for this module for a given language and skin. + * Includes all relevant JS except loader scripts. + * @param $lang string Language code + * @param $skin string Skin name + * @param $debug bool Whether to include debug scripts + * @return string JS + */ + public abstract function getScript( ResourceLoaderContext $context ); + + /** + * Get all CSS for this module for a given skin. + * @param $skin string Skin name + * @return string CSS + */ + public abstract function getStyle( ResourceLoaderContext $context ); + + /** + * Get the messages needed for this module. + * + * To get a JSON blob with messages, use MessageBlobStore::get() + * @return array of message keys. Keys may occur more than once + */ + public abstract function getMessages(); + + /** + * Get the loader JS for this module, if set. + * @return mixed Loader JS (string) or false if no custom loader set + */ + public abstract function getLoaderScript(); + + /** + * Get a list of modules this module depends on. + * + * Dependency information is taken into account when loading a module + * on the client side. When adding a module on the server side, + * dependency information is NOT taken into account and YOU are + * responsible for adding dependent modules as well. If you don't do + * this, the client side loader will send a second request back to the + * server to fetch the missing modules, which kind of defeats the + * purpose of the resource loader. + * + * To add dependencies dynamically on the client side, use a custom + * loader script, see getLoaderScript() + * @return array Array of module names (strings) + */ + public abstract function getDependencies(); + + /** + * Get this module's last modification timestamp for a given + * combination of language, skin and debug mode flag. This is typically + * the highest of each of the relevant components' modification + * timestamps. Whenever anything happens that changes the module's + * contents for these parameters, the mtime should increase. + * @param $lang string Language code + * @param $skin string Skin name + * @param $debug bool Debug mode flag + * @return int UNIX timestamp + */ + public abstract function getModifiedTime( ResourceLoaderContext $context ); +} + +/** + * Module based on local JS/CSS files. This is the most common type of module. + */ +class ResourceLoaderFileModule extends ResourceLoaderModule { + + /* Protected Members */ + + protected $scripts = array(); + protected $styles = array(); + protected $messages = array(); + protected $dependencies = array(); + protected $debugScripts = array(); + protected $languageScripts = array(); + protected $skinScripts = array(); + protected $skinStyles = array(); + protected $loaders = array(); + protected $parameters = array(); + + // In-object cache for file dependencies + protected $fileDeps = array(); + // In-object cache for mtime + protected $modifiedTime = array(); + + /* Methods */ + + /** + * Construct a new module from an options array. + * + * @param $options array Options array. If empty, an empty module will be constructed + * + * $options format: + * array( + * // Required module options (mutually exclusive) + * 'scripts' => 'dir/script.js' | array( 'dir/script1.js', 'dir/script2.js' ... ), + * + * // Optional module options + * 'languageScripts' => array( + * '[lang name]' => 'dir/lang.js' | '[lang name]' => array( 'dir/lang1.js', 'dir/lang2.js' ... ) + * ... + * ), + * 'skinScripts' => 'dir/skin.js' | array( 'dir/skin1.js', 'dir/skin2.js' ... ), + * 'debugScripts' => 'dir/debug.js' | array( 'dir/debug1.js', 'dir/debug2.js' ... ), + * + * // Non-raw module options + * 'dependencies' => 'module' | array( 'module1', 'module2' ... ) + * 'loaderScripts' => 'dir/loader.js' | array( 'dir/loader1.js', 'dir/loader2.js' ... ), + * 'styles' => 'dir/file.css' | array( 'dir/file1.css', 'dir/file2.css' ... ), + * 'skinStyles' => array( + * '[skin name]' => 'dir/skin.css' | '[skin name]' => array( 'dir/skin1.css', 'dir/skin2.css' ... ) + * ... + * ), + * 'messages' => array( 'message1', 'message2' ... ), + * ) + */ + public function __construct( $options = array() ) { + foreach ( $options as $option => $value ) { + switch ( $option ) { + case 'scripts': + $this->scripts = (array)$value; + break; + case 'styles': + $this->styles = (array)$value; + break; + case 'messages': + $this->messages = (array)$value; + break; + case 'dependencies': + $this->dependencies = (array)$value; + break; + case 'debugScripts': + $this->debugScripts = (array)$value; + break; + case 'languageScripts': + $this->languageScripts = (array)$value; + break; + case 'skinScripts': + $this->skinScripts = (array)$value; + break; + case 'skinStyles': + $this->skinStyles = (array)$value; + break; + case 'loaders': + $this->loaders = (array)$value; + break; + } + } + } + + /** + * Add script files to this module. In order to be valid, a module + * must contain at least one script file. + * @param $scripts mixed Path to script file (string) or array of paths + */ + public function addScripts( $scripts ) { + $this->scripts = array_merge( $this->scripts, (array)$scripts ); + } + + /** + * Add style (CSS) files to this module. + * @param $styles mixed Path to CSS file (string) or array of paths + */ + public function addStyles( $styles ) { + $this->styles = array_merge( $this->styles, (array)$styles ); + } + + /** + * Add messages to this module. + * @param $messages mixed Message key (string) or array of message keys + */ + public function addMessages( $messages ) { + $this->messages = array_merge( $this->messages, (array)$messages ); + } + + /** + * Add dependencies. Dependency information is taken into account when + * loading a module on the client side. When adding a module on the + * server side, dependency information is NOT taken into account and + * YOU are responsible for adding dependent modules as well. If you + * don't do this, the client side loader will send a second request + * back to the server to fetch the missing modules, which kind of + * defeats the point of using the resource loader in the first place. + * + * To add dependencies dynamically on the client side, use a custom + * loader (see addLoaders()) + * + * @param $dependencies mixed Module name (string) or array of module names + */ + public function addDependencies( $dependencies ) { + $this->dependencies = array_merge( $this->dependencies, (array)$dependencies ); + } + + /** + * Add debug scripts to the module. These scripts are only included + * in debug mode. + * @param $scripts mixed Path to script file (string) or array of paths + */ + public function addDebugScripts( $scripts ) { + $this->debugScripts = array_merge( $this->debugScripts, (array)$scripts ); + } + + /** + * Add language-specific scripts. These scripts are only included for + * a given language. + * @param $lang string Language code + * @param $scripts mixed Path to script file (string) or array of paths + */ + public function addLanguageScripts( $lang, $scripts ) { + $this->languageScripts = array_merge_recursive( + $this->languageScripts, + array( $lang => $scripts ) + ); + } + + /** + * Add skin-specific scripts. These scripts are only included for + * a given skin. + * @param $skin string Skin name, or 'default' + * @param $scripts mixed Path to script file (string) or array of paths + */ + public function addSkinScripts( $skin, $scripts ) { + $this->skinScripts = array_merge_recursive( + $this->skinScripts, + array( $skin => $scripts ) + ); + } + + /** + * Add skin-specific CSS. These CSS files are only included for a + * given skin. If there are no skin-specific CSS files for a skin, + * the files defined for 'default' will be used, if any. + * @param $skin string Skin name, or 'default' + * @param $scripts mixed Path to CSS file (string) or array of paths + */ + public function addSkinStyles( $skin, $scripts ) { + $this->skinStyles = array_merge_recursive( + $this->skinStyles, + array( $skin => $scripts ) + ); + } + + /** + * Add loader scripts. These scripts are loaded on every page and are + * responsible for registering this module using + * mediaWiki.loader.register(). If there are no loader scripts defined, + * the resource loader will register the module itself. + * + * Loader scripts are used to determine a module's dependencies + * dynamically on the client side (e.g. based on browser type/version). + * Note that loader scripts are included on every page, so they should + * be lightweight and use mediaWiki.loader.register()'s callback + * feature to defer dependency calculation. + * @param $scripts mixed Path to script file (string) or array of paths + */ + public function addLoaders( $scripts ) { + $this->loaders = array_merge( $this->loaders, (array)$scripts ); + } + + public function getScript( ResourceLoaderContext $context ) { + $retval = $this->getPrimaryScript() . "\n" . + $this->getLanguageScript( $context->getLanguage() ) . "\n" . + $this->getSkinScript( $context->getSkin() ); + if ( $context->getDebug() ) { + $retval .= $this->getDebugScript(); + } + return $retval; + } + + public function getStyle( ResourceLoaderContext $context ) { + $style = $this->getPrimaryStyle() . "\n" . $this->getSkinStyle( $context->getSkin() ); + + // Extract and store the list of referenced files + $files = CSSMin::getLocalFileReferences( $style ); + + // Only store if modified + if ( $files !== $this->getFileDependencies( $context->getSkin() ) ) { + $encFiles = FormatJson::encode( $files ); + $dbw = wfGetDb( DB_MASTER ); + $dbw->replace( 'module_deps', + array( array( 'md_module', 'md_skin' ) ), array( + 'md_module' => $this->getName(), + 'md_skin' => $context->getSkin(), + 'md_deps' => $encFiles, + ) + ); + + // Save into memcached + global $wgMemc; + $key = wfMemcKey( 'resourceloader', 'module_deps', $this->getName(), $context->getSkin() ); + $wgMemc->set( $key, $encFiles ); + } + return $style; + } + + public function getMessages() { + return $this->messages; + } + + public function getDependencies() { + return $this->dependencies; + } + + public function getLoaderScript() { + if ( count( $this->loaders ) == 0 ) { + return false; + } + return self::concatScripts( $this->loaders ); + } + + /** + * Get the last modified timestamp of this module, which is calculated + * as the highest last modified timestamp of its constituent files and + * the files it depends on (see getFileDependencies()). Only files + * relevant to the given language and skin are taken into account, and + * files only relevant in debug mode are not taken into account when + * debug mode is off. + * @param $lang string Language code + * @param $skin string Skin name + * @param $debug bool Debug mode flag + * @return int UNIX timestamp + */ + public function getModifiedTime( ResourceLoaderContext $context ) { + if ( isset( $this->modifiedTime[$context->getHash()] ) ) { + return $this->modifiedTime[$context->getHash()]; + } + + $files = array_merge( + $this->scripts, + $this->styles, + $context->getDebug() ? $this->debugScripts : array(), + isset( $this->languageScripts[$context->getLanguage()] ) ? + (array) $this->languageScripts[$context->getLanguage()] : array(), + (array) self::getSkinFiles( $context->getSkin(), $this->skinScripts ), + (array) self::getSkinFiles( $context->getSkin(), $this->skinStyles ), + $this->loaders, + $this->getFileDependencies( $context->getSkin() ) + ); + $filesMtime = max( array_map( 'filemtime', array_map( array( __CLASS__, 'remapFilename' ), $files ) ) ); + + // Get the mtime of the message blob + // TODO: This timestamp is queried a lot and queried separately for each module. Maybe it should be put in memcached? + $dbr = wfGetDb( DB_SLAVE ); + $msgBlobMtime = $dbr->selectField( 'msg_resource', 'mr_timestamp', array( + 'mr_resource' => $this->getName(), + 'mr_lang' => $context->getLanguage() + ), __METHOD__ + ); + $msgBlobMtime = $msgBlobMtime ? wfTimestamp( TS_UNIX, $msgBlobMtime ) : 0; + + $this->modifiedTime[$context->getHash()] = max( $filesMtime, $msgBlobMtime ); + return $this->modifiedTime[$context->getHash()]; + } + + /* Protected Members */ + + /** + * Get the primary JS for this module. This is pulled from the + * script files added through addScripts() + * @return string JS + */ + protected function getPrimaryScript() { + return self::concatScripts( $this->scripts ); + } + + /** + * Get the primary CSS for this module. This is pulled from the CSS + * files added through addStyles() + * @return string JS + */ + protected function getPrimaryStyle() { + return self::concatStyles( $this->styles ); + } + + /** + * Get the debug JS for this module. This is pulled from the script + * files added through addDebugScripts() + * @return string JS + */ + protected function getDebugScript() { + return self::concatScripts( $this->debugScripts ); + } + + /** + * Get the language-specific JS for a given language. This is pulled + * from the language-specific script files added through addLanguageScripts() + * @return string JS + */ + protected function getLanguageScript( $lang ) { + if ( !isset( $this->languageScripts[$lang] ) ) { + return ''; + } + return self::concatScripts( $this->languageScripts[$lang] ); + } + + /** + * Get the skin-specific JS for a given skin. This is pulled from the + * skin-specific JS files added through addSkinScripts() + * @return string JS + */ + protected function getSkinScript( $skin ) { + return self::concatScripts( self::getSkinFiles( $skin, $this->skinScripts ) ); + } + + /** + * Get the skin-specific CSS for a given skin. This is pulled from the + * skin-specific CSS files added through addSkinStyles() + * @return string CSS + */ + protected function getSkinStyle( $skin ) { + return self::concatStyles( self::getSkinFiles( $skin, $this->skinStyles ) ); + } + + /** + * Helper function to get skin-specific data from an array. + * @param $skin string Skin name + * @param $map array Map of skin names to arrays + * @return $map[$skin] if set and non-empty, or $map['default'] if set, or an empty array + */ + protected static function getSkinFiles( $skin, $map ) { + $retval = array(); + if ( isset( $map[$skin] ) && $map[$skin] ) { + $retval = $map[$skin]; + } else if ( isset( $map['default'] ) ) { + $retval = $map['default']; + } + return $retval; + } + + /** + * Get the files this module depends on indirectly for a given skin. + * Currently these are only image files referenced by the module's CSS. + * @param $skin string Skin name + * @return array of files + */ + protected function getFileDependencies( $skin ) { + // Try in-object cache first + if ( isset( $this->fileDeps[$skin] ) ) { + return $this->fileDeps[$skin]; + } + + // Now try memcached + global $wgMemc; + $key = wfMemcKey( 'resourceloader', 'module_deps', $this->getName(), $skin ); + $deps = $wgMemc->get( $key ); + + if ( !$deps ) { + $dbr = wfGetDb( DB_SLAVE ); + $deps = $dbr->selectField( 'module_deps', 'md_deps', array( + 'md_module' => $this->getName(), + 'md_skin' => $skin, + ), __METHOD__ + ); + if ( !$deps ) { + $deps = '[]'; // Empty array so we can do negative caching + } + $wgMemc->set( $key, $deps ); + } + $this->fileDeps = FormatJson::decode( $deps, true ); + return $this->fileDeps; + } + + /** + * Get the contents of a set of files and concatenate them, with + * newlines in between. Each file is used only once. + * @param $files array Array of file names + * @return string Concatenated contents of $files + */ + protected static function concatScripts( $files ) { + return implode( "\n", array_map( 'file_get_contents', array_map( array( __CLASS__, 'remapFilename' ), array_unique( (array) $files ) ) ) ); + } + + /** + * Get the contents of a set of CSS files, remap then and concatenate + * them, with newlines in between. Each file is used only once. + * @param $files array Array of file names + * @return string Concatenated and remapped contents of $files + */ + protected static function concatStyles( $files ) { + return implode( "\n", array_map( array( __CLASS__, 'remapStyle' ), array_unique( (array) $files ) ) ); + } + + /** + * Remap a relative to $IP. Used as a callback for array_map() + * @param $file string File name + * @return string $IP/$file + */ + protected static function remapFilename( $file ) { + global $IP; + return "$IP/$file"; + } + + /** + * Get the contents of a CSS file and run it through CSSMin::remap(). + * This wrapper is needed so we can use array_map() in concatStyles() + * @param $file string File name + * @return string Remapped CSS + */ + protected static function remapStyle( $file ) { + return CSSMin::remap( file_get_contents( self::remapFilename( $file ) ), dirname( $file ) ); + } +} + +/** + * Custom module for MediaWiki:Common.js and MediaWiki:Skinname.js + * TODO: Add Site CSS functionality too + */ +class ResourceLoaderSiteModule extends ResourceLoaderModule { + + /* Protected Members */ + + // In-object cache for modified time + protected $modifiedTime = null; + + /* Methods */ + + public function getScript( ResourceLoaderContext $context ) { + return Skin::newFromKey( $context->getSkin() )->generateUserJs(); + } + + public function getModifiedTime( ResourceLoaderContext $context ) { + if ( isset( $this->modifiedTime[$context->getHash()] ) ) { + return $this->modifiedTime[$context->getHash()]; + } + + // HACK: We duplicate the message names from generateUserJs() + // here and weird things (i.e. mtime moving backwards) can happen + // when a MediaWiki:Something.js page is deleted + $jsPages = array( Title::makeTitle( NS_MEDIAWIKI, 'Common.js' ), + Title::makeTitle( NS_MEDIAWIKI, ucfirst( $context->getSkin() ) . '.js' ) + ); + + // Do batch existence check + // TODO: This would work better if page_touched were loaded by this as well + $lb = new LinkBatch( $jsPages ); + $lb->execute(); + + $this->modifiedTime = 1; // wfTimestamp() interprets 0 as "now" + foreach ( $jsPages as $jsPage ) { + if ( $jsPage->exists() ) { + $this->modifiedTime = max( $this->modifiedTime, wfTimestamp( TS_UNIX, $jsPage->getTouched() ) ); + } + } + return $this->modifiedTime; + } + + public function getStyle( ResourceLoaderContext $context ) { return ''; } + public function getMessages() { return array(); } + public function getLoaderScript() { return ''; } + public function getDependencies() { return array(); } +} + + +class ResourceLoaderStartUpModule extends ResourceLoaderModule { + + /* Protected Members */ + + protected $modifiedTime = null; + + /* Methods */ + + public function getScript( ResourceLoaderContext $context ) { + global $IP; + + $scripts = file_get_contents( "$IP/resources/startup.js" ); + if ( $context->getOnly() === 'scripts' ) { + // Get all module registrations + $registration = ResourceLoader::getModuleRegistrations( $context ); + // Build configuration + $config = FormatJson::encode( + array( 'server' => $context->getServer(), 'debug' => $context->getDebug() ) + ); + // Add a well-known start-up function + $scripts .= "window.startUp = function() { $registration mediaWiki.config.set( $config ); };"; + // Build load query for jquery and mediawiki modules + $query = wfArrayToCGI( + array( + 'modules' => implode( '|', array( 'jquery', 'mediawiki' ) ), + 'only' => 'scripts', + 'lang' => $context->getLanguage(), + 'dir' => $context->getDirection(), + 'skin' => $context->getSkin(), + 'debug' => $context->getDebug(), + 'version' => wfTimestamp( TS_ISO_8601, round( max( + ResourceLoader::getModule( 'jquery' )->getModifiedTime( $context ), + ResourceLoader::getModule( 'mediawiki' )->getModifiedTime( $context ) + ), -2 ) ) + ) + ); + // Build HTML code for loading jquery and mediawiki modules + $loadScript = Html::linkedScript( $context->getServer() . "?$query" ); + // Add code to add jquery and mediawiki loading code; only if the current client is compatible + $scripts .= "if ( isCompatible() ) { document.write( '$loadScript' ); }"; + // Delete the compatible function - it's not needed anymore + $scripts .= "delete window['isCompatible'];"; + } + return $scripts; + } + + public function getModifiedTime( ResourceLoaderContext $context ) { + global $IP; + if ( !is_null( $this->modifiedTime ) ) { + return $this->modifiedTime; + } + // HACK getHighestModifiedTime() calls this function, so protect against infinite recursion + $this->modifiedTime = filemtime( "$IP/resources/startup.js" ); + $this->modifiedTime = ResourceLoader::getHighestModifiedTime( $context ); + return $this->modifiedTime; + } + + public function getClientMaxage() { + return 300; // 5 minutes + } + + public function getServerMaxage() { + return 300; // 5 minutes + } + + public function getStyle( ResourceLoaderContext $context ) { return ''; } + public function getMessages() { return array(); } + public function getLoaderScript() { return ''; } + public function getDependencies() { return array(); } +} \ No newline at end of file diff --git a/includes/Skin.php b/includes/Skin.php index 664c11f3551..94dfa7bd533 100644 --- a/includes/Skin.php +++ b/includes/Skin.php @@ -332,23 +332,17 @@ class Skin extends Linker { $out->out( $afterContent ); - $out->out( $this->bottomScripts() ); + $out->out( $this->bottomScripts( $out ) ); $out->out( wfReportTime() ); $out->out( "\n" ); wfProfileOut( __METHOD__ ); } - + static function makeVariablesScript( $data ) { if( $data ) { - $r = array(); - foreach ( $data as $name => $value ) { - $encValue = Xml::encodeJsVar( $value ); - $r[] = "$name=$encValue"; - } - $js = 'var ' . implode( ",\n", $r ) . ';'; - return Html::inlineScript( "\n$js\n" ); + return Html::inlineScript( 'mediaWiki.config.set(' . json_encode( $data ) . ');' ); } else { return ''; } @@ -686,8 +680,9 @@ CSS; * @param $out OutputPage */ function setupSkinUserCss( OutputPage $out ) { - $out->addStyle( 'common/shared.css' ); - $out->addStyle( 'common/oldshared.css' ); + // This includes the shared.js and oldshared.js files from skins/common/ + $out->addModuleStyles( 'mediawiki.legacy.shared' ); + // TODO: Figure out how to best integrate this stuff into ResourceLoader $out->addStyle( $this->getStylesheet() ); $out->addStyle( 'common/common_rtl.css', '', '', 'rtl' ); } @@ -992,10 +987,11 @@ CSS; /** * This gets called shortly before the tag. + * @param $out OutputPage object * @return String HTML-wrapped JS code to be put before */ - function bottomScripts() { - $bottomScriptText = "\n" . Html::inlineScript( 'if (window.runOnloadHook) runOnloadHook();' ) . "\n"; + function bottomScripts( $out ) { + $bottomScriptText = "\n" . $out->getHeadScripts( $this ); wfRunHooks( 'SkinAfterBottomScripts', array( $this, &$bottomScriptText ) ); return $bottomScriptText; } diff --git a/includes/SkinTemplate.php b/includes/SkinTemplate.php index 50dfefe24e1..c6153f0c25d 100644 --- a/includes/SkinTemplate.php +++ b/includes/SkinTemplate.php @@ -107,8 +107,8 @@ class SkinTemplate extends Skin { * @param $out OutputPage */ function setupSkinUserCss( OutputPage $out ){ - $out->addStyle( 'common/shared.css', 'screen' ); - $out->addStyle( 'common/commonPrint.css', 'print' ); + $out->addModuleStyles( 'mediawiki.legacy.shared' ); + $out->addModuleStyles( 'mediawiki.legacy.commonPrint' ); } /** @@ -421,7 +421,7 @@ class SkinTemplate extends Skin { $tpl->set( 'reporttime', wfReportTime() ); $tpl->set( 'sitenotice', wfGetSiteNotice() ); - $tpl->set( 'bottomscripts', $this->bottomScripts() ); + $tpl->set( 'bottomscripts', $this->bottomScripts( $out ) ); $printfooter = "
\n" . $this->printSource() . "
\n"; global $wgBetterDirectionality; diff --git a/includes/WebStart.php b/includes/WebStart.php index 664029ed169..13dc08c63bf 100644 --- a/includes/WebStart.php +++ b/includes/WebStart.php @@ -128,10 +128,15 @@ wfProfileOut( 'WebStart.php-conf' ); wfProfileIn( 'WebStart.php-ob_start' ); # Initialise output buffering -if ( ob_get_level() ) { - # Someone's been mixing configuration data with code! - # How annoying. -} elseif ( !defined( 'MW_NO_OUTPUT_BUFFER' ) ) { + +# Check that there is no previous output or previously set up buffers, because +# that would cause us to potentially mix gzip and non-gzip output, creating a +# big mess. +# In older versions of PHP ob_get_level() returns 0 if there is no buffering or +# previous output, in newer versions the default output buffer is always set up +# and ob_get_level() returns 1. In this case we check that the buffer is empty. +# FIXME: Check that this is the right way to handle this +if ( !defined( 'MW_NO_OUTPUT_BUFFER' ) && ( ob_get_level() == 0 || ( ob_get_level() == 1 && ob_get_contents() === '' ) ) ) { require_once( "$IP/includes/OutputHandler.php" ); ob_start( 'wfOutputHandler' ); } diff --git a/includes/diff/DifferenceInterface.php b/includes/diff/DifferenceInterface.php index 3b7e3ed97f2..9527846ef74 100644 --- a/includes/diff/DifferenceInterface.php +++ b/includes/diff/DifferenceInterface.php @@ -580,10 +580,7 @@ CONTROL; */ function showDiffStyle() { global $wgStylePath, $wgStyleVersion, $wgOut; - $wgOut->addStyle( 'common/diff.css' ); - - // JS is needed to detect old versions of Mozilla to work around an annoyance bug. - $wgOut->addScript( "" ); + $wgOut->addModules( 'mediawiki.legacy.diff' ); } /** diff --git a/includes/installer/MysqlUpdater.php b/includes/installer/MysqlUpdater.php index ecd1242babe..efb4f5c04b5 100644 --- a/includes/installer/MysqlUpdater.php +++ b/includes/installer/MysqlUpdater.php @@ -167,6 +167,8 @@ class MysqlUpdater extends DatabaseUpdater { array( 'addField', 'categorylinks', 'cl_collation', 'patch-categorylinks-better-collation.sql' ), array( 'do_cl_fields_update' ), array( 'do_collation_update' ), + array( 'addTable', 'msg_resource', 'patch-msg_resource.sql' ), + array( 'addTable', 'module_deps', 'patch-module_deps.sql' ), ); } diff --git a/includes/installer/SqliteUpdater.php b/includes/installer/SqliteUpdater.php index 47151fe123b..19003b68398 100644 --- a/includes/installer/SqliteUpdater.php +++ b/includes/installer/SqliteUpdater.php @@ -47,6 +47,8 @@ class SqliteUpdater extends DatabaseUpdater { array( 'addField', 'interwiki', 'iw_api', 'patch-iw_api_and_wikiid.sql' ), array( 'drop_index_if_exists', 'iwlinks', 'iwl_prefix', 'patch-kill-iwl_prefix.sql' ), array( 'drop_index_if_exists', 'iwlinks', 'iwl_prefix_from_title', 'patch-kill-iwl_pft.sql' ), + array( 'addTable', 'msg_resource', 'patch-msg_resource.sql' ), + array( 'addTable', 'module_deps', 'patch-module_deps.sql' ), ); } } diff --git a/includes/parser/ParserOutput.php b/includes/parser/ParserOutput.php index 6b84c222396..ac89cc918f3 100644 --- a/includes/parser/ParserOutput.php +++ b/includes/parser/ParserOutput.php @@ -116,6 +116,7 @@ class ParserOutput extends CacheTime $mHideNewSection = false, # Hide the new section link? $mNoGallery = false, # No gallery on category page? (__NOGALLERY__) $mHeadItems = array(), # Items to put in the section + $mModules = array(), # Modules to be loaded by the resource loader $mOutputHooks = array(), # Hook tags as per $wgParserOutputHooks $mWarnings = array(), # Warning text to be returned to the user. Wikitext formatted, in the key only $mSections = array(), # Table of contents @@ -146,6 +147,7 @@ class ParserOutput extends CacheTime function &getExternalLinks() { return $this->mExternalLinks; } function getNoGallery() { return $this->mNoGallery; } function getHeadItems() { return $this->mHeadItems; } + function getModules() { return $this->mModules; } function getSubtitle() { return $this->mSubtitle; } function getOutputHooks() { return (array)$this->mOutputHooks; } function getWarnings() { return array_keys( $this->mWarnings ); } @@ -267,6 +269,10 @@ class ParserOutput extends CacheTime $this->mHeadItems[] = $section; } } + + function addModules( $modules ) { + $this->mModules = array_merge( $this->mModules, (array) $modules ); + } /** * Override the title to be used for display diff --git a/includes/specials/SpecialBlockip.php b/includes/specials/SpecialBlockip.php index 3ed62fb52ae..e060cf9dbc6 100644 --- a/includes/specials/SpecialBlockip.php +++ b/includes/specials/SpecialBlockip.php @@ -196,8 +196,8 @@ class IPBlockForm extends SpecialPage { wfMsgForContent( 'ipbreasonotherlist' ), $this->BlockReasonList, 'wpBlockDropDown', 4 ); global $wgStylePath, $wgStyleVersion; + $wgOut->addModules( 'mediawiki.legacy.block' ); $wgOut->addHTML( - Xml::tags( 'script', array( 'type' => 'text/javascript', 'src' => "$wgStylePath/common/block.js?$wgStyleVersion" ), '' ) . Xml::openElement( 'form', array( 'method' => 'post', 'action' => $titleObj->getLocalURL( 'action=submit' ), 'id' => 'blockip' ) ) . Xml::openElement( 'fieldset' ) . Xml::element( 'legend', null, wfMsg( 'blockip-legend' ) ) . diff --git a/includes/specials/SpecialPreferences.php b/includes/specials/SpecialPreferences.php index 3db11077374..4cd54c0ec27 100644 --- a/includes/specials/SpecialPreferences.php +++ b/includes/specials/SpecialPreferences.php @@ -52,7 +52,7 @@ class SpecialPreferences extends SpecialPage { return; } - $wgOut->addScriptFile( 'prefs.js' ); + $wgOut->addModules( 'mediawiki.legacy.prefs' ); if ( $wgRequest->getCheck( 'success' ) ) { $wgOut->wrapWikiMsg( diff --git a/includes/specials/SpecialSearch.php b/includes/specials/SpecialSearch.php index 690c6b59056..a04ca91f324 100644 --- a/includes/specials/SpecialSearch.php +++ b/includes/specials/SpecialSearch.php @@ -366,7 +366,7 @@ class SpecialSearch { $wgOut->setArticleRelated( false ); $wgOut->setRobotPolicy( 'noindex,nofollow' ); // add javascript specific to special:search - $wgOut->addScriptFile( 'search.js' ); + $wgOut->addModules( 'mediawiki.legacy.search' ); // Bug #16886: Sister projects box moves down the first extract on IE7 $wgOut->addStyle( 'common/IE70Fixes.css', 'screen', 'IE 7' ); diff --git a/includes/specials/SpecialUpload.php b/includes/specials/SpecialUpload.php index 088ad0fcc91..24081ffe40f 100644 --- a/includes/specials/SpecialUpload.php +++ b/includes/specials/SpecialUpload.php @@ -1065,8 +1065,7 @@ class UploadForm extends HTMLForm { $wgOut->addScript( Skin::makeVariablesScript( $scriptVars ) ); // For support - $wgOut->addScriptFile( 'edit.js' ); - $wgOut->addScriptFile( 'upload.js' ); + $wgOut->addModules( array( 'mediawiki.legacy.edit', 'mediawiki.legacy.upload' ) ); } /** diff --git a/load.php b/load.php new file mode 100644 index 00000000000..9e18a5b54bc --- /dev/null +++ b/load.php @@ -0,0 +1,56 @@ +isPathInfoBad() ) { + wfHttpError( 403, 'Forbidden', + 'Invalid file extension found in PATH_INFO. ' . + 'The resource loader must be accessed through the primary script entry point.' ); + return; + // FIXME: Doesn't this execute the rest of the request anyway? + // Was taken from api.php so I guess it's maybe OK but it doesn't look good. +} + +// Respond to resource loading request +ResourceLoader::respond( new ResourceLoaderContext( $wgRequest, $wgServer . $wgScriptPath . '/load.php' ) ); + +wfProfileOut( 'load.php' ); +wfLogProfilingData(); + +// Shut down the database +wfGetLBFactory()->shutdown(); \ No newline at end of file diff --git a/maintenance/archives/patch-module_deps.sql b/maintenance/archives/patch-module_deps.sql new file mode 100644 index 00000000000..8cea5a110b6 --- /dev/null +++ b/maintenance/archives/patch-module_deps.sql @@ -0,0 +1,12 @@ +-- Table for tracking which local files a module depends on that aren't +-- registered directly. +-- Currently only used for tracking images that CSS depends on +CREATE TABLE /*_*/module_deps ( + -- Module name + md_module varchar(255) NOT NULL, + -- Skin name + md_skin varchar(32) NOT NULL, + -- JSON blob with file dependencies + md_deps mediumblob NOT NULL +) /*$wgDBTableOptions*/; +CREATE UNIQUE INDEX /*i*/md_module_skin ON /*_*/module_deps (md_module, md_skin); diff --git a/maintenance/archives/patch-msg_resource.sql b/maintenance/archives/patch-msg_resource.sql new file mode 100644 index 00000000000..51457ec18cb --- /dev/null +++ b/maintenance/archives/patch-msg_resource.sql @@ -0,0 +1,20 @@ +-- Table for storing JSON message blobs for the resource loader +CREATE TABLE /*_*/msg_resource ( + -- Resource name + mr_resource varchar(255) NOT NULL, + -- Language code + mr_lang varbinary(32) NOT NULL, + -- JSON blob. This is an incomplete JSON object, i.e. without the wrapping {} + mr_blob mediumblob NOT NULL, + -- Timestamp of last update + mr_timestamp binary(14) NOT NULL +) /*$wgDBTableOptions*/; +CREATE UNIQUE INDEX /*i*/mr_resource_lang ON /*_*/msg_resource(mr_resource, mr_lang); + +-- Table for administering which message is contained in which resource +CREATE TABLE /*_*/msg_resource_links ( + mrl_resource varchar(255) NOT NULL, + -- Message key + mrl_message varchar(255) NOT NULL +) /*$wgDBTableOptions*/; +CREATE UNIQUE INDEX /*i*/mrl_message_resource ON /*_*/msg_resource_links (mrl_message, mrl_resource); diff --git a/maintenance/tables.sql b/maintenance/tables.sql index dcb776d0d6f..2661b84bab7 100644 --- a/maintenance/tables.sql +++ b/maintenance/tables.sql @@ -1395,4 +1395,38 @@ CREATE TABLE /*_*/l10n_cache ( ) /*$wgDBTableOptions*/; CREATE INDEX /*i*/lc_lang_key ON /*_*/l10n_cache (lc_lang, lc_key); +-- Table for storing JSON message blobs for the resource loader +CREATE TABLE /*_*/msg_resource ( + -- Resource name + mr_resource varchar(255) NOT NULL, + -- Language code + mr_lang varbinary(32) NOT NULL, + -- JSON blob + mr_blob mediumblob NOT NULL, + -- Timestamp of last update + mr_timestamp binary(14) NOT NULL +) /*$wgDBTableOptions*/; +CREATE UNIQUE INDEX /*i*/mr_resource_lang ON /*_*/msg_resource (mr_resource, mr_lang); + +-- Table for administering which message is contained in which resource +CREATE TABLE /*_*/msg_resource_links ( + mrl_resource varchar(255) NOT NULL, + -- Message key + mrl_message varchar(255) NOT NULL +) /*$wgDBTableOptions*/; +CREATE UNIQUE INDEX /*i*/mrl_message_resource ON /*_*/msg_resource_links (mrl_message, mrl_resource); + +-- Table for tracking which local files a module depends on that aren't +-- registered directly. +-- Currently only used for tracking images that CSS depends on +CREATE TABLE /*_*/module_deps ( + -- Module name + md_module varchar(255) NOT NULL, + -- Skin name + md_skin varchar(32) NOT NULL, + -- JSON blob with file dependencies + md_deps mediumblob NOT NULL +) /*$wgDBTableOptions*/; +CREATE UNIQUE INDEX /*i*/md_module_skin ON /*_*/module_deps (md_module, md_skin); + -- vim: sw=2 sts=2 et diff --git a/maintenance/tests/ResourceLoaderFileModuleTest.php b/maintenance/tests/ResourceLoaderFileModuleTest.php new file mode 100644 index 00000000000..5f5447ce92d --- /dev/null +++ b/maintenance/tests/ResourceLoaderFileModuleTest.php @@ -0,0 +1,16 @@ + new ResourceLoaderSiteModule, + 'startup' => new ResourceLoaderStartUpModule, + + /* Skins */ + + 'vector' => new ResourceLoaderFileModule( array( 'styles' => 'skins/vector/main-ltr.css' ) ), + + /* jQuery */ + + 'jquery' => new ResourceLoaderFileModule( array( 'scripts' => 'resources/jquery/jquery.js' ) ), + + /* jQuery Plugins */ + + 'jquery.tabIndex' => new ResourceLoaderFileModule( array( 'scripts' => 'resources/jquery/jquery.tabIndex.js' ) ), + 'jquery.cookie' => new ResourceLoaderFileModule( array( 'scripts' => 'resources/jquery/jquery.cookie.js' ) ), + + /* jQuery UI */ + + // Core + 'jquery.ui.core' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.core.js', + 'skinStyles' => array( + 'default' => array( + 'resources/jquery.ui/themes/default/jquery.ui.core.css', + 'resources/jquery.ui/themes/default/jquery.ui.theme.css', + ), + 'vector' => array( + 'resources/jquery.ui/themes/vector/jquery.ui.core.css', + 'resources/jquery.ui/themes/vector/jquery.ui.theme.css', + ), + ), + 'dependencies' => 'jquery', + ) ), + 'jquery.ui.widget' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.widget.js', + 'dependencies' => 'jquery.ui.core', + ) ), + 'jquery.ui.mouse' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.mouse.js', + 'dependencies' => 'jquery', + ) ), + 'jquery.ui.position' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.position.js', + 'dependencies' => 'jquery', + ) ), + // Interactions + 'jquery.ui.draggable' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.draggable.js', + 'dependencies' => 'jquery.ui.core', + ) ), + 'jquery.ui.droppable' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.droppable.js', + 'dependencies' => array( 'jquery.ui.core', 'jquery.ui.draggable' ), + ) ), + 'jquery.ui.resizable' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.resizable.js', + 'skinStyles' => array( + 'default' => 'resources/jquery.ui/themes/default/jquery.ui.resizable.css', + 'vector' => 'resources/jquery.ui/themes/vector/jquery.ui.resizable.css', + ), + 'dependencies' => 'jquery.ui.core', + ) ), + 'jquery.ui.selectable' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.selectable.js', + 'skinStyles' => array( + 'default' => 'resources/jquery.ui/themes/default/jquery.ui.selectable.css', + 'vector' => 'resources/jquery.ui/themes/vector/jquery.ui.selectable.css', + ), + 'dependencies' => 'jquery.ui.core', + ) ), + 'jquery.ui.sortable' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.sortable.js', + 'dependencies' => 'jquery.ui.core', + ) ), + // Widgets + 'jquery.ui.accordion' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.accordion.js', + 'dependencies' => 'jquery.ui.core', + 'skinStyles' => array( + 'default' => 'resources/jquery.ui/themes/default/jquery.ui.accordion.css', + 'vector' => 'resources/jquery.ui/themes/vector/jquery.ui.accordion.css', + ), + ) ), + 'jquery.ui.autocomplete' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.autocomplete.js', + 'dependencies' => array( 'jquery.ui.core', 'jquery.ui.widget', 'jquery.ui.position' ), + 'skinStyles' => array( + 'default' => 'resources/jquery.ui/themes/default/jquery.ui.autocomplete.css', + 'vector' => 'resources/jquery.ui/themes/vector/jquery.ui.autocomplete.css', + ), + ) ), + 'jquery.ui.button' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.button.js', + 'dependencies' => array( 'jquery.ui.core', 'jquery.ui.widget' ), + 'skinStyles' => array( + 'default' => 'resources/jquery.ui/themes/default/jquery.ui.button.css', + 'vector' => 'resources/jquery.ui/themes/vector/jquery.ui.button.css', + ), + ) ), + 'jquery.ui.datepicker' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.datepicker.js', + 'dependencies' => 'jquery.ui.core', + 'skinStyles' => array( + 'default' => 'resources/jquery.ui/themes/default/jquery.ui.datepicker.css', + 'vector' => 'resources/jquery.ui/themes/vector/jquery.ui.datepicker.css', + ), + 'languageScripts' => array( + 'af' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-af.js', + 'ar' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-ar.js', + 'az' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-az.js', + 'bg' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-bg.js', + 'bs' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-bs.js', + 'ca' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-ca.js', + 'cs' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-cs.js', + 'da' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-da.js', + 'de' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-de.js', + 'el' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-el.js', + 'en-gb' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-en-GB.js', + 'eo' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-eo.js', + 'es' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-es.js', + 'et' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-et.js', + 'eu' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-eu.js', + 'fa' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-fa.js', + 'fi' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-fi.js', + 'fo' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-fo.js', + 'fr-ch' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-fr-CH.js', + 'fr' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-fr.js', + 'he' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-he.js', + 'hr' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-hr.js', + 'hu' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-hu.js', + 'hy' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-hy.js', + 'id' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-id.js', + 'is' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-is.js', + 'it' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-it.js', + 'ja' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-ja.js', + 'ko' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-ko.js', + 'lt' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-lt.js', + 'lv' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-lv.js', + 'ms' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-ms.js', + 'nl' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-nl.js', + 'no' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-no.js', + 'pl' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-pl.js', + 'pt-br' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-pt-BR.js', + 'ro' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-ro.js', + 'ru' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-ru.js', + 'sk' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-sk.js', + 'sl' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-sl.js', + 'sq' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-sq.js', + 'sr-sr' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-sr-SR.js', + 'sr' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-sr.js', + 'sv' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-sv.js', + 'ta' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-ta.js', + 'th' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-th.js', + 'tr' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-tr.js', + 'uk' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-uk.js', + 'vi' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-vi.js', + 'zh-cn' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-zh-CN.js', + 'zh-hk' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-zh-HK.js', + 'zh-tw' => 'resources/jquery.ui/i18n/jquery.ui.datepicker-zh-TW.js' + ), + ) ), + 'jquery.ui.dialog' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.dialog.js', + 'dependencies' => 'jquery.ui.core', + 'skinStyles' => array( + 'default' => 'resources/jquery.ui/themes/default/jquery.ui.dialog.css', + 'vector' => 'resources/jquery.ui/themes/vector/jquery.ui.dialog.css', + ), + ) ), + 'jquery.ui.progressbar' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.progressbar.js', + 'dependencies' => 'jquery.ui.core', + 'skinStyles' => array( + 'default' => 'resources/jquery.ui/themes/default/jquery.ui.progressbar.css', + 'vector' => 'resources/jquery.ui/themes/vector/jquery.ui.progressbar.css', + ), + ) ), + 'jquery.ui.slider' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.slider.js', + 'dependencies' => array( 'jquery.ui.core', 'jquery.ui.widget', 'jquery.ui.mouse' ), + 'skinStyles' => array( + 'default' => 'resources/jquery.ui/themes/default/jquery.ui.slider.css', + 'vector' => 'resources/jquery.ui/themes/vector/jquery.ui.slider.css', + ), + ) ), + 'jquery.ui.tabs' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.ui/jquery.ui.tabs.js', + 'dependencies' => 'jquery.ui.core', + 'skinStyles' => array( + 'default' => 'resources/jquery.ui/themes/default/jquery.ui.tabs.css', + 'vector' => 'resources/jquery.ui/themes/vector/jquery.ui.tabs.css', + ), + ) ), + // Effects + 'jquery.effects.core' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.core.js', + 'dependencies' => 'jquery', + ) ), + 'jquery.effects.blind' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.blind.js', + 'dependencies' => 'jquery.effects.core', + ) ), + 'jquery.effects.bounce' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.bounce.js', + 'dependencies' => 'jquery.effects.core', + ) ), + 'jquery.effects.clip' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.clip.js', + 'dependencies' => 'jquery.effects.core', + ) ), + 'jquery.effects.drop' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.drop.js', + 'dependencies' => 'jquery.effects.core', + ) ), + 'jquery.effects.explode' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.explode.js', + 'dependencies' => 'jquery.effects.core', + ) ), + 'jquery.effects.fold' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.fold.js', + 'dependencies' => 'jquery.effects.core', + ) ), + 'jquery.effects.highlight' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.highlight.js', + 'dependencies' => 'jquery.effects.core', + ) ), + 'jquery.effects.pulsate' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.pulsate.js', + 'dependencies' => 'jquery.effects.core', + ) ), + 'jquery.effects.scale' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.scale.js', + 'dependencies' => 'jquery.effects.core', + ) ), + 'jquery.effects.shake' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.shake.js', + 'dependencies' => 'jquery.effects.core', + ) ), + 'jquery.effects.slide' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.slide.js', + 'dependencies' => 'jquery.effects.core', + ) ), + 'jquery.effects.transfer' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/jquery.effects/jquery.effects.transfer.js', + 'dependencies' => 'jquery.effects.core', + ) ), + + /* MediaWiki */ + + 'mediawiki' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/mediawiki/mediawiki.js', + 'debugScripts' => 'resources/mediawiki/mediawiki.log.js', + ) ), + + /* MediaWiki Utilities */ + + 'mediawiki.util.client' => new ResourceLoaderFileModule( array( + 'scripts' => 'resources/mediawiki.util/mediawiki.util.client.js', + ) ), + + /* MediaWiki Legacy */ + + 'mediawiki.legacy.ajax' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/ajax.js', + 'messages' => array( 'watch', 'unwatch', 'watching', 'unwatching', 'tooltip-ca-watch', 'tooltip-ca-unwatch' ), + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.ajaxwatch' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/ajaxwatch.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.block' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/block.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.changepassword' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/changepassword.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.commonPrint' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/commonPrint.css', + ) ), + 'mediawiki.legacy.config' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/config.js', + 'styles' => array( 'skins/common/config.css', 'skins/common/config-cc.css' ), + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.diff' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/diff.js', + 'styles' => 'skins/common/diff.css', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.edit' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/edit.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.enhancedchanges' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/enhancedchanges.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.history' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/history.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.htmlform' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/htmlform.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.IEFixes' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/IEFixes.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.metadata' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/metadata.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.mwsuggest' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/mwsuggest.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.password' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/password.js', + 'styles' => 'skins/common/password.css', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.prefs' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/prefs.js', + 'dependencies' => array( 'mediawiki.legacy.wikibits', 'mediawiki.legacy.htmlform' ), + ) ), + 'mediawiki.legacy.preview' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/preview.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.protect' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/protect.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.rightclickedit' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/rightclickedit.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.search' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/search.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.shared' => new ResourceLoaderFileModule( array( + 'styles' => array( 'skins/common/shared.css', 'skins/common/oldshared.css' ), + ) ), + 'mediawiki.legacy.upload' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/upload.js', + 'dependencies' => 'mediawiki.legacy.wikibits', + ) ), + 'mediawiki.legacy.wikibits' => new ResourceLoaderFileModule( array( + 'scripts' => 'skins/common/wikibits.js', + 'messages' => array( 'showtoc', 'hidetoc' ), + ) ), +) ); diff --git a/resources/jquery.effects/jquery.effects.blind.js b/resources/jquery.effects/jquery.effects.blind.js new file mode 100644 index 00000000000..d9a3b06b472 --- /dev/null +++ b/resources/jquery.effects/jquery.effects.blind.js @@ -0,0 +1,49 @@ +/* + * jQuery UI Effects Blind 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.bounce.js b/resources/jquery.effects/jquery.effects.bounce.js new file mode 100644 index 00000000000..010585bf9df --- /dev/null +++ b/resources/jquery.effects/jquery.effects.bounce.js @@ -0,0 +1,78 @@ +/* + * jQuery UI Effects Bounce 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.clip.js b/resources/jquery.effects/jquery.effects.clip.js new file mode 100644 index 00000000000..796ba89e9b1 --- /dev/null +++ b/resources/jquery.effects/jquery.effects.clip.js @@ -0,0 +1,54 @@ +/* + * jQuery UI Effects Clip 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.core.js b/resources/jquery.effects/jquery.effects.core.js new file mode 100644 index 00000000000..f3041f569ff --- /dev/null +++ b/resources/jquery.effects/jquery.effects.core.js @@ -0,0 +1,714 @@ +/* + * jQuery UI Effects 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.each(function() { + + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('className'); + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('className', className); + + that.animate(styleDifference(originalStyle, newStyle), duration, easing, function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.2", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('
') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }); + + element.wrap(wrapper); + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0 }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + if (element.parent().is('.ui-effects-wrapper')) + return element.parent().replaceWith(element); + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : $.fx.speeds[speed] || $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects takes actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + effectMethod = $.effects[effect]; + + return effectMethod && !$.fx.off ? effectMethod.call(this, args2) : this; + }, + + _show: $.fn.show, + show: function(speed) { + if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and create _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if (!speed || typeof speed == 'number' || $.fx.speeds[speed] || + typeof speed == 'boolean' || $.isFunction(speed)) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.drop.js b/resources/jquery.effects/jquery.effects.drop.js new file mode 100644 index 00000000000..0059c0338f9 --- /dev/null +++ b/resources/jquery.effects/jquery.effects.drop.js @@ -0,0 +1,50 @@ +/* + * jQuery UI Effects Drop 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.explode.js b/resources/jquery.effects/jquery.effects.explode.js new file mode 100644 index 00000000000..85ba1dccb0b --- /dev/null +++ b/resources/jquery.effects/jquery.effects.explode.js @@ -0,0 +1,79 @@ +/* + * jQuery UI Effects Explode 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.fold.js b/resources/jquery.effects/jquery.effects.fold.js new file mode 100644 index 00000000000..946831bfbbd --- /dev/null +++ b/resources/jquery.effects/jquery.effects.fold.js @@ -0,0 +1,56 @@ +/* + * jQuery UI Effects Fold 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.highlight.js b/resources/jquery.effects/jquery.effects.highlight.js new file mode 100644 index 00000000000..5e03e9ec428 --- /dev/null +++ b/resources/jquery.effects/jquery.effects.highlight.js @@ -0,0 +1,50 @@ +/* + * jQuery UI Effects Highlight 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.pulsate.js b/resources/jquery.effects/jquery.effects.pulsate.js new file mode 100644 index 00000000000..11c5af13e64 --- /dev/null +++ b/resources/jquery.effects/jquery.effects.pulsate.js @@ -0,0 +1,51 @@ +/* + * jQuery UI Effects Pulsate 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'); + times = ((o.options.times || 5) * 2) - 1; + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.scale.js b/resources/jquery.effects/jquery.effects.scale.js new file mode 100644 index 00000000000..1efb781a1bc --- /dev/null +++ b/resources/jquery.effects/jquery.effects.scale.js @@ -0,0 +1,178 @@ +/* + * jQuery UI Effects Scale 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','width','height','overflow','opacity']; + var props1 = ['position','top','left','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.shake.js b/resources/jquery.effects/jquery.effects.shake.js new file mode 100644 index 00000000000..050894b4f46 --- /dev/null +++ b/resources/jquery.effects/jquery.effects.shake.js @@ -0,0 +1,57 @@ +/* + * jQuery UI Effects Shake 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.slide.js b/resources/jquery.effects/jquery.effects.slide.js new file mode 100644 index 00000000000..d0719a7ff3b --- /dev/null +++ b/resources/jquery.effects/jquery.effects.slide.js @@ -0,0 +1,50 @@ +/* + * jQuery UI Effects Slide 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); diff --git a/resources/jquery.effects/jquery.effects.transfer.js b/resources/jquery.effects/jquery.effects.transfer.js new file mode 100644 index 00000000000..4c212ca00d4 --- /dev/null +++ b/resources/jquery.effects/jquery.effects.transfer.js @@ -0,0 +1,45 @@ +/* + * jQuery UI Effects Transfer 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function($) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('
') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-af.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-af.js new file mode 100644 index 00000000000..43fbf6cd8e8 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-af.js @@ -0,0 +1,23 @@ +/* Afrikaans initialisation for the jQuery UI date picker plugin. */ +/* Written by Renier Pretorius. */ +jQuery(function($){ + $.datepicker.regional['af'] = { + closeText: 'Selekteer', + prevText: 'Vorige', + nextText: 'Volgende', + currentText: 'Vandag', + monthNames: ['Januarie','Februarie','Maart','April','Mei','Junie', + 'Julie','Augustus','September','Oktober','November','Desember'], + monthNamesShort: ['Jan', 'Feb', 'Mrt', 'Apr', 'Mei', 'Jun', + 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Des'], + dayNames: ['Sondag', 'Maandag', 'Dinsdag', 'Woensdag', 'Donderdag', 'Vrydag', 'Saterdag'], + dayNamesShort: ['Son', 'Maa', 'Din', 'Woe', 'Don', 'Vry', 'Sat'], + dayNamesMin: ['So','Ma','Di','Wo','Do','Vr','Sa'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['af']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-ar.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-ar.js new file mode 100644 index 00000000000..c799b48d8e2 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-ar.js @@ -0,0 +1,24 @@ +/* Arabic Translation for jQuery UI date picker plugin. */ +/* Khaled Al Horani -- koko.dw@gmail.com */ +/* خالد الحوراني -- koko.dw@gmail.com */ +/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */ +jQuery(function($){ + $.datepicker.regional['ar'] = { + closeText: 'إغلاق', + prevText: '<السابق', + nextText: 'التالي>', + currentText: 'اليوم', + monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران', + 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'], + dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], + dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], + weekHeader: 'أسبوع', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ar']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-az.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-az.js new file mode 100644 index 00000000000..b5434057b7f --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-az.js @@ -0,0 +1,23 @@ +/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Jamil Najafov (necefov33@gmail.com). */ +jQuery(function($) { + $.datepicker.regional['az'] = { + closeText: 'Bağla', + prevText: '<Geri', + nextText: 'İrəli>', + currentText: 'Bugün', + monthNames: ['Yanvar','Fevral','Mart','Aprel','May','İyun', + 'İyul','Avqust','Sentyabr','Oktyabr','Noyabr','Dekabr'], + monthNamesShort: ['Yan','Fev','Mar','Apr','May','İyun', + 'İyul','Avq','Sen','Okt','Noy','Dek'], + dayNames: ['Bazar','Bazar ertəsi','Çərşənbə axşamı','Çərşənbə','Cümə axşamı','Cümə','Şənbə'], + dayNamesShort: ['B','Be','Ça','Ç','Ca','C','Ş'], + dayNamesMin: ['B','B','Ç','С','Ç','C','Ş'], + weekHeader: 'Hf', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['az']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-bg.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-bg.js new file mode 100644 index 00000000000..b5113f78170 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-bg.js @@ -0,0 +1,24 @@ +/* Bulgarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Stoyan Kyosev (http://svest.org). */ +jQuery(function($){ + $.datepicker.regional['bg'] = { + closeText: 'затвори', + prevText: '<назад', + nextText: 'напред>', + nextBigText: '>>', + currentText: 'днес', + monthNames: ['Януари','Февруари','Март','Април','Май','Юни', + 'Юли','Август','Септември','Октомври','Ноември','Декември'], + monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни', + 'Юли','Авг','Сеп','Окт','Нов','Дек'], + dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'], + dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'], + dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'], + weekHeader: 'Wk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['bg']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-bs.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-bs.js new file mode 100644 index 00000000000..30ab826b0f0 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-bs.js @@ -0,0 +1,23 @@ +/* Bosnian i18n for the jQuery UI date picker plugin. */ +/* Written by Kenan Konjo. */ +jQuery(function($){ + $.datepicker.regional['bs'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Januar','Februar','Mart','April','Maj','Juni', + 'Juli','August','Septembar','Oktobar','Novembar','Decembar'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Wk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['bs']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-ca.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-ca.js new file mode 100644 index 00000000000..b128e699efd --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-ca.js @@ -0,0 +1,23 @@ +/* Inicialització en català per a l'extenció 'calendar' per jQuery. */ +/* Writers: (joan.leon@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ca'] = { + closeText: 'Tancar', + prevText: '<Ant', + nextText: 'Seg>', + currentText: 'Avui', + monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny', + 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'], + monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Oct','Nov','Des'], + dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'], + dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'], + dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ca']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-cs.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-cs.js new file mode 100644 index 00000000000..c3c07ea672e --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-cs.js @@ -0,0 +1,23 @@ +/* Czech initialisation for the jQuery UI date picker plugin. */ +/* Written by Tomas Muller (tomas@tomas-muller.net). */ +jQuery(function($){ + $.datepicker.regional['cs'] = { + closeText: 'Zavřít', + prevText: '<Dříve', + nextText: 'Později>', + currentText: 'Nyní', + monthNames: ['leden','únor','březen','duben','květen','červen', + 'červenec','srpen','září','říjen','listopad','prosinec'], + monthNamesShort: ['led','úno','bře','dub','kvě','čer', + 'čvc','srp','zář','říj','lis','pro'], + dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'], + dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'], + dayNamesMin: ['ne','po','út','st','čt','pá','so'], + weekHeader: 'Týd', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['cs']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-da.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-da.js new file mode 100644 index 00000000000..4a99a5833b3 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-da.js @@ -0,0 +1,23 @@ +/* Danish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jan Christensen ( deletestuff@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['da'] = { + closeText: 'Luk', + prevText: '<Forrige', + nextText: 'Næste>', + currentText: 'Idag', + monthNames: ['Januar','Februar','Marts','April','Maj','Juni', + 'Juli','August','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], + dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], + dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], + weekHeader: 'Uge', + dateFormat: 'dd-mm-yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['da']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-de.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-de.js new file mode 100644 index 00000000000..ac2d516aa93 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-de.js @@ -0,0 +1,23 @@ +/* German initialisation for the jQuery UI date picker plugin. */ +/* Written by Milian Wolff (mail@milianw.de). */ +jQuery(function($){ + $.datepicker.regional['de'] = { + closeText: 'schließen', + prevText: '<zurück', + nextText: 'Vor>', + currentText: 'heute', + monthNames: ['Januar','Februar','März','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Dezember'], + monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dez'], + dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'], + dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'], + dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'], + weekHeader: 'Wo', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['de']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-el.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-el.js new file mode 100644 index 00000000000..9542769d9a5 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-el.js @@ -0,0 +1,23 @@ +/* Greek (el) initialisation for the jQuery UI date picker plugin. */ +/* Written by Alex Cicovic (http://www.alexcicovic.com) */ +jQuery(function($){ + $.datepicker.regional['el'] = { + closeText: 'Κλείσιμο', + prevText: 'Προηγούμενος', + nextText: 'Επόμενος', + currentText: 'Τρέχων Μήνας', + monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος', + 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'], + monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν', + 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'], + dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'], + dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'], + dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'], + weekHeader: 'Εβδ', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['el']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-en-GB.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-en-GB.js new file mode 100644 index 00000000000..aac7b6195c4 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-en-GB.js @@ -0,0 +1,23 @@ +/* English/UK initialisation for the jQuery UI date picker plugin. */ +/* Written by Stuart. */ +jQuery(function($){ + $.datepicker.regional['en-GB'] = { + closeText: 'Done', + prevText: 'Prev', + nextText: 'Next', + currentText: 'Today', + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', + 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['en-GB']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-eo.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-eo.js new file mode 100644 index 00000000000..ba5715687b9 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-eo.js @@ -0,0 +1,23 @@ +/* Esperanto initialisation for the jQuery UI date picker plugin. */ +/* Written by Olivier M. (olivierweb@ifrance.com). */ +jQuery(function($){ + $.datepicker.regional['eo'] = { + closeText: 'Fermi', + prevText: '<Anta', + nextText: 'Sekv>', + currentText: 'Nuna', + monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio', + 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aŭg','Sep','Okt','Nov','Dec'], + dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'], + dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'], + weekHeader: 'Sb', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['eo']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-es.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-es.js new file mode 100644 index 00000000000..a02133de3ff --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-es.js @@ -0,0 +1,23 @@ +/* Inicialización en español para la extensión 'UI date picker' para jQuery. */ +/* Traducido por Vester (xvester@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['es'] = { + closeText: 'Cerrar', + prevText: '<Ant', + nextText: 'Sig>', + currentText: 'Hoy', + monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio', + 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'], + monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun', + 'Jul','Ago','Sep','Oct','Nov','Dic'], + dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'], + dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'], + dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['es']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-et.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-et.js new file mode 100644 index 00000000000..f97311f31a5 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-et.js @@ -0,0 +1,23 @@ +/* Estonian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mart Sõmermaa (mrts.pydev at gmail com). */ +jQuery(function($){ + $.datepicker.regional['et'] = { + closeText: 'Sulge', + prevText: 'Eelnev', + nextText: 'Järgnev', + currentText: 'Täna', + monthNames: ['Jaanuar','Veebruar','Märts','Aprill','Mai','Juuni', + 'Juuli','August','September','Oktoober','November','Detsember'], + monthNamesShort: ['Jaan', 'Veebr', 'Märts', 'Apr', 'Mai', 'Juuni', + 'Juuli', 'Aug', 'Sept', 'Okt', 'Nov', 'Dets'], + dayNames: ['Pühapäev', 'Esmaspäev', 'Teisipäev', 'Kolmapäev', 'Neljapäev', 'Reede', 'Laupäev'], + dayNamesShort: ['Pühap', 'Esmasp', 'Teisip', 'Kolmap', 'Neljap', 'Reede', 'Laup'], + dayNamesMin: ['P','E','T','K','N','R','L'], + weekHeader: 'Sm', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['et']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-eu.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-eu.js new file mode 100644 index 00000000000..9ba6ee22e34 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-eu.js @@ -0,0 +1,23 @@ +/* Euskarako oinarria 'UI date picker' jquery-ko extentsioarentzat */ +/* Karrikas-ek itzulia (karrikas@karrikas.com) */ +jQuery(function($){ + $.datepicker.regional['eu'] = { + closeText: 'Egina', + prevText: '<Aur', + nextText: 'Hur>', + currentText: 'Gaur', + monthNames: ['Urtarrila','Otsaila','Martxoa','Apirila','Maiatza','Ekaina', + 'Uztaila','Abuztua','Iraila','Urria','Azaroa','Abendua'], + monthNamesShort: ['Urt','Ots','Mar','Api','Mai','Eka', + 'Uzt','Abu','Ira','Urr','Aza','Abe'], + dayNames: ['Igandea','Astelehena','Asteartea','Asteazkena','Osteguna','Ostirala','Larunbata'], + dayNamesShort: ['Iga','Ast','Ast','Ast','Ost','Ost','Lar'], + dayNamesMin: ['Ig','As','As','As','Os','Os','La'], + weekHeader: 'Wk', + dateFormat: 'yy/mm/dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['eu']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-fa.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-fa.js new file mode 100644 index 00000000000..adb3709feda --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-fa.js @@ -0,0 +1,23 @@ +/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */ +/* Javad Mowlanezhad -- jmowla@gmail.com */ +/* Jalali calendar should supported soon! (Its implemented but I have to test it) */ +jQuery(function($) { + $.datepicker.regional['fa'] = { + closeText: 'بستن', + prevText: '<قبلي', + nextText: 'بعدي>', + currentText: 'امروز', + monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور', + 'مهر','آبان','آذر','دي','بهمن','اسفند'], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: ['يکشنبه','دوشنبه','سه‌شنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'], + dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'], + dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'], + weekHeader: 'هف', + dateFormat: 'yy/mm/dd', + firstDay: 6, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fa']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-fi.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-fi.js new file mode 100644 index 00000000000..e1f25fd84ca --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-fi.js @@ -0,0 +1,23 @@ +/* Finnish initialisation for the jQuery UI date picker plugin. */ +/* Written by Harri Kilpi� (harrikilpio@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['fi'] = { + closeText: 'Sulje', + prevText: '«Edellinen', + nextText: 'Seuraava»', + currentText: 'Tänään', + monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu', + 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'], + monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä', + 'Heinä','Elo','Syys','Loka','Marras','Joulu'], + dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'], + dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'], + dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'], + weekHeader: 'Vk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fi']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-fo.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-fo.js new file mode 100644 index 00000000000..c14362216eb --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-fo.js @@ -0,0 +1,23 @@ +/* Faroese initialisation for the jQuery UI date picker plugin */ +/* Written by Sverri Mohr Olsen, sverrimo@gmail.com */ +jQuery(function($){ + $.datepicker.regional['fo'] = { + closeText: 'Lat aftur', + prevText: '<Fyrra', + nextText: 'Næsta>', + currentText: 'Í dag', + monthNames: ['Januar','Februar','Mars','Apríl','Mei','Juni', + 'Juli','August','September','Oktober','November','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun', + 'Jul','Aug','Sep','Okt','Nov','Des'], + dayNames: ['Sunnudagur','Mánadagur','Týsdagur','Mikudagur','Hósdagur','Fríggjadagur','Leyardagur'], + dayNamesShort: ['Sun','Mán','Týs','Mik','Hós','Frí','Ley'], + dayNamesMin: ['Su','Má','Tý','Mi','Hó','Fr','Le'], + weekHeader: 'Vk', + dateFormat: 'dd-mm-yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fo']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-fr-CH.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-fr-CH.js new file mode 100644 index 00000000000..38212d5482b --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-fr-CH.js @@ -0,0 +1,23 @@ +/* Swiss-French initialisation for the jQuery UI date picker plugin. */ +/* Written Martin Voelkle (martin.voelkle@e-tc.ch). */ +jQuery(function($){ + $.datepicker.regional['fr-CH'] = { + closeText: 'Fermer', + prevText: '<Préc', + nextText: 'Suiv>', + currentText: 'Courant', + monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin', + 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'], + monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun', + 'Jul','Aoû','Sep','Oct','Nov','Déc'], + dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'], + dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'], + weekHeader: 'Sm', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fr-CH']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-fr.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-fr.js new file mode 100644 index 00000000000..134bda65dea --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-fr.js @@ -0,0 +1,23 @@ +/* French initialisation for the jQuery UI date picker plugin. */ +/* Written by Keith Wood (kbwood{at}iinet.com.au) and Stéphane Nahmani (sholby@sholby.net). */ +jQuery(function($){ + $.datepicker.regional['fr'] = { + closeText: 'Fermer', + prevText: '<Préc', + nextText: 'Suiv>', + currentText: 'Courant', + monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin', + 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'], + monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun', + 'Jul','Aoû','Sep','Oct','Nov','Déc'], + dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'], + dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fr']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-he.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-he.js new file mode 100644 index 00000000000..3b3dc387f2f --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-he.js @@ -0,0 +1,23 @@ +/* Hebrew initialisation for the UI Datepicker extension. */ +/* Written by Amir Hardon (ahardon at gmail dot com). */ +jQuery(function($){ + $.datepicker.regional['he'] = { + closeText: 'סגור', + prevText: '<הקודם', + nextText: 'הבא>', + currentText: 'היום', + monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני', + 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'], + monthNamesShort: ['1','2','3','4','5','6', + '7','8','9','10','11','12'], + dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'], + dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['he']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-hr.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-hr.js new file mode 100644 index 00000000000..0285c1aa9bd --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-hr.js @@ -0,0 +1,23 @@ +/* Croatian i18n for the jQuery UI date picker plugin. */ +/* Written by Vjekoslav Nesek. */ +jQuery(function($){ + $.datepicker.regional['hr'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipanj', + 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'], + monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip', + 'Srp','Kol','Ruj','Lis','Stu','Pro'], + dayNames: ['Nedjelja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Tje', + dateFormat: 'dd.mm.yy.', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hr']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-hu.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-hu.js new file mode 100644 index 00000000000..249e7b0ef4f --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-hu.js @@ -0,0 +1,23 @@ +/* Hungarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Istvan Karaszi (jquery@spam.raszi.hu). */ +jQuery(function($){ + $.datepicker.regional['hu'] = { + closeText: 'bezárás', + prevText: '« vissza', + nextText: 'előre »', + currentText: 'ma', + monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június', + 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'], + monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún', + 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'], + dayNames: ['Vasárnap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'], + dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'], + dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'], + weekHeader: 'Hé', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hu']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-hy.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-hy.js new file mode 100644 index 00000000000..c6cc1946c47 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-hy.js @@ -0,0 +1,23 @@ +/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/ +jQuery(function($){ + $.datepicker.regional['hy'] = { + closeText: 'Փակել', + prevText: '<Նախ.', + nextText: 'Հաջ.>', + currentText: 'Այսօր', + monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս', + 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'], + monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս', + 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'], + dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'], + dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + weekHeader: 'ՇԲՏ', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hy']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-id.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-id.js new file mode 100644 index 00000000000..c626fbb7b83 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-id.js @@ -0,0 +1,23 @@ +/* Indonesian initialisation for the jQuery UI date picker plugin. */ +/* Written by Deden Fathurahman (dedenf@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['id'] = { + closeText: 'Tutup', + prevText: '<mundur', + nextText: 'maju>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Maret','April','Mei','Juni', + 'Juli','Agustus','September','Oktober','Nopember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun', + 'Jul','Agus','Sep','Okt','Nop','Des'], + dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'], + dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'], + dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'], + weekHeader: 'Mg', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['id']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-is.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-is.js new file mode 100644 index 00000000000..c53235a49e1 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-is.js @@ -0,0 +1,23 @@ +/* Icelandic initialisation for the jQuery UI date picker plugin. */ +/* Written by Haukur H. Thorsson (haukur@eskill.is). */ +jQuery(function($){ + $.datepicker.regional['is'] = { + closeText: 'Loka', + prevText: '< Fyrri', + nextText: 'Næsti >', + currentText: 'Í dag', + monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní', + 'Júlí','Ágúst','September','Október','Nóvember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún', + 'Júl','Ágú','Sep','Okt','Nóv','Des'], + dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'], + dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'], + dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'], + weekHeader: 'Vika', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['is']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-it.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-it.js new file mode 100644 index 00000000000..59da2df671e --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-it.js @@ -0,0 +1,23 @@ +/* Italian initialisation for the jQuery UI date picker plugin. */ +/* Written by Antonello Pasella (antonello.pasella@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['it'] = { + closeText: 'Chiudi', + prevText: '<Prec', + nextText: 'Succ>', + currentText: 'Oggi', + monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno', + 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'], + monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu', + 'Lug','Ago','Set','Ott','Nov','Dic'], + dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'], + dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'], + dayNamesMin: ['Do','Lu','Ma','Me','Gi','Ve','Sa'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['it']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-ja.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-ja.js new file mode 100644 index 00000000000..79cd827c766 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-ja.js @@ -0,0 +1,23 @@ +/* Japanese initialisation for the jQuery UI date picker plugin. */ +/* Written by Kentaro SATO (kentaro@ranvis.com). */ +jQuery(function($){ + $.datepicker.regional['ja'] = { + closeText: '閉じる', + prevText: '<前', + nextText: '次>', + currentText: '今日', + monthNames: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + monthNamesShort: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'], + dayNamesShort: ['日','月','火','水','木','金','土'], + dayNamesMin: ['日','月','火','水','木','金','土'], + weekHeader: '週', + dateFormat: 'yy/mm/dd', + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['ja']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-ko.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-ko.js new file mode 100644 index 00000000000..5b3531652d9 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-ko.js @@ -0,0 +1,23 @@ +/* Korean initialisation for the jQuery calendar extension. */ +/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ko'] = { + closeText: '닫기', + prevText: '이전달', + nextText: '다음달', + currentText: '오늘', + monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', + '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], + monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', + '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], + dayNames: ['일','월','화','수','목','금','토'], + dayNamesShort: ['일','월','화','수','목','금','토'], + dayNamesMin: ['일','월','화','수','목','금','토'], + weekHeader: 'Wk', + dateFormat: 'yy-mm-dd', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: '년'}; + $.datepicker.setDefaults($.datepicker.regional['ko']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-lt.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-lt.js new file mode 100644 index 00000000000..67d5119ca70 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-lt.js @@ -0,0 +1,23 @@ +/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas */ +jQuery(function($){ + $.datepicker.regional['lt'] = { + closeText: 'Uždaryti', + prevText: '<Atgal', + nextText: 'Pirmyn>', + currentText: 'Šiandien', + monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis', + 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'], + monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir', + 'Lie','Rugp','Rugs','Spa','Lap','Gru'], + dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'], + dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'], + dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'], + weekHeader: 'Wk', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['lt']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-lv.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-lv.js new file mode 100644 index 00000000000..003934e7212 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-lv.js @@ -0,0 +1,23 @@ +/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas */ +jQuery(function($){ + $.datepicker.regional['lv'] = { + closeText: 'Aizvērt', + prevText: 'Iepr', + nextText: 'Nāka', + currentText: 'Šodien', + monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs', + 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn', + 'Jūl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'], + dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'], + dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'], + weekHeader: 'Nav', + dateFormat: 'dd-mm-yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['lv']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-ms.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-ms.js new file mode 100644 index 00000000000..e953ac04f19 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-ms.js @@ -0,0 +1,23 @@ +/* Malaysian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */ +jQuery(function($){ + $.datepicker.regional['ms'] = { + closeText: 'Tutup', + prevText: '<Sebelum', + nextText: 'Selepas>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Mac','April','Mei','Jun', + 'Julai','Ogos','September','Oktober','November','Disember'], + monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun', + 'Jul','Ogo','Sep','Okt','Nov','Dis'], + dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'], + dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'], + dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'], + weekHeader: 'Mg', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ms']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-nl.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-nl.js new file mode 100644 index 00000000000..663d6bb26bd --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-nl.js @@ -0,0 +1,23 @@ +/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Mathias Bynens */ +jQuery(function($){ + $.datepicker.regional.nl = { + closeText: 'Sluiten', + prevText: '←', + nextText: '→', + currentText: 'Vandaag', + monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni', + 'juli', 'augustus', 'september', 'oktober', 'november', 'december'], + monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun', + 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'], + dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'], + dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'], + dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional.nl); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-no.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-no.js new file mode 100644 index 00000000000..12b2356bf34 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-no.js @@ -0,0 +1,23 @@ +/* Norwegian initialisation for the jQuery UI date picker plugin. */ +/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['no'] = { + closeText: 'Lukk', + prevText: '«Forrige', + nextText: 'Neste»', + currentText: 'I dag', + monthNames: ['Januar','Februar','Mars','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Des'], + dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], + dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], + dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], + weekHeader: 'Uke', + dateFormat: 'yy-mm-dd', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['no']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-pl.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-pl.js new file mode 100644 index 00000000000..61fa29ccd83 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-pl.js @@ -0,0 +1,23 @@ +/* Polish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pl'] = { + closeText: 'Zamknij', + prevText: '<Poprzedni', + nextText: 'Następny>', + currentText: 'Dziś', + monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec', + 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'], + monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze', + 'Lip','Sie','Wrz','Pa','Lis','Gru'], + dayNames: ['Niedziela','Poniedziałek','Wtorek','Środa','Czwartek','Piątek','Sobota'], + dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'], + dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'], + weekHeader: 'Tydz', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['pl']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-pt-BR.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-pt-BR.js new file mode 100644 index 00000000000..38818637dbe --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-pt-BR.js @@ -0,0 +1,23 @@ +/* Brazilian initialisation for the jQuery UI date picker plugin. */ +/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pt-BR'] = { + closeText: 'Fechar', + prevText: '<Anterior', + nextText: 'Próximo>', + currentText: 'Hoje', + monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho', + 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], + monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Out','Nov','Dez'], + dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'], + dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'], + dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['pt-BR']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-ro.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-ro.js new file mode 100644 index 00000000000..4fe95aeac16 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-ro.js @@ -0,0 +1,26 @@ +/* Romanian initialisation for the jQuery UI date picker plugin. + * + * Written by Edmond L. (ll_edmond@walla.com) + * and Ionut G. Stan (ionut.g.stan@gmail.com) + */ +jQuery(function($){ + $.datepicker.regional['ro'] = { + closeText: 'Închide', + prevText: '« Luna precedentă', + nextText: 'Luna următoare »', + currentText: 'Azi', + monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie', + 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'], + monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun', + 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'], + dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'], + dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'], + weekHeader: 'Săpt', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ro']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-ru.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-ru.js new file mode 100644 index 00000000000..b8091f9eccd --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-ru.js @@ -0,0 +1,23 @@ +/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Andrew Stromnov (stromnov@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ru'] = { + closeText: 'Закрыть', + prevText: '<Пред', + nextText: 'След>', + currentText: 'Сегодня', + monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь', + 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'], + monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн', + 'Июл','Авг','Сен','Окт','Ноя','Дек'], + dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'], + dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'], + dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'], + weekHeader: 'Не', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ru']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-sk.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-sk.js new file mode 100644 index 00000000000..8a6771c1e00 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-sk.js @@ -0,0 +1,23 @@ +/* Slovak initialisation for the jQuery UI date picker plugin. */ +/* Written by Vojtech Rinik (vojto@hmm.sk). */ +jQuery(function($){ + $.datepicker.regional['sk'] = { + closeText: 'Zavrieť', + prevText: '<Predchádzajúci', + nextText: 'Nasledujúci>', + currentText: 'Dnes', + monthNames: ['Január','Február','Marec','Apríl','Máj','Jún', + 'Júl','August','September','Október','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún', + 'Júl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'], + dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'], + dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'], + weekHeader: 'Ty', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sk']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-sl.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-sl.js new file mode 100644 index 00000000000..516550192a7 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-sl.js @@ -0,0 +1,24 @@ +/* Slovenian initialisation for the jQuery UI date picker plugin. */ +/* Written by Jaka Jancar (jaka@kubje.org). */ +/* c = č, s = š z = ž C = Č S = Š Z = Ž */ +jQuery(function($){ + $.datepicker.regional['sl'] = { + closeText: 'Zapri', + prevText: '<Prejšnji', + nextText: 'Naslednji>', + currentText: 'Trenutni', + monthNames: ['Januar','Februar','Marec','April','Maj','Junij', + 'Julij','Avgust','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Avg','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'], + dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'], + dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'], + weekHeader: 'Teden', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sl']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-sq.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-sq.js new file mode 100644 index 00000000000..be84104c096 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-sq.js @@ -0,0 +1,23 @@ +/* Albanian initialisation for the jQuery UI date picker plugin. */ +/* Written by Flakron Bytyqi (flakron@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['sq'] = { + closeText: 'mbylle', + prevText: '<mbrapa', + nextText: 'Përpara>', + currentText: 'sot', + monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor', + 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'], + monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer', + 'Kor','Gus','Sht','Tet','Nën','Dhj'], + dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'], + dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'], + dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'], + weekHeader: 'Ja', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sq']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-sr-SR.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-sr-SR.js new file mode 100644 index 00000000000..8f8ea5e6307 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-sr-SR.js @@ -0,0 +1,23 @@ +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr-SR'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Januar','Februar','Mart','April','Maj','Jun', + 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Avg','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Sed', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sr-SR']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-sr.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-sr.js new file mode 100644 index 00000000000..49c9b4a3036 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-sr.js @@ -0,0 +1,23 @@ +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr'] = { + closeText: 'Затвори', + prevText: '<', + nextText: '>', + currentText: 'Данас', + monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун', + 'Јул','Август','Септембар','Октобар','Новембар','Децембар'], + monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун', + 'Јул','Авг','Сеп','Окт','Нов','Дец'], + dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'], + dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'], + dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'], + weekHeader: 'Сед', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sr']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-sv.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-sv.js new file mode 100644 index 00000000000..8236b62b53b --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-sv.js @@ -0,0 +1,23 @@ +/* Swedish initialisation for the jQuery UI date picker plugin. */ +/* Written by Anders Ekdahl ( anders@nomadiz.se). */ +jQuery(function($){ + $.datepicker.regional['sv'] = { + closeText: 'Stäng', + prevText: '«Förra', + nextText: 'Nästa»', + currentText: 'Idag', + monthNames: ['Januari','Februari','Mars','April','Maj','Juni', + 'Juli','Augusti','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'], + dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'], + dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'], + weekHeader: 'Ve', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sv']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-ta.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-ta.js new file mode 100644 index 00000000000..91116d3877c --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-ta.js @@ -0,0 +1,23 @@ +/* Tamil (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by S A Sureshkumar (saskumar@live.com). */ +jQuery(function($){ + $.datepicker.regional['ta'] = { + closeText: 'மூடு', + prevText: 'முன்னையது', + nextText: 'அடுத்தது', + currentText: 'இன்று', + monthNames: ['தை','மாசி','பங்குனி','சித்திரை','வைகாசி','ஆனி', + 'ஆடி','ஆவணி','புரட்டாசி','ஐப்பசி','கார்த்திகை','மார்கழி'], + monthNamesShort: ['தை','மாசி','பங்','சித்','வைகா','ஆனி', + 'ஆடி','ஆவ','புர','ஐப்','கார்','மார்'], + dayNames: ['ஞாயிற்றுக்கிழமை','திங்கட்கிழமை','செவ்வாய்க்கிழமை','புதன்கிழமை','வியாழக்கிழமை','வெள்ளிக்கிழமை','சனிக்கிழமை'], + dayNamesShort: ['ஞாயிறு','திங்கள்','செவ்வாய்','புதன்','வியாழன்','வெள்ளி','சனி'], + dayNamesMin: ['ஞா','தி','செ','பு','வி','வெ','ச'], + weekHeader: 'Не', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ta']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-th.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-th.js new file mode 100644 index 00000000000..978500ab11b --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-th.js @@ -0,0 +1,23 @@ +/* Thai initialisation for the jQuery UI date picker plugin. */ +/* Written by pipo (pipo@sixhead.com). */ +jQuery(function($){ + $.datepicker.regional['th'] = { + closeText: 'ปิด', + prevText: '« ย้อน', + nextText: 'ถัดไป »', + currentText: 'วันนี้', + monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน', + 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'], + monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.', + 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'], + dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'], + dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['th']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-tr.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-tr.js new file mode 100644 index 00000000000..dedfc7ff99b --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-tr.js @@ -0,0 +1,23 @@ +/* Turkish initialisation for the jQuery UI date picker plugin. */ +/* Written by Izzet Emre Erkan (kara@karalamalar.net). */ +jQuery(function($){ + $.datepicker.regional['tr'] = { + closeText: 'kapat', + prevText: '<geri', + nextText: 'ileri>', + currentText: 'bugün', + monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran', + 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'], + monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz', + 'Tem','Ağu','Eyl','Eki','Kas','Ara'], + dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'], + dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + weekHeader: 'Hf', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['tr']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-uk.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-uk.js new file mode 100644 index 00000000000..112b40e7f8d --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-uk.js @@ -0,0 +1,23 @@ +/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['uk'] = { + closeText: 'Закрити', + prevText: '<', + nextText: '>', + currentText: 'Сьогодні', + monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень', + 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'], + monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер', + 'Лип','Сер','Вер','Жов','Лис','Гру'], + dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'], + dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'], + dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'], + weekHeader: 'Не', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['uk']); +}); \ No newline at end of file diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-vi.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-vi.js new file mode 100644 index 00000000000..9813a59e019 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-vi.js @@ -0,0 +1,23 @@ +/* Vietnamese initialisation for the jQuery UI date picker plugin. */ +/* Translated by Le Thanh Huy (lthanhhuy@cit.ctu.edu.vn). */ +jQuery(function($){ + $.datepicker.regional['vi'] = { + closeText: 'Đóng', + prevText: '<Trước', + nextText: 'Tiếp>', + currentText: 'Hôm nay', + monthNames: ['Tháng Một', 'Tháng Hai', 'Tháng Ba', 'Tháng Tư', 'Tháng Năm', 'Tháng Sáu', + 'Tháng Bảy', 'Tháng Tám', 'Tháng Chín', 'Tháng Mười', 'Tháng Mười Một', 'Tháng Mười Hai'], + monthNamesShort: ['Tháng 1', 'Tháng 2', 'Tháng 3', 'Tháng 4', 'Tháng 5', 'Tháng 6', + 'Tháng 7', 'Tháng 8', 'Tháng 9', 'Tháng 10', 'Tháng 11', 'Tháng 12'], + dayNames: ['Chủ Nhật', 'Thứ Hai', 'Thứ Ba', 'Thứ Tư', 'Thứ Năm', 'Thứ Sáu', 'Thứ Bảy'], + dayNamesShort: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'], + dayNamesMin: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'], + weekHeader: 'Tu', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['vi']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-zh-CN.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-zh-CN.js new file mode 100644 index 00000000000..6c4883f536d --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-zh-CN.js @@ -0,0 +1,23 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Cloudream (cloudream@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-CN'] = { + closeText: '关闭', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-CN']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-zh-HK.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-zh-HK.js new file mode 100644 index 00000000000..06c4c628c40 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-zh-HK.js @@ -0,0 +1,23 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by SCCY (samuelcychan@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-HK'] = { + closeText: '關閉', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'dd-mm-yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-HK']); +}); diff --git a/resources/jquery.ui/i18n/jquery.ui.datepicker-zh-TW.js b/resources/jquery.ui/i18n/jquery.ui.datepicker-zh-TW.js new file mode 100644 index 00000000000..d211573c678 --- /dev/null +++ b/resources/jquery.ui/i18n/jquery.ui.datepicker-zh-TW.js @@ -0,0 +1,23 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Ressol (ressol@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-TW'] = { + closeText: '關閉', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'yy/mm/dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-TW']); +}); diff --git a/resources/jquery.ui/jquery.ui.accordion.js b/resources/jquery.ui/jquery.ui.accordion.js new file mode 100644 index 00000000000..7d926e0960f --- /dev/null +++ b/resources/jquery.ui/jquery.ui.accordion.js @@ -0,0 +1,504 @@ +/* + * jQuery UI Accordion 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.accordion", { + options: { + active: 0, + animated: 'slide', + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() == location.href.toLowerCase(); + } + }, + _create: function() { + + var o = this.options, self = this; + this.running = 0; + + this.element.addClass("ui-accordion ui-widget ui-helper-reset"); + + // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix + this.element.children("li").addClass("ui-accordion-li-fix"); + + this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all") + .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); }) + .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); }) + .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); }) + .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); }); + + this.headers + .next() + .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); + + if ( o.navigation ) { + var current = this.element.find("a").filter(o.navigationFilter); + if ( current.length ) { + var header = current.closest(".ui-accordion-header"); + if ( header.length ) { + // anchor within header + this.active = header; + } else { + // anchor within content + this.active = current.closest(".ui-accordion-content").prev(); + } + } + } + + this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"); + this.active.next().addClass('ui-accordion-content-active'); + + //Append icon elements + this._createIcons(); + + this.resize(); + + //ARIA + this.element.attr('role','tablist'); + + this.headers + .attr('role','tab') + .bind('keydown', function(event) { return self._keydown(event); }) + .next() + .attr('role','tabpanel'); + + this.headers + .not(this.active || "") + .attr('aria-expanded','false') + .attr("tabIndex", "-1") + .next() + .hide(); + + // make sure at least one header is in the tab order + if (!this.active.length) { + this.headers.eq(0).attr('tabIndex','0'); + } else { + this.active + .attr('aria-expanded','true') + .attr('tabIndex', '0'); + } + + // only need links in taborder for Safari + if (!$.browser.safari) + this.headers.find('a').attr('tabIndex','-1'); + + if (o.event) { + this.headers.bind((o.event) + ".accordion", function(event) { + self._clickHandler.call(self, event, this); + event.preventDefault(); + }); + } + + }, + + _createIcons: function() { + var o = this.options; + if (o.icons) { + $("").addClass("ui-icon " + o.icons.header).prependTo(this.headers); + this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected); + this.element.addClass("ui-accordion-icons"); + } + }, + + _destroyIcons: function() { + this.headers.children(".ui-icon").remove(); + this.element.removeClass("ui-accordion-icons"); + }, + + destroy: function() { + var o = this.options; + + this.element + .removeClass("ui-accordion ui-widget ui-helper-reset") + .removeAttr("role") + .unbind('.accordion') + .removeData('accordion'); + + this.headers + .unbind(".accordion") + .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top") + .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex"); + + this.headers.find("a").removeAttr("tabIndex"); + this._destroyIcons(); + var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active"); + if (o.autoHeight || o.fillHeight) { + contents.css("height", ""); + } + + return this; + }, + + _setOption: function(key, value) { + $.Widget.prototype._setOption.apply(this, arguments); + + if (key == "active") { + this.activate(value); + } + if (key == "icons") { + this._destroyIcons(); + if (value) { + this._createIcons(); + } + } + + }, + + _keydown: function(event) { + + var o = this.options, keyCode = $.ui.keyCode; + + if (o.disabled || event.altKey || event.ctrlKey) + return; + + var length = this.headers.length; + var currentIndex = this.headers.index(event.target); + var toFocus = false; + + switch(event.keyCode) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[(currentIndex + 1) % length]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[(currentIndex - 1 + length) % length]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler({ target: event.target }, event.target); + event.preventDefault(); + } + + if (toFocus) { + $(event.target).attr('tabIndex','-1'); + $(toFocus).attr('tabIndex','0'); + toFocus.focus(); + return false; + } + + return true; + + }, + + resize: function() { + + var o = this.options, maxHeight; + + if (o.fillSpace) { + + if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); } + maxHeight = this.element.parent().height(); + if($.browser.msie) { this.element.parent().css('overflow', defOverflow); } + + this.headers.each(function() { + maxHeight -= $(this).outerHeight(true); + }); + + this.headers.next().each(function() { + $(this).height(Math.max(0, maxHeight - $(this).innerHeight() + $(this).height())); + }).css('overflow', 'auto'); + + } else if ( o.autoHeight ) { + maxHeight = 0; + this.headers.next().each(function() { + maxHeight = Math.max(maxHeight, $(this).height()); + }).height(maxHeight); + } + + return this; + }, + + activate: function(index) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive(index)[0]; + this._clickHandler({ target: active }, active); + + return this; + }, + + _findActive: function(selector) { + return selector + ? typeof selector == "number" + ? this.headers.filter(":eq(" + selector + ")") + : this.headers.not(this.headers.not(selector)) + : selector === false + ? $([]) + : this.headers.filter(":eq(0)"); + }, + + // TODO isn't event.target enough? why the seperate target argument? + _clickHandler: function(event, target) { + + var o = this.options; + if (o.disabled) + return; + + // called only when using activate(false) to close all parts programmatically + if (!event.target) { + if (!o.collapsible) + return; + this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all") + .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header); + this.active.next().addClass('ui-accordion-content-active'); + var toHide = this.active.next(), + data = { + options: o, + newHeader: $([]), + oldHeader: o.active, + newContent: $([]), + oldContent: toHide + }, + toShow = (this.active = $([])); + this._toggle(toShow, toHide, data); + return; + } + + // get the click target + var clicked = $(event.currentTarget || target); + var clickedIsActive = clicked[0] == this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + o.active = o.collapsible && clickedIsActive ? false : $('.ui-accordion-header', this.element).index(clicked); + + // if animations are still active, or the active header is the target, ignore click + if (this.running || (!o.collapsible && clickedIsActive)) { + return; + } + + // switch classes + this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all") + .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header); + if (!clickedIsActive) { + clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top") + .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected); + clicked.next().addClass('ui-accordion-content-active'); + } + + // find elements to show and hide + var toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: o, + newHeader: clickedIsActive && o.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && o.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + this.active = clickedIsActive ? $([]) : clicked; + this._toggle(toShow, toHide, data, clickedIsActive, down); + + return; + + }, + + _toggle: function(toShow, toHide, data, clickedIsActive, down) { + + var o = this.options, self = this; + + this.toShow = toShow; + this.toHide = toHide; + this.data = data; + + var complete = function() { if(!self) return; return self._completed.apply(self, arguments); }; + + // trigger changestart event + this._trigger("changestart", null, this.data); + + // count elements to animate + this.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if (o.animated) { + + var animOptions = {}; + + if ( o.collapsible && clickedIsActive ) { + animOptions = { + toShow: $([]), + toHide: toHide, + complete: complete, + down: down, + autoHeight: o.autoHeight || o.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: o.autoHeight || o.fillSpace + }; + } + + if (!o.proxied) { + o.proxied = o.animated; + } + + if (!o.proxiedDuration) { + o.proxiedDuration = o.duration; + } + + o.animated = $.isFunction(o.proxied) ? + o.proxied(animOptions) : o.proxied; + + o.duration = $.isFunction(o.proxiedDuration) ? + o.proxiedDuration(animOptions) : o.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = o.duration, + easing = o.animated; + + if (easing && !animations[easing] && !$.easing[easing]) { + easing = 'slide'; + } + if (!animations[easing]) { + animations[easing] = function(options) { + this.slide(options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[easing](animOptions); + + } else { + + if (o.collapsible && clickedIsActive) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete(true); + + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur(); + toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus(); + + }, + + _completed: function(cancel) { + + var o = this.options; + + this.running = cancel ? 0 : --this.running; + if (this.running) return; + + if (o.clearStyle) { + this.toShow.add(this.toHide).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass("ui-accordion-content-active"); + + this._trigger('change', null, this.data); + } + +}); + + +$.extend($.ui.accordion, { + version: "1.8.2", + animations: { + slide: function(options, additions) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions); + if ( !options.toHide.size() ) { + options.toShow.animate({height: "show"}, options); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({height: "hide"}, options); + return; + } + var overflow = options.toShow.css('overflow'), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) ); + + $.each(fxAttrs, function(i, prop) { + hideProps[prop] = 'hide'; + + var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/); + showProps[prop] = { + value: parts[1], + unit: parts[2] || 'px' + }; + }); + options.toShow.css({ height: 0, overflow: 'hidden' }).show(); + options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{ + step: function(now, settings) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if (settings.prop == 'height') { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + (settings.now - settings.start) / (settings.end - settings.start); + } + + options.toShow[0].style[settings.prop] = + (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css("height", ""); + } + options.toShow.css("width", originalWidth); + options.toShow.css({overflow: overflow}); + options.complete(); + } + }); + }, + bounceslide: function(options) { + this.slide(options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})(jQuery); diff --git a/resources/jquery.ui/jquery.ui.autocomplete.js b/resources/jquery.ui/jquery.ui.autocomplete.js new file mode 100644 index 00000000000..9a12a6b0aec --- /dev/null +++ b/resources/jquery.ui/jquery.ui.autocomplete.js @@ -0,0 +1,511 @@ +/* + * jQuery UI Autocomplete 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $ ) { + +$.widget( "ui.autocomplete", { + options: { + minLength: 1, + delay: 300 + }, + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument; + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._move( "previous", event ); + // prevent moving cursor to beginning of text field in some browsers + event.preventDefault(); + break; + case keyCode.DOWN: + self._move( "next", event ); + // prevent moving cursor to end of text field in some browsers + event.preventDefault(); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open or has focus + if ( self.menu.active ) { + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + case keyCode.LEFT: + case keyCode.RIGHT: + case keyCode.SHIFT: + case keyCode.CONTROL: + case keyCode.ALT: + case keyCode.COMMAND: + case keyCode.COMMAND_RIGHT: + case keyCode.INSERT: + case keyCode.CAPS_LOCK: + case keyCode.END: + case keyCode.HOME: + // ignore metakeys (shift, ctrl, alt) + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + self.search( null, event ); + }, self.options.delay ); + break; + } + }) + .bind( "focus.autocomplete", function() { + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.response = function() { + return self._response.apply( self, arguments ); + }; + this.menu = $( "
    " ) + .addClass( "ui-autocomplete" ) + .appendTo( "body", doc ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function() { + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", null, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + self.close( event ); + // only trigger when focus was lost (click on menu) + var previous = self.previous; + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + } + self.selectedItem = item; + }, + blur: function( event, ui ) { + if ( self.menu.element.is(":visible") ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + }, + + _initSource: function() { + var array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + $.getJSON( url, request, response ); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger("search") === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.term = this.element + .addClass( "ui-autocomplete-loading" ) + // always save the actual value, not the one passed as an argument + .val(); + + this.source( { term: value }, this.response ); + }, + + _response: function( content ) { + if ( content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + this.element.removeClass( "ui-autocomplete-loading" ); + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this._trigger( "close", event ); + this.menu.element.hide(); + this.menu.deactivate(); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ), + menuWidth, + textWidth; + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + this.menu.element.show().position({ + my: "left top", + at: "left bottom", + of: this.element, + collision: "none" + }); + + menuWidth = ul.width( "" ).width(); + textWidth = this.element.width(); + ul.width( Math.max( menuWidth, textWidth ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "
  • " ) + .data( "item.autocomplete", item ) + .append( "" + item.label + "" ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace( /([\^\$\(\)\[\]\{\}\*\.\+\?\|\\])/gi, "\\$1" ); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.attr("scrollTop"), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.attr("scrollTop", scroll + offset); + } else if (offset > elementHeight) { + this.element.attr("scrollTop", scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prev().length; + }, + + last: function() { + return this.active && !this.active.next().length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(":first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children("li").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(":last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(":last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(); + result = this.element.children("li").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(":first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element.attr("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); diff --git a/resources/jquery.ui/jquery.ui.button.js b/resources/jquery.ui/jquery.ui.button.js new file mode 100644 index 00000000000..d318e3dec69 --- /dev/null +++ b/resources/jquery.ui/jquery.ui.button.js @@ -0,0 +1,365 @@ +/* + * jQuery UI Button 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $ ) { + +var lastActive, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon ui-button-text-only", + formResetHandler = function( event ) { + $( ":ui-button", event.target.form ).each(function() { + var inst = $( this ).data( "button" ); + setTimeout(function() { + inst.refresh(); + }, 1 ); + }); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + if ( this.element.is( ":disabled" ) ) { + options.disabled = true; + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + $( this ).addClass( focusClass ); + }) + .bind( "blur.button", function() { + $( this ).removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + self.refresh(); + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", true ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else { + if ( this.element.is(":radio") ) { + this.type = "radio"; + } else { + if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + } + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + this.buttonElement = this.element.parents().last() + .find( "[for=" + this.element.attr("id") + "]" ); + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.attr( "disabled", true ); + } else { + this.element.removeAttr( "disabled" ); + } + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "" ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary; + if ( icons.primary || icons.secondary ) { + buttonElement.addClass( "ui-button-text-icon" + + ( multipleIcons ? "s" : "" ) ); + if ( icons.primary ) { + buttonElement.prepend( "" ); + } + if ( icons.secondary ) { + buttonElement.append( "" ); + } + if ( !this.options.text ) { + buttonElement + .addClass( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ) + .removeClass( "ui-button-text-icons ui-button-text-icon" ); + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonElement.addClass( "ui-button-text-only" ); + } + } +}); + +$.widget( "ui.buttonset", { + _create: function() { + this.element.addClass( "ui-buttonset" ); + this._init(); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + this.buttons = this.element.find( ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); diff --git a/resources/jquery.ui/jquery.ui.core.js b/resources/jquery.ui/jquery.ui.core.js new file mode 100644 index 00000000000..80448028d14 --- /dev/null +++ b/resources/jquery.ui/jquery.ui.core.js @@ -0,0 +1,216 @@ +/*! + * jQuery UI 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI + */ + +(function($) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ($.ui.version) { + return; +} + +//Helper functions and ui object +$.extend($.ui, { + version: "1.8.2", + + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function(module, option, set) { + var proto = $.ui[module].prototype; + for(var i in set) { + proto.plugins[i] = proto.plugins[i] || []; + proto.plugins[i].push([option, set[i]]); + } + }, + call: function(instance, name, args) { + var set = instance.plugins[name]; + if(!set || !instance.element[0].parentNode) { return; } + + for (var i = 0; i < set.length; i++) { + if (instance.options[set[i][0]]) { + set[i][1].apply(instance.element, args); + } + } + } + }, + + contains: function(a, b) { + return document.compareDocumentPosition + ? a.compareDocumentPosition(b) & 16 + : a !== b && a.contains(b); + }, + + hasScroll: function(el, a) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ($(el).css('overflow') == 'hidden') { return false; } + + var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop', + has = false; + + if (el[scroll] > 0) { return true; } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[scroll] = 1; + has = (el[scroll] > 0); + el[scroll] = 0; + return has; + }, + + isOverAxis: function(x, reference, size) { + //Determines when x coordinate is over "b" element axis + return (x > reference) && (x < (reference + size)); + }, + + isOver: function(y, x, top, left, height, width) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width); + }, + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +//jQuery plugins +$.fn.extend({ + _focus: $.fn.focus, + focus: function(delay, fn) { + return typeof delay === 'number' + ? this.each(function() { + var elem = this; + setTimeout(function() { + $(elem).focus(); + (fn && fn.call(elem)); + }, delay); + }) + : this._focus.apply(this, arguments); + }, + + enableSelection: function() { + return this + .attr('unselectable', 'off') + .css('MozUserSelect', ''); + }, + + disableSelection: function() { + return this + .attr('unselectable', 'on') + .css('MozUserSelect', 'none'); + }, + + scrollParent: function() { + var scrollParent; + if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function(zIndex) { + if (zIndex !== undefined) { + return this.css('zIndex', zIndex); + } + + if (this.length) { + var elem = $(this[0]), position, value; + while (elem.length && elem[0] !== document) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css('position'); + if (position == 'absolute' || position == 'relative' || position == 'fixed') + { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + //
    + value = parseInt(elem.css('zIndex')); + if (!isNaN(value) && value != 0) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + } +}); + + +//Additional selectors +$.extend($.expr[':'], { + data: function(elem, i, match) { + return !!$.data(elem, match[3]); + }, + + focusable: function(element) { + var nodeName = element.nodeName.toLowerCase(), + tabIndex = $.attr(element, 'tabindex'); + return (/input|select|textarea|button|object/.test(nodeName) + ? !element.disabled + : 'a' == nodeName || 'area' == nodeName + ? element.href || !isNaN(tabIndex) + : !isNaN(tabIndex)) + // the element and all of its ancestors must be visible + // the browser may report that the area is hidden + && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length; + }, + + tabbable: function(element) { + var tabIndex = $.attr(element, 'tabindex'); + return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable'); + } +}); + +})(jQuery); diff --git a/resources/jquery.ui/jquery.ui.datepicker.js b/resources/jquery.ui/jquery.ui.datepicker.js new file mode 100644 index 00000000000..cad1d58c522 --- /dev/null +++ b/resources/jquery.ui/jquery.ui.datepicker.js @@ -0,0 +1,1730 @@ +/* + * jQuery UI Datepicker 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ + +(function($) { // hide the namespace + +$.extend($.ui, { datepicker: { version: "1.8.2" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false // True to size the input for the date format, false to leave as is + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = $('
    '); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + $('
    '))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('' + appendText + ''); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $(''); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + extendRemove(inst.settings, settings); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDateDatepicker(target, date); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass, inst.dpDiv). + add($('td.' + $.datepicker._currentClass, inst.dpDiv)); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (event) { + $.datepicker.log(event); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {})); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._datepickerShowing = true; + var borders = $.datepicker._getBorders(inst.dpDiv); + inst.dpDiv.find('iframe.ui-datepicker-cover'). // IE6- only + css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + var borders = $.datepicker._getBorders(inst.dpDiv); + inst.dpDiv.empty().append(this._generateHTML(inst)) + .find('iframe.ui-datepicker-cover') // IE6- only + .css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + .end() + .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a') + .bind('mouseout', function(){ + $(this).removeClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover'); + }) + .bind('mouseover', function(){ + if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) { + $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + $(this).addClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover'); + } + }) + .end() + .find('.' + this._dayOverClass + ' a') + .trigger('mouseover') + .end(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + else + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + this._curInst = null; + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if ($target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst._selectingMonthYear = false; + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Restore input focus after not changing month/year. */ + _clickMonthYear: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (inst.input && inst._selectingMonthYear && !$.browser.msie) + inst.input.focus(); + inst._selectingMonthYear = !inst._selectingMonthYear; + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = (lookAhead(match) ? longNames : shortNames); + for (var i = 0; i < names.length; i++) { + if (value.substr(iValue, names[i].length) == names[i]) { + iValue += names[i].length; + return i + 1; + } + } + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/* + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + (date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + date = (date == null ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date))); + date = (date && date.toString() == 'Invalid Date' ? defaultDate : date); + if (date) { + date.setHours(0); + date.setMinutes(0); + date.setSeconds(0); + date.setMilliseconds(0); + } + return this._daylightSavingAdjust(date); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !(date); + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + date = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
    ' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
    ' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
    '; + } + calender += '
    ' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
    ' + + ''; + var thead = (showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = (!showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
    ' + this._get(inst, 'weekHeader') + '
    ' + + this._get(inst, 'calculateWeek')(printDate) + '' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
    ' + (isMultiMonth ? '
    ' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
    ' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
    '; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + html += ''; + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '
    '; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + date = (minDate && date < minDate ? minDate : date); + date = (maxDate && date > maxDate ? maxDate : date); + return date; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - new Date(year, month, 32).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.2"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); diff --git a/resources/jquery.ui/jquery.ui.dialog.js b/resources/jquery.ui/jquery.ui.dialog.js new file mode 100644 index 00000000000..5f9b1f8b6c9 --- /dev/null +++ b/resources/jquery.ui/jquery.ui.dialog.js @@ -0,0 +1,823 @@ +/* + * jQuery UI Dialog 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function($) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all '; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: 'center', + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + _create: function() { + this.originalTitle = this.element.attr('title'); + + var self = this, + options = self.options, + + title = options.title || self.originalTitle || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('
    ')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('
    ')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + maxZ = Math.max(maxZ, $(this).css('z-index')); + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + if (uiDialog.next().length) { + uiDialog.appendTo('body'); + } + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if (options.modal) { + uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode !== $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $([]) + .add(uiDialog.find('.ui-dialog-content :tabbable:first')) + .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first')) + .add(uiDialog) + .filter(':first') + .focus(); + + self._trigger('open'); + self._isOpen = true; + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
    ') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, fn) { + var button = $('') + .text(name) + .click(function() { fn.apply(self.element[0], arguments); }) + .appendTo(uiDialogButtonPane); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + position = position || $.ui.dialog.prototype.options.position; + + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( +// if (typeof position == 'string' || $.isArray(position)) { +// myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + } else if (typeof position === 'object') { + if ('left' in position) { + myAt[0] = 'left'; + offset[0] = position.left; + } else if ('right' in position) { + myAt[0] = 'right'; + offset[0] = -position.right; + } + + if ('top' in position) { + myAt[1] = 'top'; + offset[1] = position.top; + } else if ('bottom' in position) { + myAt[1] = 'bottom'; + offset[1] = -position.bottom; + } + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position({ + my: myAt.join(' '), + at: myAt.join(' '), + offset: offset.join(' '), + of: window, + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog, + isResizable = uiDialog.is(':data(resizable)'), + resize = false; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // convert whatever was passed in to a string, for text() to not throw up + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + if (value) { + self._makeDraggable(); + } else { + uiDialog.draggable('destroy'); + } + break; + case "height": + resize = true; + break; + case "maxHeight": + if (isResizable) { + uiDialog.resizable('option', 'maxHeight', value); + } + resize = true; + break; + case "maxWidth": + if (isResizable) { + uiDialog.resizable('option', 'maxWidth', value); + } + resize = true; + break; + case "minHeight": + if (isResizable) { + uiDialog.resizable('option', 'minHeight', value); + } + resize = true; + break; + case "minWidth": + if (isResizable) { + uiDialog.resizable('option', 'minWidth', value); + } + resize = true; + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + case "width": + resize = true; + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + if (resize) { + self._size(); + } + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight; + + // reset content sizing + // hide for non content measurement because height: 0 doesn't work in IE quirks mode (see #4350) + this.element.css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + + this.element + .css(options.height === 'auto' ? { + minHeight: Math.max(options.minHeight - nonContentHeight, 0), + height: 'auto' + } : { + minHeight: 0, + height: Math.max(options.height - nonContentHeight, 0) + }) + .show(); + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.2", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + return ($(event.target).zIndex() >= $.ui.dialog.overlay.maxZ); + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('
    ').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + this.oldInstances.push(this.instances.splice($.inArray($el, this.instances), 1)[0]); + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); diff --git a/resources/jquery.ui/jquery.ui.draggable.js b/resources/jquery.ui/jquery.ui.draggable.js new file mode 100644 index 00000000000..b4c1070dfa7 --- /dev/null +++ b/resources/jquery.ui/jquery.ui.draggable.js @@ -0,0 +1,797 @@ +/* + * jQuery UI Draggable 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is removed, don't bother to continue + if(!this.element[0] || !this.element[0].parentNode) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.2" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
    ') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); diff --git a/resources/jquery.ui/jquery.ui.droppable.js b/resources/jquery.ui/jquery.ui.droppable.js new file mode 100644 index 00000000000..b6a15fdf1b1 --- /dev/null +++ b/resources/jquery.ui/jquery.ui.droppable.js @@ -0,0 +1,285 @@ +/* + * jQuery UI Droppable 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function($) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.2" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l < x1 && x2 < r + && t < y1 && y2 < b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = dropped || this._drop.call(this, event); + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + } +}; + +})(jQuery); diff --git a/resources/jquery.ui/jquery.ui.mouse.js b/resources/jquery.ui/jquery.ui.mouse.js new file mode 100644 index 00000000000..871edd83182 --- /dev/null +++ b/resources/jquery.ui/jquery.ui.mouse.js @@ -0,0 +1,151 @@ +/*! + * jQuery UI Mouse 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if(self._preventClickEvent) { + self._preventClickEvent = false; + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + // TODO: figure out why we have to use originalEvent + event.originalEvent = event.originalEvent || {}; + if (event.originalEvent.mouseHandled) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + // preventDefault() is used to prevent the selection of text here - + // however, in Safari, this causes select boxes not to be selectable + // anymore, so this fix is needed + ($.browser.safari || event.preventDefault()); + + event.originalEvent.mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + this._preventClickEvent = (event.target == this._mouseDownEvent.target); + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); diff --git a/resources/jquery.ui/jquery.ui.position.js b/resources/jquery.ui/jquery.ui.position.js new file mode 100644 index 00000000000..50dd57f0e3e --- /dev/null +++ b/resources/jquery.ui/jquery.ui.position.js @@ -0,0 +1,233 @@ +/* + * jQuery UI Position 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Position + */ +(function( $ ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + horizontalDefault = "center", + verticalPositions = /top|center|bottom/, + verticalDefault = "center", + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( options.of.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + } else if ( options.of.scrollTo && options.of.document ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( options.of.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [verticalDefault] ) : + verticalPositions.test( pos[0] ) ? + [ horizontalDefault ].concat( pos ) : + [ horizontalDefault, verticalDefault ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : horizontalDefault; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : verticalDefault; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if (options.at[0] === horizontalDefault ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === verticalDefault ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + position = $.extend( {}, basePosition ); + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === horizontalDefault ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === verticalDefault ) { + position.top -= elemHeight / 2; + } + + // prevent fractions (see #5280) + position.left = parseInt( position.left ); + position.top = parseInt( position.top ); + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = position.left + data.elemWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( 0, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = position.top + data.elemHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( 0, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === "center" ) { + return; + } + var win = $( window ), + over = position.left + data.elemWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + offset = -2 * data.offset[ 0 ]; + position.left += position.left < 0 ? + myOffset + data.targetWidth + offset : + over > 0 ? + myOffset - data.targetWidth + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === "center" ) { + return; + } + var win = $( window ), + over = position.top + data.elemHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += position.top < 0 ? + myOffset + data.targetHeight + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +}( jQuery )); diff --git a/resources/jquery.ui/jquery.ui.progressbar.js b/resources/jquery.ui/jquery.ui.progressbar.js new file mode 100644 index 00000000000..4bc092d1941 --- /dev/null +++ b/resources/jquery.ui/jquery.ui.progressbar.js @@ -0,0 +1,107 @@ +/* + * jQuery UI Progressbar 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $ ) { + +$.widget( "ui.progressbar", { + options: { + value: 0 + }, + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this._valueMin(), + "aria-valuemax": this._valueMax(), + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "
    " ) + .appendTo( this.element ); + + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + switch ( key ) { + case "value": + this.options.value = value; + this._refreshValue(); + this._trigger( "change" ); + break; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + if ( val < this._valueMin() ) { + val = this._valueMin(); + } + if ( val > this._valueMax() ) { + val = this._valueMax(); + } + + return val; + }, + + _valueMin: function() { + return 0; + }, + + _valueMax: function() { + return 100; + }, + + _refreshValue: function() { + var value = this.value(); + this.valueDiv + [ value === this._valueMax() ? "addClass" : "removeClass"]( "ui-corner-right" ) + .width( value + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.2" +}); + +})( jQuery ); diff --git a/resources/jquery.ui/jquery.ui.resizable.js b/resources/jquery.ui/jquery.ui.resizable.js new file mode 100644 index 00000000000..0a782bb515e --- /dev/null +++ b/resources/jquery.ui/jquery.ui.resizable.js @@ -0,0 +1,799 @@ +/* + * jQuery UI Resizable 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('
    ').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('
    '); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (data.height) data.width = (csize.height * this.aspectRatio); + else if (data.width) data.height = (csize.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('
    '); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.2" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options; + + var _store = function(exp) { + $(exp).each(function() { + $(this).data("resizable-alsoresize", { + width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10), + left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function(exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left']; + + $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + //Opera fixing relative position + if (/relative/.test(el.css('position')) && $.browser.opera) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"); + + //Opera fixing relative position + if (self._revertToRelativePosition && $.browser.opera) { + self._revertToRelativePosition = false; + el.css({ position: 'relative' }); + } + + $(this).removeData("resizable-alsoresize-start"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); diff --git a/resources/jquery.ui/jquery.ui.selectable.js b/resources/jquery.ui/jquery.ui.selectable.js new file mode 100644 index 00000000000..bc707d36ff9 --- /dev/null +++ b/resources/jquery.ui/jquery.ui.selectable.js @@ -0,0 +1,269 @@ + +/* + * jQuery UI Selectable 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("
    "); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "z-index": 100, + "position": "absolute", + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if (event.metaKey && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.2" +}); + +})(jQuery); diff --git a/resources/jquery.ui/jquery.ui.slider.js b/resources/jquery.ui/jquery.ui.slider.js new file mode 100644 index 00000000000..81d854b5838 --- /dev/null +++ b/resources/jquery.ui/jquery.ui.slider.js @@ -0,0 +1,682 @@ +/* + * jQuery UI Slider 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ + +(function( $ ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ); + + if ( o.disabled ) { + this.element.addClass( "ui-slider-disabled ui-disabled" ); + } + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + this.range = $( "
    " ); + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } else { + this.range = $( "
    " ); + } + + this.range + .appendTo( this.element ) + .addClass( "ui-slider-range" ); + + if ( o.range === "min" || o.range === "max" ) { + this.range.addClass( "ui-slider-range-" + o.range ); + } + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + this.range.addClass( "ui-widget-header" ); + } + + if ( $( ".ui-slider-handle", this.element ).length === 0 ) { + $( "" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + + if ( o.values && o.values.length ) { + while ( $(".ui-slider-handle", this.element).length < o.values.length ) { + $( "" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + } + + this.handles = $( ".ui-slider-handle", this.element ) + .addClass( "ui-state-default" + + " ui-corner-all" ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var ret = true, + index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + + return ret; + + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + normValue = this._normValueFromMouse( position ); + this._slide( event, index, normValue ); + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.attr( "disabled", "disabled" ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.removeAttr( "disabled" ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val < this._valueMin() ) { + return this._valueMin(); + } + if ( val > this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = val % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.2" +}); + +}(jQuery)); diff --git a/resources/jquery.ui/jquery.ui.sortable.js b/resources/jquery.ui/jquery.ui.sortable.js new file mode 100644 index 00000000000..fe9898e066b --- /dev/null +++ b/resources/jquery.ui/jquery.ui.sortable.js @@ -0,0 +1,1067 @@ +/* + * jQuery UI Sortable 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are floating + this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled") + .removeData("sortable") + .unbind(".sortable"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData("sortable-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, 'sortable-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp(); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(sortable-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data('sortable-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.2" +}); + +})(jQuery); diff --git a/resources/jquery.ui/jquery.ui.tabs.js b/resources/jquery.ui/jquery.ui.tabs.js new file mode 100644 index 00000000000..1f94d52a250 --- /dev/null +++ b/resources/jquery.ui/jquery.ui.tabs.js @@ -0,0 +1,729 @@ +/* + * jQuery UI Tabs 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget("ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: 'click', + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: 'ui-tabs-', + load: null, + panelTemplate: '
    ', + remove: null, + select: null, + show: null, + spinner: 'Loading…', + tabTemplate: '
  • #{label}
  • ' + }, + _create: function() { + this._tabify(true); + }, + + _setOption: function(key, value) { + if (key == 'selected') { + if (this.options.collapsible && value == this.options.selected) { + return; + } + this.select(value); + } + else { + this.options[key] = value; + this._tabify(); + } + }, + + _tabId: function(a) { + return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function(hash) { + return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":" + }, + + _cookie: function() { + var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + getNextListId()); + return $.cookie.apply(null, [cookie].concat($.makeArray(arguments))); + }, + + _ui: function(tab, panel) { + return { + tab: tab, + panel: panel, + index: this.anchors.index(tab) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter('.ui-state-processing').removeClass('ui-state-processing') + .find('span:data(label.tabs)') + .each(function() { + var el = $(this); + el.html(el.data('label.tabs')).removeData('label.tabs'); + }); + }, + + _tabify: function(init) { + + this.list = this.element.find('ol,ul').eq(0); + this.lis = $('li:has(a[href])', this.list); + this.anchors = this.lis.map(function() { return $('a', this)[0]; }); + this.panels = $([]); + + var self = this, o = this.options; + + var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + this.anchors.each(function(i, a) { + var href = $(a).attr('href'); + + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split('#')[0], baseEl; + if (hrefBase && (hrefBase === location.toString().split('#')[0] || + (baseEl = $('base')[0]) && hrefBase === baseEl.href)) { + href = a.hash; + a.href = href; + } + + // inline tab + if (fragmentId.test(href)) { + self.panels = self.panels.add(self._sanitizeSelector(href)); + } + + // remote tab + else if (href != '#') { // prevent loading the page itself if href is just "#" + $.data(a, 'href.tabs', href); // required for restore on destroy + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data + + var id = self._tabId(a); + a.href = '#' + id; + var $panel = $('#' + id); + if (!$panel.length) { + $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom') + .insertAfter(self.panels[i - 1] || self.list); + $panel.data('destroy.tabs', true); + } + self.panels = self.panels.add($panel); + } + + // invalid tab href + else { + o.disabled.push(i); + } + }); + + // initialization from scratch + if (init) { + + // attach necessary classes for styling + this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all'); + this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); + this.lis.addClass('ui-state-default ui-corner-top'); + this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom'); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
  • + if (o.selected === undefined) { + if (location.hash) { + this.anchors.each(function(i, a) { + if (a.hash == location.hash) { + o.selected = i; + return false; // break + } + }); + } + if (typeof o.selected != 'number' && o.cookie) { + o.selected = parseInt(self._cookie(), 10); + } + if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) { + o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected')); + } + o.selected = o.selected || (this.lis.length ? 0 : -1); + } + else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique(o.disabled.concat( + $.map(this.lis.filter('.ui-state-disabled'), + function(n, i) { return self.lis.index(n); } ) + )).sort(); + + if ($.inArray(o.selected, o.disabled) != -1) { + o.disabled.splice($.inArray(o.selected, o.disabled), 1); + } + + // highlight selected tab + this.panels.addClass('ui-tabs-hide'); + this.lis.removeClass('ui-tabs-selected ui-state-active'); + if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list + this.panels.eq(o.selected).removeClass('ui-tabs-hide'); + this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active'); + + // seems to be expected behavior that the show callback is fired + self.element.queue("tabs", function() { + self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected])); + }); + + this.load(o.selected); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + $(window).bind('unload', function() { + self.lis.add(self.anchors).unbind('.tabs'); + self.lis = self.anchors = self.panels = null; + }); + + } + // update selected after add/remove + else { + o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected')); + } + + // update collapsible + this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible'); + + // set or update cookie after init and add/remove respectively + if (o.cookie) { + this._cookie(o.selected, o.cookie); + } + + // disable tabs + for (var i = 0, li; (li = this.lis[i]); i++) { + $(li)[$.inArray(i, o.disabled) != -1 && + !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled'); + } + + // reset cache if switching from cached to not cached + if (o.cache === false) { + this.anchors.removeData('cache.tabs'); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add(this.anchors).unbind('.tabs'); + + if (o.event != 'mouseover') { + var addState = function(state, el) { + if (el.is(':not(.ui-state-disabled)')) { + el.addClass('ui-state-' + state); + } + }; + var removeState = function(state, el) { + el.removeClass('ui-state-' + state); + }; + this.lis.bind('mouseover.tabs', function() { + addState('hover', $(this)); + }); + this.lis.bind('mouseout.tabs', function() { + removeState('hover', $(this)); + }); + this.anchors.bind('focus.tabs', function() { + addState('focus', $(this).closest('li')); + }); + this.anchors.bind('blur.tabs', function() { + removeState('focus', $(this).closest('li')); + }); + } + + // set up animations + var hideFx, showFx; + if (o.fx) { + if ($.isArray(o.fx)) { + hideFx = o.fx[0]; + showFx = o.fx[1]; + } + else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle($el, fx) { + $el.css({ display: '' }); + if (!$.support.opacity && fx.opacity) { + $el[0].style.removeAttribute('filter'); + } + } + + // Show a tab... + var showTab = showFx ? + function(clicked, $show) { + $(clicked).closest('li').addClass('ui-tabs-selected ui-state-active'); + $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way + .animate(showFx, showFx.duration || 'normal', function() { + resetStyle($show, showFx); + self._trigger('show', null, self._ui(clicked, $show[0])); + }); + } : + function(clicked, $show) { + $(clicked).closest('li').addClass('ui-tabs-selected ui-state-active'); + $show.removeClass('ui-tabs-hide'); + self._trigger('show', null, self._ui(clicked, $show[0])); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx ? + function(clicked, $hide) { + $hide.animate(hideFx, hideFx.duration || 'normal', function() { + self.lis.removeClass('ui-tabs-selected ui-state-active'); + $hide.addClass('ui-tabs-hide'); + resetStyle($hide, hideFx); + self.element.dequeue("tabs"); + }); + } : + function(clicked, $hide, $show) { + self.lis.removeClass('ui-tabs-selected ui-state-active'); + $hide.addClass('ui-tabs-hide'); + self.element.dequeue("tabs"); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind(o.event + '.tabs', function() { + var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'), + $show = $(self._sanitizeSelector(this.hash)); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if (($li.hasClass('ui-tabs-selected') && !o.collapsible) || + $li.hasClass('ui-state-disabled') || + $li.hasClass('ui-state-processing') || + self._trigger('select', null, self._ui(this, $show[0])) === false) { + this.blur(); + return false; + } + + o.selected = self.anchors.index(this); + + self.abort(); + + // if tab may be closed + if (o.collapsible) { + if ($li.hasClass('ui-tabs-selected')) { + o.selected = -1; + + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + self.element.queue("tabs", function() { + hideTab(el, $hide); + }).dequeue("tabs"); + + this.blur(); + return false; + } + else if (!$hide.length) { + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + self.element.queue("tabs", function() { + showTab(el, $show); + }); + + self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + + this.blur(); + return false; + } + } + + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + // show new tab + if ($show.length) { + if ($hide.length) { + self.element.queue("tabs", function() { + hideTab(el, $hide); + }); + } + self.element.queue("tabs", function() { + showTab(el, $show); + }); + + self.load(self.anchors.index(this)); + } + else { + throw 'jQuery UI Tabs: Mismatching fragment identifier.'; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ($.browser.msie) { + this.blur(); + } + + }); + + // disable click in any case + this.anchors.bind('click.tabs', function(){return false;}); + + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element.unbind('.tabs') + .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible') + .removeData('tabs'); + + this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); + + this.anchors.each(function() { + var href = $.data(this, 'href.tabs'); + if (href) { + this.href = href; + } + var $this = $(this).unbind('.tabs'); + $.each(['href', 'load', 'cache'], function(i, prefix) { + $this.removeData(prefix + '.tabs'); + }); + }); + + this.lis.unbind('.tabs').add(this.panels).each(function() { + if ($.data(this, 'destroy.tabs')) { + $(this).remove(); + } + else { + $(this).removeClass([ + 'ui-state-default', + 'ui-corner-top', + 'ui-tabs-selected', + 'ui-state-active', + 'ui-state-hover', + 'ui-state-focus', + 'ui-state-disabled', + 'ui-tabs-panel', + 'ui-widget-content', + 'ui-corner-bottom', + 'ui-tabs-hide' + ].join(' ')); + } + }); + + if (o.cookie) { + this._cookie(null, o.cookie); + } + + return this; + }, + + add: function(url, label, index) { + if (index === undefined) { + index = this.anchors.length; // append by default + } + + var self = this, o = this.options, + $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)), + id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]); + + $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true); + + // try to find an existing element before creating a new one + var $panel = $('#' + id); + if (!$panel.length) { + $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true); + } + $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide'); + + if (index >= this.lis.length) { + $li.appendTo(this.list); + $panel.appendTo(this.list[0].parentNode); + } + else { + $li.insertBefore(this.lis[index]); + $panel.insertBefore(this.panels[index]); + } + + o.disabled = $.map(o.disabled, + function(n, i) { return n >= index ? ++n : n; }); + + this._tabify(); + + if (this.anchors.length == 1) { // after tabify + o.selected = 0; + $li.addClass('ui-tabs-selected ui-state-active'); + $panel.removeClass('ui-tabs-hide'); + this.element.queue("tabs", function() { + self._trigger('show', null, self._ui(self.anchors[0], self.panels[0])); + }); + + this.load(0); + } + + // callback + this._trigger('add', null, this._ui(this.anchors[index], this.panels[index])); + return this; + }, + + remove: function(index) { + var o = this.options, $li = this.lis.eq(index).remove(), + $panel = this.panels.eq(index).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) { + this.select(index + (index + 1 < this.anchors.length ? 1 : -1)); + } + + o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }), + function(n, i) { return n >= index ? --n : n; }); + + this._tabify(); + + // callback + this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0])); + return this; + }, + + enable: function(index) { + var o = this.options; + if ($.inArray(index, o.disabled) == -1) { + return; + } + + this.lis.eq(index).removeClass('ui-state-disabled'); + o.disabled = $.grep(o.disabled, function(n, i) { return n != index; }); + + // callback + this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index])); + return this; + }, + + disable: function(index) { + var self = this, o = this.options; + if (index != o.selected) { // cannot disable already selected tab + this.lis.eq(index).addClass('ui-state-disabled'); + + o.disabled.push(index); + o.disabled.sort(); + + // callback + this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index])); + } + + return this; + }, + + select: function(index) { + if (typeof index == 'string') { + index = this.anchors.index(this.anchors.filter('[href$=' + index + ']')); + } + else if (index === null) { // usage of null is deprecated, TODO remove in next release + index = -1; + } + if (index == -1 && this.options.collapsible) { + index = this.options.selected; + } + + this.anchors.eq(index).trigger(this.options.event + '.tabs'); + return this; + }, + + load: function(index) { + var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs'); + + this.abort(); + + // not remote or from cache + if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) { + this.element.dequeue("tabs"); + return; + } + + // load remote from here on + this.lis.eq(index).addClass('ui-state-processing'); + + if (o.spinner) { + var span = $('span', a); + span.data('label.tabs', span.html()).html(o.spinner); + } + + this.xhr = $.ajax($.extend({}, o.ajaxOptions, { + url: url, + success: function(r, s) { + $(self._sanitizeSelector(a.hash)).html(r); + + // take care of tab labels + self._cleanup(); + + if (o.cache) { + $.data(a, 'cache.tabs', true); // if loaded once do not load them again + } + + // callbacks + self._trigger('load', null, self._ui(self.anchors[index], self.panels[index])); + try { + o.ajaxOptions.success(r, s); + } + catch (e) {} + }, + error: function(xhr, s, e) { + // take care of tab labels + self._cleanup(); + + // callbacks + self._trigger('load', null, self._ui(self.anchors[index], self.panels[index])); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error(xhr, s, index, a); + } + catch (e) {} + } + })); + + // last, so that load event is fired before show... + self.element.dequeue("tabs"); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue([]); + this.panels.stop(false, true); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue("tabs", this.element.queue("tabs").splice(-2, 2)); + + // terminate pending requests from other tabs + if (this.xhr) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function(index, url) { + this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url); + return this; + }, + + length: function() { + return this.anchors.length; + } + +}); + +$.extend($.ui.tabs, { + version: '1.8.2' +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend($.ui.tabs.prototype, { + rotation: null, + rotate: function(ms, continuing) { + + var self = this, o = this.options; + + var rotate = self._rotate || (self._rotate = function(e) { + clearTimeout(self.rotation); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms); + + if (e) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || (self._unrotate = !continuing ? + function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } : + function(e) { + t = o.selected; + rotate(); + }); + + // start rotation + if (ms) { + this.element.bind('tabsshow', rotate); + this.anchors.bind(o.event + '.tabs', stop); + rotate(); + } + // stop rotation + else { + clearTimeout(self.rotation); + this.element.unbind('tabsshow', rotate); + this.anchors.unbind(o.event + '.tabs', stop); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})(jQuery); diff --git a/resources/jquery.ui/jquery.ui.widget.js b/resources/jquery.ui/jquery.ui.widget.js new file mode 100644 index 00000000000..6425d086a5d --- /dev/null +++ b/resources/jquery.ui/jquery.ui.widget.js @@ -0,0 +1,236 @@ +/*! + * jQuery UI Widget 1.8.2 + * + * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Widget + */ +(function( $ ) { + +var _remove = $.fn.remove; + +$.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( this ).each(function() { + $( this ).triggerHandler( "remove" ); + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); +}; + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.substring( 0, 1 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + if ( options ) { + instance.option( options ); + } + instance._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + this.element = $( element ).data( this.widgetName, this ); + this.options = $.extend( true, {}, + this.options, + $.metadata && $.metadata.get( element )[ this.widgetName ], + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._init(); + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key, + self = this; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, self.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return self; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); diff --git a/resources/jquery.ui/themes/default/images/ui-anim_basic_16x16.gif b/resources/jquery.ui/themes/default/images/ui-anim_basic_16x16.gif new file mode 100644 index 00000000000..085ccaecaf5 Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-anim_basic_16x16.gif differ diff --git a/resources/jquery.ui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png b/resources/jquery.ui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png new file mode 100644 index 00000000000..5b5dab2ab7b Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-bg_flat_55_fbf9ee_40x100.png b/resources/jquery.ui/themes/default/images/ui-bg_flat_55_fbf9ee_40x100.png new file mode 100644 index 00000000000..062f58072ae Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-bg_flat_55_fbf9ee_40x100.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-bg_flat_65_ffffff_40x100.png b/resources/jquery.ui/themes/default/images/ui-bg_flat_65_ffffff_40x100.png new file mode 100644 index 00000000000..ac8b229af95 Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-bg_flat_65_ffffff_40x100.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-bg_flat_75_cccccc_40x100.png b/resources/jquery.ui/themes/default/images/ui-bg_flat_75_cccccc_40x100.png new file mode 100644 index 00000000000..5473afffbc2 Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-bg_flat_75_cccccc_40x100.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-bg_flat_75_dadada_40x100.png b/resources/jquery.ui/themes/default/images/ui-bg_flat_75_dadada_40x100.png new file mode 100644 index 00000000000..7b7b0744db4 Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-bg_flat_75_dadada_40x100.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-bg_flat_75_e6e6e6_40x100.png b/resources/jquery.ui/themes/default/images/ui-bg_flat_75_e6e6e6_40x100.png new file mode 100644 index 00000000000..5b4ca1a0367 Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-bg_flat_75_e6e6e6_40x100.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png b/resources/jquery.ui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png new file mode 100644 index 00000000000..ac8b229af95 Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-bg_flat_95_fef1ec_40x100.png b/resources/jquery.ui/themes/default/images/ui-bg_flat_95_fef1ec_40x100.png new file mode 100644 index 00000000000..c61aad2e39c Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-bg_flat_95_fef1ec_40x100.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-icons_222222_256x240.png b/resources/jquery.ui/themes/default/images/ui-icons_222222_256x240.png new file mode 100644 index 00000000000..b273ff111d2 Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-icons_222222_256x240.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-icons_2e83ff_256x240.png b/resources/jquery.ui/themes/default/images/ui-icons_2e83ff_256x240.png new file mode 100644 index 00000000000..84defe6e8ab Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-icons_2e83ff_256x240.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-icons_454545_256x240.png b/resources/jquery.ui/themes/default/images/ui-icons_454545_256x240.png new file mode 100644 index 00000000000..59bd45b907c Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-icons_454545_256x240.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-icons_888888_256x240.png b/resources/jquery.ui/themes/default/images/ui-icons_888888_256x240.png new file mode 100644 index 00000000000..6d02426c114 Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-icons_888888_256x240.png differ diff --git a/resources/jquery.ui/themes/default/images/ui-icons_cd0a0a_256x240.png b/resources/jquery.ui/themes/default/images/ui-icons_cd0a0a_256x240.png new file mode 100644 index 00000000000..2ab019b73ec Binary files /dev/null and b/resources/jquery.ui/themes/default/images/ui-icons_cd0a0a_256x240.png differ diff --git a/resources/jquery.ui/themes/default/jquery.ui.accordion.css b/resources/jquery.ui/themes/default/jquery.ui.accordion.css new file mode 100644 index 00000000000..8d8a1a6e183 --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.accordion.css @@ -0,0 +1,12 @@ +/* Accordion +----------------------------------*/ +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +/* IE7-/Win - Fix extra vertical space in lists */ +.ui-accordion a { zoom: 1; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } \ No newline at end of file diff --git a/resources/jquery.ui/themes/default/jquery.ui.autocomplete.css b/resources/jquery.ui/themes/default/jquery.ui.autocomplete.css new file mode 100644 index 00000000000..f9900624362 --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.autocomplete.css @@ -0,0 +1,39 @@ +/* Autocomplete +----------------------------------*/ +.ui-autocomplete { position: absolute; cursor: default; } +.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* Menu +----------------------------------*/ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} diff --git a/resources/jquery.ui/themes/default/jquery.ui.button.css b/resources/jquery.ui/themes/default/jquery.ui.button.css new file mode 100644 index 00000000000..47777a42800 --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.button.css @@ -0,0 +1,35 @@ +/* Button +----------------------------------*/ + +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ + + + + + diff --git a/resources/jquery.ui/themes/default/jquery.ui.core.css b/resources/jquery.ui/themes/default/jquery.ui.core.css new file mode 100644 index 00000000000..b3e81930595 --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.core.css @@ -0,0 +1,37 @@ +/* +* jQuery UI CSS Framework +* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +*/ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute; left: -99999999px; } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } diff --git a/resources/jquery.ui/themes/default/jquery.ui.datepicker.css b/resources/jquery.ui/themes/default/jquery.ui.datepicker.css new file mode 100644 index 00000000000..a1116e69c74 --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.datepicker.css @@ -0,0 +1,61 @@ +/* Datepicker +----------------------------------*/ +.ui-datepicker { width: 17em; padding: .2em .2em 0; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +} \ No newline at end of file diff --git a/resources/jquery.ui/themes/default/jquery.ui.dialog.css b/resources/jquery.ui/themes/default/jquery.ui.dialog.css new file mode 100644 index 00000000000..f8354642a4c --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.dialog.css @@ -0,0 +1,13 @@ +/* Dialog +----------------------------------*/ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } diff --git a/resources/jquery.ui/themes/default/jquery.ui.progressbar.css b/resources/jquery.ui/themes/default/jquery.ui.progressbar.css new file mode 100644 index 00000000000..bc0939ecfa1 --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.progressbar.css @@ -0,0 +1,4 @@ +/* Progressbar +----------------------------------*/ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/resources/jquery.ui/themes/default/jquery.ui.resizable.css b/resources/jquery.ui/themes/default/jquery.ui.resizable.css new file mode 100644 index 00000000000..366643b5421 --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.resizable.css @@ -0,0 +1,13 @@ +/* Resizable +----------------------------------*/ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;} \ No newline at end of file diff --git a/resources/jquery.ui/themes/default/jquery.ui.selectable.css b/resources/jquery.ui/themes/default/jquery.ui.selectable.css new file mode 100644 index 00000000000..c5d46ce24bf --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.selectable.css @@ -0,0 +1,3 @@ +/* Selectable +----------------------------------*/ +.ui-selectable-helper { border:1px dotted black } diff --git a/resources/jquery.ui/themes/default/jquery.ui.slider.css b/resources/jquery.ui/themes/default/jquery.ui.slider.css new file mode 100644 index 00000000000..07c6f4e5ef3 --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.slider.css @@ -0,0 +1,17 @@ +/* Slider +----------------------------------*/ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; } \ No newline at end of file diff --git a/resources/jquery.ui/themes/default/jquery.ui.tabs.css b/resources/jquery.ui/themes/default/jquery.ui.tabs.css new file mode 100644 index 00000000000..99e16dbdbe6 --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.tabs.css @@ -0,0 +1,11 @@ +/* Tabs +----------------------------------*/ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } diff --git a/resources/jquery.ui/themes/default/jquery.ui.theme.css b/resources/jquery.ui/themes/default/jquery.ui.theme.css new file mode 100644 index 00000000000..47fbc23866d --- /dev/null +++ b/resources/jquery.ui/themes/default/jquery.ui.theme.css @@ -0,0 +1,249 @@ + + +/* +* jQuery UI CSS Framework +* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=sans-serif&fwDefault=normal&fsDefault=1em&cornerRadius=0&bgColorHeader=cccccc&bgTextureHeader=01_flat.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=01_flat.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=01_flat.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=01_flat.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=01_flat.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=01_flat.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px +*/ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: sans-serif; font-size: 1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } +.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_flat_75_cccccc_40x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } +.ui-widget-header a { color: #222222; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_flat_75_e6e6e6_40x100.png) 50% 50% repeat-x; font-weight: normal; color: #555555; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_flat_75_dadada_40x100.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_65_ffffff_40x100.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_flat_55_fbf9ee_40x100.png) 50% 50% repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_flat_95_fef1ec_40x100.png) 50% 50% repeat-x; color: #cd0a0a; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; border-top-left-radius: 0; } +.ui-corner-tr { -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; border-top-right-radius: 0; } +.ui-corner-bl { -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; border-bottom-left-radius: 0; } +.ui-corner-br { -moz-border-radius-bottomright: 0; -webkit-border-bottom-right-radius: 0; border-bottom-right-radius: 0; } +.ui-corner-top { -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; border-top-left-radius: 0; -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; border-top-right-radius: 0; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; border-bottom-left-radius: 0; -moz-border-radius-bottomright: 0; -webkit-border-bottom-right-radius: 0; border-bottom-right-radius: 0; } +.ui-corner-right { -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; border-top-right-radius: 0; -moz-border-radius-bottomright: 0; -webkit-border-bottom-right-radius: 0; border-bottom-right-radius: 0; } +.ui-corner-left { -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; border-top-left-radius: 0; -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; border-bottom-left-radius: 0; } +.ui-corner-all { -moz-border-radius: 0; -webkit-border-radius: 0; border-radius: 0; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; } \ No newline at end of file diff --git a/resources/jquery.ui/themes/vector/images/ui-anim_basic_16x16.gif b/resources/jquery.ui/themes/vector/images/ui-anim_basic_16x16.gif new file mode 100644 index 00000000000..085ccaecaf5 Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-anim_basic_16x16.gif differ diff --git a/resources/jquery.ui/themes/vector/images/ui-bg_flat_15_cd0a0a_40x100.png b/resources/jquery.ui/themes/vector/images/ui-bg_flat_15_cd0a0a_40x100.png new file mode 100644 index 00000000000..7680b5437cf Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-bg_flat_15_cd0a0a_40x100.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-bg_flat_70_000000_40x100.png b/resources/jquery.ui/themes/vector/images/ui-bg_flat_70_000000_40x100.png new file mode 100644 index 00000000000..abdc01082bf Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-bg_flat_70_000000_40x100.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-bg_glow-ball_100_000000_600x600.png b/resources/jquery.ui/themes/vector/images/ui-bg_glow-ball_100_000000_600x600.png new file mode 100644 index 00000000000..6fb90ba8ff3 Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-bg_glow-ball_100_000000_600x600.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-bg_highlight-hard_100_f2f5f7_1x100.png b/resources/jquery.ui/themes/vector/images/ui-bg_highlight-hard_100_f2f5f7_1x100.png new file mode 100644 index 00000000000..28b566c2c29 Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-bg_highlight-hard_100_f2f5f7_1x100.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-bg_highlight-hard_80_d7ebf9_1x100.png b/resources/jquery.ui/themes/vector/images/ui-bg_highlight-hard_80_d7ebf9_1x100.png new file mode 100644 index 00000000000..dac84622af2 Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-bg_highlight-hard_80_d7ebf9_1x100.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-bg_highlight-soft_100_e4f1fb_1x100.png b/resources/jquery.ui/themes/vector/images/ui-bg_highlight-soft_100_e4f1fb_1x100.png new file mode 100644 index 00000000000..ad7f982b72d Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-bg_highlight-soft_100_e4f1fb_1x100.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-bg_highlight-soft_100_ffffff_1x100.png b/resources/jquery.ui/themes/vector/images/ui-bg_highlight-soft_100_ffffff_1x100.png new file mode 100644 index 00000000000..8169ec3e0e8 Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-bg_highlight-soft_100_ffffff_1x100.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-bg_highlight-soft_25_ffef8f_1x100.png b/resources/jquery.ui/themes/vector/images/ui-bg_highlight-soft_25_ffef8f_1x100.png new file mode 100644 index 00000000000..54aff0cb974 Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-bg_highlight-soft_25_ffef8f_1x100.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-bg_inset-hard_100_f0f0f0_1x100.png b/resources/jquery.ui/themes/vector/images/ui-bg_inset-hard_100_f0f0f0_1x100.png new file mode 100644 index 00000000000..3d87ac7b5a2 Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-bg_inset-hard_100_f0f0f0_1x100.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-icons_2694e8_256x240.png b/resources/jquery.ui/themes/vector/images/ui-icons_2694e8_256x240.png new file mode 100644 index 00000000000..9d192c2f659 Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-icons_2694e8_256x240.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-icons_2e83ff_256x240.png b/resources/jquery.ui/themes/vector/images/ui-icons_2e83ff_256x240.png new file mode 100644 index 00000000000..09d1cdc856c Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-icons_2e83ff_256x240.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-icons_3d80b3_256x240.png b/resources/jquery.ui/themes/vector/images/ui-icons_3d80b3_256x240.png new file mode 100644 index 00000000000..f13b206645b Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-icons_3d80b3_256x240.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-icons_666666_256x240.png b/resources/jquery.ui/themes/vector/images/ui-icons_666666_256x240.png new file mode 100644 index 00000000000..f87de1ca1dc Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-icons_666666_256x240.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-icons_72a7cf_256x240.png b/resources/jquery.ui/themes/vector/images/ui-icons_72a7cf_256x240.png new file mode 100644 index 00000000000..0d20b730833 Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-icons_72a7cf_256x240.png differ diff --git a/resources/jquery.ui/themes/vector/images/ui-icons_ffffff_256x240.png b/resources/jquery.ui/themes/vector/images/ui-icons_ffffff_256x240.png new file mode 100644 index 00000000000..42f8f992c72 Binary files /dev/null and b/resources/jquery.ui/themes/vector/images/ui-icons_ffffff_256x240.png differ diff --git a/resources/jquery.ui/themes/vector/jquery.ui.accordion.css b/resources/jquery.ui/themes/vector/jquery.ui.accordion.css new file mode 100644 index 00000000000..8d8a1a6e183 --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.accordion.css @@ -0,0 +1,12 @@ +/* Accordion +----------------------------------*/ +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +/* IE7-/Win - Fix extra vertical space in lists */ +.ui-accordion a { zoom: 1; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } \ No newline at end of file diff --git a/resources/jquery.ui/themes/vector/jquery.ui.autocomplete.css b/resources/jquery.ui/themes/vector/jquery.ui.autocomplete.css new file mode 100644 index 00000000000..f9900624362 --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.autocomplete.css @@ -0,0 +1,39 @@ +/* Autocomplete +----------------------------------*/ +.ui-autocomplete { position: absolute; cursor: default; } +.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* Menu +----------------------------------*/ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} diff --git a/resources/jquery.ui/themes/vector/jquery.ui.button.css b/resources/jquery.ui/themes/vector/jquery.ui.button.css new file mode 100644 index 00000000000..47777a42800 --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.button.css @@ -0,0 +1,35 @@ +/* Button +----------------------------------*/ + +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ + + + + + diff --git a/resources/jquery.ui/themes/vector/jquery.ui.core.css b/resources/jquery.ui/themes/vector/jquery.ui.core.css new file mode 100644 index 00000000000..b3e81930595 --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.core.css @@ -0,0 +1,37 @@ +/* +* jQuery UI CSS Framework +* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +*/ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute; left: -99999999px; } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } diff --git a/resources/jquery.ui/themes/vector/jquery.ui.datepicker.css b/resources/jquery.ui/themes/vector/jquery.ui.datepicker.css new file mode 100644 index 00000000000..a1116e69c74 --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.datepicker.css @@ -0,0 +1,61 @@ +/* Datepicker +----------------------------------*/ +.ui-datepicker { width: 17em; padding: .2em .2em 0; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +} \ No newline at end of file diff --git a/resources/jquery.ui/themes/vector/jquery.ui.dialog.css b/resources/jquery.ui/themes/vector/jquery.ui.dialog.css new file mode 100644 index 00000000000..f8354642a4c --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.dialog.css @@ -0,0 +1,13 @@ +/* Dialog +----------------------------------*/ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } diff --git a/resources/jquery.ui/themes/vector/jquery.ui.progressbar.css b/resources/jquery.ui/themes/vector/jquery.ui.progressbar.css new file mode 100644 index 00000000000..bc0939ecfa1 --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.progressbar.css @@ -0,0 +1,4 @@ +/* Progressbar +----------------------------------*/ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/resources/jquery.ui/themes/vector/jquery.ui.resizable.css b/resources/jquery.ui/themes/vector/jquery.ui.resizable.css new file mode 100644 index 00000000000..366643b5421 --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.resizable.css @@ -0,0 +1,13 @@ +/* Resizable +----------------------------------*/ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;} \ No newline at end of file diff --git a/resources/jquery.ui/themes/vector/jquery.ui.selectable.css b/resources/jquery.ui/themes/vector/jquery.ui.selectable.css new file mode 100644 index 00000000000..c5d46ce24bf --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.selectable.css @@ -0,0 +1,3 @@ +/* Selectable +----------------------------------*/ +.ui-selectable-helper { border:1px dotted black } diff --git a/resources/jquery.ui/themes/vector/jquery.ui.slider.css b/resources/jquery.ui/themes/vector/jquery.ui.slider.css new file mode 100644 index 00000000000..07c6f4e5ef3 --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.slider.css @@ -0,0 +1,17 @@ +/* Slider +----------------------------------*/ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; } \ No newline at end of file diff --git a/resources/jquery.ui/themes/vector/jquery.ui.tabs.css b/resources/jquery.ui/themes/vector/jquery.ui.tabs.css new file mode 100644 index 00000000000..99e16dbdbe6 --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.tabs.css @@ -0,0 +1,11 @@ +/* Tabs +----------------------------------*/ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } diff --git a/resources/jquery.ui/themes/vector/jquery.ui.theme.css b/resources/jquery.ui/themes/vector/jquery.ui.theme.css new file mode 100644 index 00000000000..767b35bbeed --- /dev/null +++ b/resources/jquery.ui/themes/vector/jquery.ui.theme.css @@ -0,0 +1,249 @@ + + +/* +* jQuery UI CSS Framework +* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=sans-serif&fwDefault=normal&fsDefault=1.0em&cornerRadius=3px&bgColorHeader=ffffff&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=100&borderColorHeader=aed0ea&fcHeader=222222&iconColorHeader=72a7cf&bgColorContent=f2f5f7&bgTextureContent=04_highlight_hard.png&bgImgOpacityContent=100&borderColorContent=cccccc&fcContent=362b36&iconColorContent=72a7cf&bgColorDefault=d7ebf9&bgTextureDefault=04_highlight_hard.png&bgImgOpacityDefault=80&borderColorDefault=aed0ea&fcDefault=2779aa&iconColorDefault=3d80b3&bgColorHover=e4f1fb&bgTextureHover=03_highlight_soft.png&bgImgOpacityHover=100&borderColorHover=74b2e2&fcHover=0070a3&iconColorHover=2694e8&bgColorActive=f0f0f0&bgTextureActive=06_inset_hard.png&bgImgOpacityActive=100&borderColorActive=cccccc&fcActive=000000&iconColorActive=666666&bgColorHighlight=ffef8f&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=25&borderColorHighlight=f9dd34&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=cd0a0a&bgTextureError=01_flat.png&bgImgOpacityError=15&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffffff&bgColorOverlay=000000&bgTextureOverlay=21_glow_ball.png&bgImgOpacityOverlay=100&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=70&opacityShadow=20&thicknessShadow=7px&offsetTopShadow=-7px&offsetLeftShadow=-7px&cornerRadiusShadow=8px +*/ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: sans-serif; font-size: 1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #cccccc; background: #f2f5f7 url(images/ui-bg_highlight-hard_100_f2f5f7_1x100.png) 50% top repeat-x; color: #362b36; } +.ui-widget-content a { color: #362b36; } +.ui-widget-header { border: 1px solid #aed0ea; background: #ffffff url(images/ui-bg_highlight-soft_100_ffffff_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } +.ui-widget-header a { color: #222222; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #aed0ea; background: #d7ebf9 url(images/ui-bg_highlight-hard_80_d7ebf9_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #2779aa; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #2779aa; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #74b2e2; background: #e4f1fb url(images/ui-bg_highlight-soft_100_e4f1fb_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #0070a3; } +.ui-state-hover a, .ui-state-hover a:hover { color: #0070a3; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #cccccc; background: #f0f0f0 url(images/ui-bg_inset-hard_100_f0f0f0_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #000000; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #000000; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #f9dd34; background: #ffef8f url(images/ui-bg_highlight-soft_25_ffef8f_1x100.png) 50% top repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #cd0a0a url(images/ui-bg_flat_15_cd0a0a_40x100.png) 50% 50% repeat-x; color: #ffffff; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_72a7cf_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_72a7cf_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_72a7cf_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_3d80b3_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_2694e8_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_666666_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 3px; -webkit-border-top-left-radius: 3px; border-top-left-radius: 3px; } +.ui-corner-tr { -moz-border-radius-topright: 3px; -webkit-border-top-right-radius: 3px; border-top-right-radius: 3px; } +.ui-corner-bl { -moz-border-radius-bottomleft: 3px; -webkit-border-bottom-left-radius: 3px; border-bottom-left-radius: 3px; } +.ui-corner-br { -moz-border-radius-bottomright: 3px; -webkit-border-bottom-right-radius: 3px; border-bottom-right-radius: 3px; } +.ui-corner-top { -moz-border-radius-topleft: 3px; -webkit-border-top-left-radius: 3px; border-top-left-radius: 3px; -moz-border-radius-topright: 3px; -webkit-border-top-right-radius: 3px; border-top-right-radius: 3px; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 3px; -webkit-border-bottom-left-radius: 3px; border-bottom-left-radius: 3px; -moz-border-radius-bottomright: 3px; -webkit-border-bottom-right-radius: 3px; border-bottom-right-radius: 3px; } +.ui-corner-right { -moz-border-radius-topright: 3px; -webkit-border-top-right-radius: 3px; border-top-right-radius: 3px; -moz-border-radius-bottomright: 3px; -webkit-border-bottom-right-radius: 3px; border-bottom-right-radius: 3px; } +.ui-corner-left { -moz-border-radius-topleft: 3px; -webkit-border-top-left-radius: 3px; border-top-left-radius: 3px; -moz-border-radius-bottomleft: 3px; -webkit-border-bottom-left-radius: 3px; border-bottom-left-radius: 3px; } +.ui-corner-all { -moz-border-radius: 3px; -webkit-border-radius: 3px; border-radius: 3px; } + +/* Overlays */ +.ui-widget-overlay { background: #000000 url(images/ui-bg_glow-ball_100_000000_600x600.png) 50% 35% repeat-x; opacity: .50;filter:Alpha(Opacity=50); } +.ui-widget-shadow { margin: -7px 0 0 -7px; padding: 7px; background: #000000 url(images/ui-bg_flat_70_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; } \ No newline at end of file diff --git a/skins/common/jquery-1.4.2.js b/resources/jquery/jquery-1.4.2.js similarity index 99% rename from skins/common/jquery-1.4.2.js rename to resources/jquery/jquery-1.4.2.js index 4f8a4db222e..fff67764336 100644 --- a/skins/common/jquery-1.4.2.js +++ b/resources/jquery/jquery-1.4.2.js @@ -4614,7 +4614,7 @@ jQuery.extend({ name = name.replace(rdashAlpha, fcamelCase); - if ( set && value !== 'NaNpx' && value !== 'nullpx' ) { + if ( set ) { style[ name ] = value; } @@ -6238,6 +6238,3 @@ jQuery.each([ "Height", "Width" ], function( i, name ) { window.jQuery = window.$ = jQuery; })(window); - -$j = jQuery.noConflict(); - diff --git a/resources/jquery/jquery.async.js b/resources/jquery/jquery.async.js new file mode 100644 index 00000000000..f5de3266457 --- /dev/null +++ b/resources/jquery/jquery.async.js @@ -0,0 +1,78 @@ +/* + * jQuery Asynchronous Plugin 1.0 + * + * Copyright (c) 2008 Vincent Robert (genezys.net) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + */ +(function($){ + +// opts.delay : (default 10) delay between async call in ms +// opts.bulk : (default 500) delay during which the loop can continue synchronously without yielding the CPU +// opts.test : (default true) function to test in the while test part +// opts.loop : (default empty) function to call in the while loop part +// opts.end : (default empty) function to call at the end of the while loop +$.whileAsync = function(opts) +{ + var delay = Math.abs(opts.delay) || 10, + bulk = isNaN(opts.bulk) ? 500 : Math.abs(opts.bulk), + test = opts.test || function(){ return true; }, + loop = opts.loop || function(){}, + end = opts.end || function(){}; + + (function(){ + + var t = false, + begin = new Date(); + + while( t = test() ) + { + loop(); + if( bulk === 0 || (new Date() - begin) > bulk ) + { + break; + } + } + if( t ) + { + setTimeout(arguments.callee, delay); + } + else + { + end(); + } + + })(); +} + +// opts.delay : (default 10) delay between async call in ms +// opts.bulk : (default 500) delay during which the loop can continue synchronously without yielding the CPU +// opts.loop : (default empty) function to call in the each loop part, signature: function(index, value) this = value +// opts.end : (default empty) function to call at the end of the each loop +$.eachAsync = function(array, opts) +{ + var i = 0, + l = array.length, + loop = opts.loop || function(){}; + + $.whileAsync( + $.extend(opts, { + test: function(){ return i < l; }, + loop: function() + { + var val = array[i]; + return loop.call(val, i++, val); + } + }) + ); +} + +$.fn.eachAsync = function(opts) +{ + $.eachAsync(this, opts); + return this; +} + +})(jQuery); + diff --git a/resources/jquery/jquery.autoEllipsis.js b/resources/jquery/jquery.autoEllipsis.js new file mode 100644 index 00000000000..1af65a69e19 --- /dev/null +++ b/resources/jquery/jquery.autoEllipsis.js @@ -0,0 +1,131 @@ +/** + * Plugin that automatically truncates the plain text contents of an element and adds an ellipsis + */ +( function( $ ) { + +// Cache ellipsed substrings for every string-width combination +var cache = { }; +// Use a seperate cache when match highlighting is enabled +var matchTextCache = { }; + +$.fn.autoEllipsis = function( options ) { + options = $.extend( { + 'position': 'center', + 'tooltip': false, + 'restoreText': false, + 'hasSpan': false, + 'matchText': null + }, options ); + $(this).each( function() { + var $this = $(this); + if ( options.restoreText ) { + if ( ! $this.data( 'autoEllipsis.originalText' ) ) { + $this.data( 'autoEllipsis.originalText', $this.text() ); + } else { + $this.text( $this.data( 'autoEllipsis.originalText' ) ); + } + } + + // container element - used for measuring against + var $container = $this; + // trimmable text element - only the text within this element will be trimmed + var $trimmableText = null; + // protected text element - the width of this element is counted, but next is never trimmed from it + var $protectedText = null; + + if ( options.hasSpan ) { + $trimmableText = $this.children( options.selector ); + } else { + $trimmableText = $( '' ) + .css( 'whiteSpace', 'nowrap' ) + .text( $this.text() ); + $this + .empty() + .append( $trimmableText ); + } + + var text = $container.text(); + var trimmableText = $trimmableText.text(); + var w = $container.width(); + var pw = $protectedText ? $protectedText.width() : 0; + // Try cache + if ( !( text in cache ) ) { + cache[text] = {}; + } + if ( options.matchText && !( text in matchTextCache ) ) { + matchTextCache[text] = {}; + } + if ( options.matchText && !( options.matchText in matchTextCache[text] ) ) { + matchTextCache[text][options.matchText] = {}; + } + if ( !options.matchText && w in cache[text] ) { + $container.html( cache[text][w] ); + if ( options.tooltip ) + $container.attr( 'title', text ); + return; + } + if( options.matchText && options.matchText in matchTextCache[text] && w in matchTextCache[text][options.matchText] ) { + $container.html( matchTextCache[text][options.matchText][w] ); + if ( options.tooltip ) + $container.attr( 'title', text ); + return; + } + if ( $trimmableText.width() + pw > w ) { + switch ( options.position ) { + case 'right': + // Use binary search-like technique for efficiency + var l = 0, r = trimmableText.length; + do { + var m = Math.ceil( ( l + r ) / 2 ); + $trimmableText.text( trimmableText.substr( 0, m ) + '...' ); + if ( $trimmableText.width() + pw > w ) { + // Text is too long + r = m - 1; + } else { + l = m; + } + } while ( l < r ); + $trimmableText.text( trimmableText.substr( 0, l ) + '...' ); + break; + case 'center': + // TODO: Use binary search like for 'right' + var i = [Math.round( trimmableText.length / 2 ), Math.round( trimmableText.length / 2 )]; + var side = 1; // Begin with making the end shorter + while ( $trimmableText.outerWidth() + pw > w && i[0] > 0 ) { + $trimmableText.text( trimmableText.substr( 0, i[0] ) + '...' + trimmableText.substr( i[1] ) ); + // Alternate between trimming the end and begining + if ( side == 0 ) { + // Make the begining shorter + i[0]--; + side = 1; + } else { + // Make the end shorter + i[1]++; + side = 0; + } + } + break; + case 'left': + // TODO: Use binary search like for 'right' + var r = 0; + while ( $trimmableText.outerWidth() + pw > w && r < trimmableText.length ) { + $trimmableText.text( '...' + trimmableText.substr( r ) ); + r++; + } + break; + } + } + if ( options.tooltip ) { + $container.attr( 'title', text ); + } + if ( options.matchText ) { + $container.highlightText( options.matchText ); + matchTextCache[text][options.matchText][w] = $container.html(); + } else { + cache[text][w] = $container.html(); + } + + } ); +}; + +} )( jQuery ); diff --git a/resources/jquery/jquery.browser.js b/resources/jquery/jquery.browser.js new file mode 100644 index 00000000000..aef7653e915 --- /dev/null +++ b/resources/jquery/jquery.browser.js @@ -0,0 +1,87 @@ +/* + +jQuery Browser Plugin + * Version 2.3 + * 2008-09-17 19:27:05 + * URL: http://jquery.thewikies.com/browser + * Description: jQuery Browser Plugin extends browser detection capabilities and can assign browser selectors to CSS classes. + * Author: Nate Cavanaugh, Minhchau Dang, & Jonathan Neal + * Copyright: Copyright (c) 2008 Jonathan Neal under dual MIT/GPL license. + * JSLint: This javascript file passes JSLint verification. +*//*jslint + bitwise: true, + browser: true, + eqeqeq: true, + forin: true, + nomen: true, + plusplus: true, + undef: true, + white: true +*//*global + jQuery +*/ + +(function ($) { + $.browserTest = function (a, z) { + var u = 'unknown', x = 'X', m = function (r, h) { + for (var i = 0; i < h.length; i = i + 1) { + r = r.replace(h[i][0], h[i][1]); + } + + return r; + }, c = function (i, a, b, c) { + var r = { + name: m((a.exec(i) || [u, u])[1], b) + }; + + r[r.name] = true; + + r.version = (c.exec(i) || [x, x, x, x])[3]; + + if (r.name.match(/safari/) && r.version > 400) { + r.version = '2.0'; + } + + if (r.name === 'presto') { + r.version = ($.browser.version > 9.27) ? 'futhark' : 'linear_b'; + } + + if (r.name === 'opera' && $.browser.version >= 9.8) { + r.version = i.match( /version\/([0-9\.]*)/i )[1] || 10; + } + r.versionNumber = parseFloat(r.version, 10) || 0; + r.versionX = (r.version !== x) ? (r.version + '').substr(0, 1) : x; + r.className = r.name + r.versionX; + + return r; + }; + + a = (a.match(/Opera|Navigator|Minefield|KHTML|Chrome|PLAYSTATION 3/) ? m(a, [ + [/(Firefox|MSIE|KHTML,\slike\sGecko|Konqueror)/, ''], + ['Chrome Safari', 'Chrome'], + ['KHTML', 'Konqueror'], + ['Minefield', 'Firefox'], + ['Navigator', 'Netscape'], + ['PLAYSTATION 3', 'PS3'] + ]) : a).toLowerCase(); + + $.browser = $.extend((!z) ? $.browser : {}, c(a, /(camino|chrome|firefox|netscape|konqueror|lynx|msie|opera|safari|ipod|iphone|blackberry|ps3|docomo)/, [], /(camino|chrome|firefox|netscape|netscape6|opera|version|konqueror|lynx|msie|safari|ps3)(\/|\;?\s|)([a-z0-9\.\+]*?)(\;|dev|rel|\)|\s|$)/)); + + $.layout = c(a, /(gecko|konqueror|msie|opera|webkit)/, [ + ['konqueror', 'khtml'], + ['msie', 'trident'], + ['opera', 'presto'] + ], /(applewebkit|rv|konqueror|msie)(\:|\/|\s)([a-z0-9\.]*?)(\;|\)|\s)/); + + $.os = { + name: (/(win|mac|linux|sunos|solaris|iphone)/.exec(navigator.platform.toLowerCase()) || [u])[0].replace('sunos', 'solaris') + }; + + if (!z) { + $('html').addClass([$.os.name, $.browser.name, $.browser.className, $.layout.name, $.layout.className].join(' ')); + } + }; + + $.browserTest(navigator.userAgent); +})(jQuery); + diff --git a/resources/jquery/jquery.collapsibleTabs.js b/resources/jquery/jquery.collapsibleTabs.js new file mode 100644 index 00000000000..5a6b2546d3d --- /dev/null +++ b/resources/jquery/jquery.collapsibleTabs.js @@ -0,0 +1,115 @@ +( function( $ ) { + +$.fn.collapsibleTabs = function( $$options ) { + // return if the function is called on an empty jquery object + if( !this.length ) return this; + //merge options into the defaults + var $settings = $.extend( {}, $.collapsibleTabs.defaults, $$options ); + + this.each( function() { + var $this = $( this ); + // add the element to our array of collapsible managers + $.collapsibleTabs.instances = ( $.collapsibleTabs.instances.length == 0 ? + $this : $.collapsibleTabs.instances.add( $this ) ); + // attach the settings to the elements + $this.data( 'collapsibleTabsSettings', $settings ); + // attach data to our collapsible elements + $this.children( $settings.collapsible ).each( function() { + $.collapsibleTabs.addData( $( this ) ); + } ); + } ); + + // if we haven't already bound our resize hanlder, bind it now + if( !$.collapsibleTabs.boundEvent ) { + $( window ) + .delayedBind( '500', 'resize', function( ) { $.collapsibleTabs.handleResize(); } ); + } + // call our resize handler to setup the page + $.collapsibleTabs.handleResize(); + return this; +}; + +$.collapsibleTabs = { + instances: [], + boundEvent: null, + defaults: { + expandedContainer: '#p-views ul', + collapsedContainer: '#p-cactions ul', + collapsible: 'li.collapsible', + shifting: false, + expandCondition: function( eleWidth ) { + return ( $( '#left-navigation' ).position().left + $( '#left-navigation' ).width() ) + < ( $( '#right-navigation' ).position().left - eleWidth ); + }, + collapseCondition: function() { + return ( $( '#left-navigation' ).position().left + $( '#left-navigation' ).width() ) + > $( '#right-navigation' ).position().left; + } + }, + addData: function( $collapsible ) { + var $settings = $collapsible.parent().data( 'collapsibleTabsSettings' ); + $collapsible.data( 'collapsibleTabsSettings', { + 'expandedContainer': $settings.expandedContainer, + 'collapsedContainer': $settings.collapsedContainer, + 'expandedWidth': $collapsible.width(), + 'prevElement': $collapsible.prev() + } ); + }, + getSettings: function( $collapsible ) { + var $settings = $collapsible.data( 'collapsibleTabsSettings' ); + if ( typeof $settings == 'undefined' ) { + $.collapsibleTabs.addData( $collapsible ); + $settings = $collapsible.data( 'collapsibleTabsSettings' ); + } + return $settings; + }, + handleResize: function( e ){ + $.collapsibleTabs.instances.each( function() { + var $this = $( this ), data = $.collapsibleTabs.getSettings( $this ); + if( data.shifting ) return; + + // if the two navigations are colliding + if( $this.children( data.collapsible ).length > 0 && data.collapseCondition() ) { + + $this.trigger( "beforeTabCollapse" ); + // move the element to the dropdown menu + $.collapsibleTabs.moveToCollapsed( $this.children( data.collapsible + ':last' ) ); + } + + // if there are still moveable items in the dropdown menu, + // and there is sufficient space to place them in the tab container + if( $( data.collapsedContainer + ' ' + data.collapsible ).length > 0 + && data.expandCondition( $.collapsibleTabs.getSettings( $( data.collapsedContainer ).children( + data.collapsible+":first" ) ).expandedWidth ) ) { + //move the element from the dropdown to the tab + $this.trigger( "beforeTabExpand" ); + $.collapsibleTabs + .moveToExpanded( data.collapsedContainer + " " + data.collapsible + ':first' ); + } + }); + }, + moveToCollapsed: function( ele ) { + var $moving = $( ele ); + var data = $.collapsibleTabs.getSettings( $moving ); + var dataExp = $.collapsibleTabs.getSettings( data.expandedContainer ); + dataExp.shifting = true; + $moving + .remove() + .prependTo( data.collapsedContainer ) + .data( 'collapsibleTabsSettings', data ); + dataExp.shifting = false; + $.collapsibleTabs.handleResize(); + }, + moveToExpanded: function( ele ) { + var $moving = $( ele ); + var data = $.collapsibleTabs.getSettings( $moving ); + var dataExp = $.collapsibleTabs.getSettings( data.expandedContainer ); + dataExp.shifting = true; + // remove this element from where it's at and put it in the dropdown menu + $moving.remove().insertAfter( data.prevElement ).data( 'collapsibleTabsSettings', data ); + dataExp.shifting = false; + $.collapsibleTabs.handleResize(); + } +}; + +} )( jQuery ); diff --git a/resources/jquery/jquery.color.js b/resources/jquery/jquery.color.js new file mode 100644 index 00000000000..634719d37f0 --- /dev/null +++ b/resources/jquery/jquery.color.js @@ -0,0 +1,123 @@ +/* + * jQuery Color Animations + * Copyright 2007 John Resig + * Released under the MIT and GPL licenses. + */ + +(function(jQuery){ + + // We override the animation for all of these color styles + jQuery.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){ + jQuery.fx.step[attr] = function(fx){ + if ( fx.state == 0 ) { + fx.start = getColor( fx.elem, attr ); + fx.end = getRGB( fx.end ); + } + + fx.elem.style[attr] = "rgb(" + [ + Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0]), 255), 0), + Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1]), 255), 0), + Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2]), 255), 0) + ].join(",") + ")"; + } + }); + + // Color Conversion functions from highlightFade + // By Blair Mitchelmore + // http://jquery.offput.ca/highlightFade/ + + // Parse strings looking for color tuples [255,255,255] + function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1]), parseInt(result[2]), parseInt(result[3])]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Otherwise, we're most likely dealing with a named color + return colors[jQuery.trim(color).toLowerCase()]; + } + + function getColor(elem, attr) { + var color; + + do { + color = jQuery.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || jQuery.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); + }; + + // Some named colors to work with + // From Interface by Stefan Petre + // http://interface.eyecon.ro/ + + var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0] + }; + +})(jQuery); diff --git a/resources/jquery/jquery.cookie.js b/resources/jquery/jquery.cookie.js new file mode 100644 index 00000000000..7b3e7012519 --- /dev/null +++ b/resources/jquery/jquery.cookie.js @@ -0,0 +1,89 @@ +/*jslint browser: true */ /*global jQuery: true */ + +/** + * jQuery Cookie plugin + * + * Copyright (c) 2010 Klaus Hartl (stilbuero.de) + * Dual licensed under the MIT and GPL licenses: + * http://www.opensource.org/licenses/mit-license.php + * http://www.gnu.org/licenses/gpl.html + * + */ + +// TODO JsDoc + +/** + * Create a cookie with the given key and value and other optional parameters. + * + * @example $.cookie('the_cookie', 'the_value'); + * @desc Set the value of a cookie. + * @example $.cookie('the_cookie', 'the_value', { expires: 7, path: '/', domain: 'jquery.com', secure: true }); + * @desc Create a cookie with all available options. + * @example $.cookie('the_cookie', 'the_value'); + * @desc Create a session cookie. + * @example $.cookie('the_cookie', null); + * @desc Delete a cookie by passing null as value. Keep in mind that you have to use the same path and domain + * used when the cookie was set. + * + * @param String key The key of the cookie. + * @param String value The value of the cookie. + * @param Object options An object literal containing key/value pairs to provide optional cookie attributes. + * @option Number|Date expires Either an integer specifying the expiration date from now on in days or a Date object. + * If a negative value is specified (e.g. a date in the past), the cookie will be deleted. + * If set to null or omitted, the cookie will be a session cookie and will not be retained + * when the the browser exits. + * @option String path The value of the path atribute of the cookie (default: path of page that created the cookie). + * @option String domain The value of the domain attribute of the cookie (default: domain of page that created the cookie). + * @option Boolean secure If true, the secure attribute of the cookie will be set and the cookie transmission will + * require a secure protocol (like HTTPS). + * @type undefined + * + * @name $.cookie + * @cat Plugins/Cookie + * @author Klaus Hartl/klaus.hartl@stilbuero.de + */ + +/** + * Get the value of a cookie with the given key. + * + * @example $.cookie('the_cookie'); + * @desc Get the value of a cookie. + * + * @param String key The key of the cookie. + * @return The value of the cookie. + * @type String + * + * @name $.cookie + * @cat Plugins/Cookie + * @author Klaus Hartl/klaus.hartl@stilbuero.de + */ +jQuery.cookie = function (key, value, options) { + + // key and value given, set cookie... + if (arguments.length > 1 && (value === null || typeof value !== "object")) { + options = jQuery.extend({}, options); + + if (value === null) { + options.expires = -1; + } + + if (typeof options.expires === 'number') { + var days = options.expires, t = options.expires = new Date(); + t.setDate(t.getDate() + days); + } + + return (document.cookie = [ + encodeURIComponent(key), '=', + options.raw ? String(value) : encodeURIComponent(String(value)), + options.expires ? '; expires=' + options.expires.toUTCString() : '', // use expires attribute, max-age is not supported by IE + options.path ? '; path=' + options.path : '', + options.domain ? '; domain=' + options.domain : '', + options.secure ? '; secure' : '' + ].join('')); + } + + // key and possibly options given, get cookie... + options = value || {}; + var result, decode = options.raw ? function (s) { return s; } : decodeURIComponent; + return (result = new RegExp('(?:^|; )' + encodeURIComponent(key) + '=([^;]*)').exec(document.cookie)) ? decode(result[1]) : null; +}; diff --git a/resources/jquery/jquery.delayedBind.js b/resources/jquery/jquery.delayedBind.js new file mode 100644 index 00000000000..49e1ac5cbdf --- /dev/null +++ b/resources/jquery/jquery.delayedBind.js @@ -0,0 +1,68 @@ +(function( $ ) { +/** + * Function that escapes spaces in event names. This is needed because + * "_delayedBind-foo bar-1000" refers to two events + */ +function encodeEvent( event ) { + return event.replace( /-/g, '--' ).replace( / /g, '-' ); +} + +$.fn.extend( { + /** + * Bind a callback to an event in a delayed fashion. + * In detail, this means that the callback will be called a certain + * time after the event fires, but the timer is reset every time + * the event fires. + * @param timeout Number of milliseconds to wait + * @param event Name of the event (string) + * @param data Data to pass to the event handler (optional) + * @param callback Function to call + */ + delayedBind: function( timeout, event, data, callback ) { + var encEvent = encodeEvent( event ); + return this.each( function() { + var that = this; + // Bind the top half + // Do this only once for every (event, timeout) pair + if ( !( $(this).data( '_delayedBindBound-' + encEvent + '-' + timeout ) ) ) { + $(this).data( '_delayedBindBound-' + encEvent + '-' + timeout, true ); + $(this).bind( event, function() { + var timerID = $(this).data( '_delayedBindTimerID-' + encEvent + '-' + timeout ); + // Cancel the running timer + if ( typeof timerID != 'undefined' ) + clearTimeout( timerID ); + timerID = setTimeout( function() { + $(that).trigger( '_delayedBind-' + encEvent + '-' + timeout ); + }, timeout ); + $(this).data( '_delayedBindTimerID-' + encEvent + '-' + timeout, timerID ); + } ); + } + + // Bottom half + $(this).bind( '_delayedBind-' + encEvent + '-' + timeout, data, callback ); + } ); + }, + + /** + * Cancel the timers for delayed events on the selected elements. + */ + delayedBindCancel: function( timeout, event ) { + var encEvent = encodeEvent( event ); + return this.each( function() { + var timerID = $(this).data( '_delayedBindTimerID-' + encEvent + '-' + timeout ); + if ( typeof timerID != 'undefined' ) + clearTimeout( timerID ); + } ); + }, + + /** + * Unbind an event bound with delayedBind() + */ + delayedBindUnbind: function( timeout, event, callback ) { + var encEvent = encodeEvent( event ); + return this.each( function() { + $(this).unbind( '_delayedBind-' + encEvent + '-' + timeout, callback ); + } ); + } +} ); +} )( jQuery ); diff --git a/resources/jquery/jquery.expandableField.js b/resources/jquery/jquery.expandableField.js new file mode 100644 index 00000000000..2054f4ef511 --- /dev/null +++ b/resources/jquery/jquery.expandableField.js @@ -0,0 +1,129 @@ +/** + * This plugin provides functionallity to expand a text box on focus to double it's current width + * + * Usage: + * + * Set options: + * $('#textbox').expandableField( { option1: value1, option2: value2 } ); + * $('#textbox').expandableField( option, value ); + * Get option: + * value = $('#textbox').expandableField( option ); + * Initialize: + * $('#textbox').expandableField(); + * + * Options: + * + */ +( function( $ ) { + +$.expandableField = { + /** + * Expand the field, make the callback + */ + expandField: function( e, context ) { + context.config.beforeExpand.call( context.data.$field, context ); + context.data.$field + .animate( { 'width': context.data.expandedWidth }, 'fast', function() { + context.config.afterExpand.call( this, context ); + } ); + }, + /** + * Condense the field, make the callback + */ + condenseField: function( e, context ) { + context.config.beforeCondense.call( context.data.$field, context ); + context.data.$field + .animate( { 'width': context.data.condensedWidth }, 'fast', function() { + context.config.afterCondense.call( this, context ); + } ); + }, + /** + * Sets the value of a property, and updates the widget accordingly + * @param {String} property Name of property + * @param {Mixed} value Value to set property with + */ + configure: function( context, property, value ) { + // Validate creation using fallback values + switch( property ) { + default: + context.config[property] = value; + break; + } + } + +}; +$.fn.expandableField = function() { + + // Multi-context fields + var returnValue = null; + var args = arguments; + + $( this ).each( function() { + + /* Construction / Loading */ + + var context = $( this ).data( 'expandableField-context' ); + if ( context == null ) { + context = { + config: { + // callback function for before collapse + 'beforeCondense': function( context ) {}, + // callback function for before expand + 'beforeExpand': function( context ) {}, + // callback function for after collapse + 'afterCondense': function( context ) {}, + // callback function for after expand + 'afterExpand': function( context ) {}, + // Whether the field should expand to the left or the right -- defaults to left + 'expandToLeft': true + } + }; + } + + /* API */ + // Handle various calling styles + if ( args.length > 0 ) { + if ( typeof args[0] == 'object' ) { + // Apply set of properties + for ( var key in args[0] ) { + $.expandableField.configure( context, key, args[0][key] ); + } + } else if ( typeof args[0] == 'string' ) { + if ( args.length > 1 ) { + // Set property values + $.expandableField.configure( context, args[0], args[1] ); + } else if ( returnValue == null ) { + // Get property values, but don't give access to internal data - returns only the first + returnValue = ( args[0] in context.config ? undefined : context.config[args[0]] ); + } + } + } + + /* Initialization */ + + if ( typeof context.data == 'undefined' ) { + context.data = { + // The width of the field in it's condensed state + 'condensedWidth': $( this ).width(), + // The width of the field in it's expanded state + 'expandedWidth': $( this ).width() * 2, + // Reference to the field + '$field': $( this ) + }; + + $( this ) + .addClass( 'expandableField' ) + .focus( function( e ) { + $.expandableField.expandField( e, context ); + } ) + .delayedBind( 250, 'blur', function( e ) { + $.expandableField.condenseField( e, context ); + } ); + } + // Store the context for next time + $( this ).data( 'expandableField-context', context ); + } ); + return returnValue !== null ? returnValue : $(this); +}; + +} )( jQuery ); diff --git a/resources/jquery/jquery.highlightText.js b/resources/jquery/jquery.highlightText.js new file mode 100644 index 00000000000..19a0deb2881 --- /dev/null +++ b/resources/jquery/jquery.highlightText.js @@ -0,0 +1,62 @@ +/** + * Plugin that highlights matched word partials in a given element + * TODO: add a function for restoring the previous text + * TODO: accept mappings for converting shortcuts like WP: to Wikipedia: + */ +( function( $ ) { + +$.highlightText = { + + // Split our pattern string at spaces and run our highlight function on the results + splitAndHighlight: function( node, pat ) { + var patArray = pat.split(" "); + for ( var i = 0; i < patArray.length; i++ ) { + if ( patArray[i].length == 0 ) continue; + $.highlightText.innerHighlight( node, patArray[i] ); + } + return node; + }, + // scans a node looking for the pattern and wraps a span around each match + innerHighlight: function( node, pat ) { + // if this is a text node + if ( node.nodeType == 3 ) { + // TODO - need to be smarter about the character matching here. + // non latin characters can make regex think a new word has begun. + // look for an occurence of our pattern and store the starting position + var pos = node.data.search( new RegExp( "\\b" + RegExp.escape( pat ), "i" ) ); + if ( pos >= 0 ) { + // create the span wrapper for the matched text + var spannode = document.createElement( 'span' ); + spannode.className = 'highlight'; + // shave off the characters preceding the matched text + var middlebit = node.splitText( pos ); + // shave off any unmatched text off the end + middlebit.splitText( pat.length ); + // clone for appending to our span + var middleclone = middlebit.cloneNode( true ); + // append the matched text node to the span + spannode.appendChild( middleclone ); + // replace the matched node, with our span-wrapped clone of the matched node + middlebit.parentNode.replaceChild( spannode, middlebit ); + } + // if this is an element with childnodes, and not a script, style or an element we created + } else if ( node.nodeType == 1 && node.childNodes && !/(script|style)/i.test( node.tagName ) + && !( node.tagName.toLowerCase() == 'span' && node.className.match( /\bhighlight/ ) ) ) { + for ( var i = 0; i < node.childNodes.length; ++i ) { + // call the highlight function for each child node + $.highlightText.innerHighlight( node.childNodes[i], pat ); + } + } + } +}; + +$.fn.highlightText = function( matchString ) { + return $( this ).each( function() { + var $this = $( this ); + $this.data( 'highlightText', { originalText: $this.text() } ); + $.highlightText.splitAndHighlight( this, matchString ); + } ); +}; + +} )( jQuery ); + diff --git a/resources/jquery/jquery.js b/resources/jquery/jquery.js new file mode 100644 index 00000000000..fff67764336 --- /dev/null +++ b/resources/jquery/jquery.js @@ -0,0 +1,6240 @@ +/*! + * jQuery JavaScript Library v1.4.2 + * http://jquery.com/ + * + * Copyright 2010, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2010, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Sat Feb 13 22:33:48 2010 -0500 + */ +(function( window, undefined ) { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // Use the correct document accordingly with window argument (sandbox) + document = window.document, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // (both of which we optimize for) + quickExpr = /^[^<]*(<[\w\W]+>)[^>]*$|^#([\w-]+)$/, + + // Is it a simple selector + isSimple = /^.[^:#\[\.,]*$/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + rtrim = /^(\s|\u00A0)+|(\s|\u00A0)+$/g, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // Has the ready events already been bound? + readyBound = false, + + // The functions to execute on DOM ready + readyList = [], + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwnProperty = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + indexOf = Array.prototype.indexOf; + +jQuery.fn = jQuery.prototype = { + init: function( selector, context ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context ) { + this.context = document; + this[0] = document.body; + this.selector = "body"; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + match = quickExpr.exec( selector ); + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + doc = (context ? context.ownerDocument || context : document); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = buildFragment( [ match[1] ], [ doc ] ); + selector = (ret.cacheable ? ret.fragment.cloneNode(true) : ret.fragment).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + if ( elem ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $("TAG") + } else if ( !context && /^\w+$/.test( selector ) ) { + this.selector = selector; + this.context = document; + selector = document.getElementsByTagName( selector ); + return jQuery.merge( this, selector ); + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return (context || rootjQuery).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return jQuery( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if (selector.selector !== undefined) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.4.2", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this.slice(num)[ 0 ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = jQuery(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + (this.selector ? " " : "") + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // If the DOM is already ready + if ( jQuery.isReady ) { + // Execute the function immediately + fn.call( document, jQuery ); + + // Otherwise, remember the function for later + } else if ( readyList ) { + // Add the function to the wait list + readyList.push( fn ); + } + + return this; + }, + + eq: function( i ) { + return i === -1 ? + this.slice( i ) : + this.slice( i, +i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || jQuery(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + // copy reference to target object + var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options, name, src, copy; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging object literal values or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || jQuery.isArray(copy) ) ) { + var clone = src && ( jQuery.isPlainObject(src) || jQuery.isArray(src) ) ? src + : jQuery.isArray(copy) ? [] : {}; + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + window.$ = _$; + + if ( deep ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // Handle when the DOM is ready + ready: function() { + // Make sure that the DOM is not already loaded + if ( !jQuery.isReady ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 13 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If there are functions bound, to execute + if ( readyList ) { + // Execute all of them + var fn, i = 0; + while ( (fn = readyList[ i++ ]) ) { + fn.call( document, jQuery ); + } + + // Reset the list of functions + readyList = null; + } + + // Trigger any bound ready events + if ( jQuery.fn.triggerHandler ) { + jQuery( document ).triggerHandler( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyBound ) { + return; + } + + readyBound = true; + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + return jQuery.ready(); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent("onreadystatechange", DOMContentLoaded); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return toString.call(obj) === "[object Function]"; + }, + + isArray: function( obj ) { + return toString.call(obj) === "[object Array]"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || toString.call(obj) !== "[object Object]" || obj.nodeType || obj.setInterval ) { + return false; + } + + // Not own constructor property must be Object + if ( obj.constructor + && !hasOwnProperty.call(obj, "constructor") + && !hasOwnProperty.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwnProperty.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw msg; + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( /^[\],:{}\s]*$/.test(data.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, "@") + .replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, "]") + .replace(/(?:^|:|,)(?:\s*\[)+/g, "")) ) { + + // Try to use the native JSON parser first + return window.JSON && window.JSON.parse ? + window.JSON.parse( data ) : + (new Function("return " + data))(); + + } else { + jQuery.error( "Invalid JSON: " + data ); + } + }, + + noop: function() {}, + + // Evalulates a script in a global context + globalEval: function( data ) { + if ( data && rnotwhite.test(data) ) { + // Inspired by code by Andrea Giammarchi + // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html + var head = document.getElementsByTagName("head")[0] || document.documentElement, + script = document.createElement("script"); + + script.type = "text/javascript"; + + if ( jQuery.support.scriptEval ) { + script.appendChild( document.createTextNode( data ) ); + } else { + script.text = data; + } + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709). + head.insertBefore( script, head.firstChild ); + head.removeChild( script ); + } + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction(object); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( var value = object[0]; + i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {} + } + } + + return object; + }, + + trim: function( text ) { + return (text || "").replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // The extra typeof function check is to prevent crashes + // in Safari 2 (See: #3039) + if ( array.length == null || typeof array === "string" || jQuery.isFunction(array) || (typeof array !== "function" && array.setInterval) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array ) { + if ( array.indexOf ) { + return array.indexOf( elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = []; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + if ( !inv !== !callback( elems[ i ], i ) ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var ret = [], value; + + // Go through the array, translating each of the items to their + // new value (or values). + for ( var i = 0, length = elems.length; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + proxy: function( fn, proxy, thisObject ) { + if ( arguments.length === 2 ) { + if ( typeof proxy === "string" ) { + thisObject = fn; + fn = thisObject[ proxy ]; + proxy = undefined; + + } else if ( proxy && !jQuery.isFunction( proxy ) ) { + thisObject = proxy; + proxy = undefined; + } + } + + if ( !proxy && fn ) { + proxy = function() { + return fn.apply( thisObject || this, arguments ); + }; + } + + // Set the guid of unique handler to the same of original handler, so it can be removed + if ( fn ) { + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + } + + // So proxy can be declared as an argument + return proxy; + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = /(webkit)[ \/]([\w.]+)/.exec( ua ) || + /(opera)(?:.*version)?[ \/]([\w.]+)/.exec( ua ) || + /(msie) ([\w.]+)/.exec( ua ) || + !/compatible/.test( ua ) && /(mozilla)(?:.*? rv:([\w.]+))?/.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + browser: {} +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +if ( indexOf ) { + jQuery.inArray = function( elem, array ) { + return indexOf.call( array, elem ); + }; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch( error ) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +function evalScript( i, elem ) { + if ( elem.src ) { + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + } else { + jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } +} + +// Mutifunctional method to get and set values to a collection +// The value/s can be optionally by executed if its a function +function access( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; +} + +function now() { + return (new Date).getTime(); +} +(function() { + + jQuery.support = {}; + + var root = document.documentElement, + script = document.createElement("script"), + div = document.createElement("div"), + id = "script" + now(); + + div.style.display = "none"; + div.innerHTML = "
    a"; + + var all = div.getElementsByTagName("*"), + a = div.getElementsByTagName("a")[0]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return; + } + + jQuery.support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: div.firstChild.nodeType === 3, + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText insted) + style: /red/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: a.getAttribute("href") === "/a", + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55$/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: div.getElementsByTagName("input")[0].value === "on", + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: document.createElement("select").appendChild( document.createElement("option") ).selected, + + parentNode: div.removeChild( div.appendChild( document.createElement("div") ) ).parentNode === null, + + // Will be defined later + deleteExpando: true, + checkClone: false, + scriptEval: false, + noCloneEvent: true, + boxModel: null + }; + + script.type = "text/javascript"; + try { + script.appendChild( document.createTextNode( "window." + id + "=1;" ) ); + } catch(e) {} + + root.insertBefore( script, root.firstChild ); + + // Make sure that the execution of code works by injecting a script + // tag with appendChild/createTextNode + // (IE doesn't support this, fails, and uses .text instead) + if ( window[ id ] ) { + jQuery.support.scriptEval = true; + delete window[ id ]; + } + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete script.test; + + } catch(e) { + jQuery.support.deleteExpando = false; + } + + root.removeChild( script ); + + if ( div.attachEvent && div.fireEvent ) { + div.attachEvent("onclick", function click() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + jQuery.support.noCloneEvent = false; + div.detachEvent("onclick", click); + }); + div.cloneNode(true).fireEvent("onclick"); + } + + div = document.createElement("div"); + div.innerHTML = ""; + + var fragment = document.createDocumentFragment(); + fragment.appendChild( div.firstChild ); + + // WebKit doesn't clone checked state correctly in fragments + jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked; + + // Figure out if the W3C box model works as expected + // document.body must exist before we can do this + jQuery(function() { + var div = document.createElement("div"); + div.style.width = div.style.paddingLeft = "1px"; + + document.body.appendChild( div ); + jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2; + document.body.removeChild( div ).style.display = 'none'; + + div = null; + }); + + // Technique from Juriy Zaytsev + // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ + var eventSupported = function( eventName ) { + var el = document.createElement("div"); + eventName = "on" + eventName; + + var isSupported = (eventName in el); + if ( !isSupported ) { + el.setAttribute(eventName, "return;"); + isSupported = typeof el[eventName] === "function"; + } + el = null; + + return isSupported; + }; + + jQuery.support.submitBubbles = eventSupported("submit"); + jQuery.support.changeBubbles = eventSupported("change"); + + // release memory in IE + root = script = div = all = a = null; +})(); + +jQuery.props = { + "for": "htmlFor", + "class": "className", + readonly: "readOnly", + maxlength: "maxLength", + cellspacing: "cellSpacing", + rowspan: "rowSpan", + colspan: "colSpan", + tabindex: "tabIndex", + usemap: "useMap", + frameborder: "frameBorder" +}; +var expando = "jQuery" + now(), uuid = 0, windowData = {}; + +jQuery.extend({ + cache: {}, + + expando:expando, + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + "object": true, + "applet": true + }, + + data: function( elem, name, data ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + return; + } + + elem = elem == window ? + windowData : + elem; + + var id = elem[ expando ], cache = jQuery.cache, thisCache; + + if ( !id && typeof name === "string" && data === undefined ) { + return null; + } + + // Compute a unique ID for the element + if ( !id ) { + id = ++uuid; + } + + // Avoid generating a new cache unless none exists and we + // want to manipulate it. + if ( typeof name === "object" ) { + elem[ expando ] = id; + thisCache = cache[ id ] = jQuery.extend(true, {}, name); + + } else if ( !cache[ id ] ) { + elem[ expando ] = id; + cache[ id ] = {}; + } + + thisCache = cache[ id ]; + + // Prevent overriding the named cache with undefined values + if ( data !== undefined ) { + thisCache[ name ] = data; + } + + return typeof name === "string" ? thisCache[ name ] : thisCache; + }, + + removeData: function( elem, name ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + return; + } + + elem = elem == window ? + windowData : + elem; + + var id = elem[ expando ], cache = jQuery.cache, thisCache = cache[ id ]; + + // If we want to remove a specific section of the element's data + if ( name ) { + if ( thisCache ) { + // Remove the section of cache data + delete thisCache[ name ]; + + // If we've removed all the data, remove the element's cache + if ( jQuery.isEmptyObject(thisCache) ) { + jQuery.removeData( elem ); + } + } + + // Otherwise, we want to remove all of the element's data + } else { + if ( jQuery.support.deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } + + // Completely remove the data cache + delete cache[ id ]; + } + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + if ( typeof key === "undefined" && this.length ) { + return jQuery.data( this[0] ); + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + } + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + } else { + return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function() { + jQuery.data( this, key, value ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); +jQuery.extend({ + queue: function( elem, type, data ) { + if ( !elem ) { + return; + } + + type = (type || "fx") + "queue"; + var q = jQuery.data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( !data ) { + return q || []; + } + + if ( !q || jQuery.isArray(data) ) { + q = jQuery.data( elem, type, jQuery.makeArray(data) ); + + } else { + q.push( data ); + } + + return q; + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), fn = queue.shift(); + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift("inprogress"); + } + + fn.call(elem, function() { + jQuery.dequeue(elem, type); + }); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function( i, elem ) { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + type = type || "fx"; + + return this.queue( type, function() { + var elem = this; + setTimeout(function() { + jQuery.dequeue( elem, type ); + }, time ); + }); + }, + + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + } +}); +var rclass = /[\n\t]/g, + rspace = /\s+/, + rreturn = /\r/g, + rspecialurl = /href|src|style/, + rtype = /(button|input)/i, + rfocusable = /(button|input|object|select|textarea)/i, + rclickable = /^(a|area)$/i, + rradiocheck = /radio|checkbox/; + +jQuery.fn.extend({ + attr: function( name, value ) { + return access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name, fn ) { + return this.each(function(){ + jQuery.attr( this, name, "" ); + if ( this.nodeType === 1 ) { + this.removeAttribute( name ); + } + }); + }, + + addClass: function( value ) { + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + self.addClass( value.call(this, i, self.attr("class")) ); + }); + } + + if ( value && typeof value === "string" ) { + var classNames = (value || "").split( rspace ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className ) { + elem.className = value; + + } else { + var className = " " + elem.className + " ", setClass = elem.className; + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) { + setClass += " " + classNames[c]; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + self.removeClass( value.call(this, i, self.attr("class")) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + var classNames = (value || "").split(rspace); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + var className = (" " + elem.className + " ").replace(rclass, " "); + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[c] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this); + self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, i = 0, self = jQuery(this), + state = stateVal, + classNames = value.split( rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery.data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery.data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " "; + for ( var i = 0, l = this.length; i < l; i++ ) { + if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + if ( value === undefined ) { + var elem = this[0]; + + if ( elem ) { + if ( jQuery.nodeName( elem, "option" ) ) { + return (elem.attributes.value || {}).specified ? elem.value : elem.text; + } + + // We need to handle select boxes special + if ( jQuery.nodeName( elem, "select" ) ) { + var index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + if ( option.selected ) { + // Get the specifc value for the option + value = jQuery(option).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + } + + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) { + return elem.getAttribute("value") === null ? "on" : elem.value; + } + + + // Everything else, we just grab the value + return (elem.value || "").replace(rreturn, ""); + + } + + return undefined; + } + + var isFunction = jQuery.isFunction(value); + + return this.each(function(i) { + var self = jQuery(this), val = value; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call(this, i, self.val()); + } + + // Typecast each time if the value is a Function and the appended + // value is therefore different each time. + if ( typeof val === "number" ) { + val += ""; + } + + if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) { + this.checked = jQuery.inArray( self.val(), val ) >= 0; + + } else if ( jQuery.nodeName( this, "select" ) ) { + var values = jQuery.makeArray(val); + + jQuery( "option", this ).each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + this.selectedIndex = -1; + } + + } else { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attr: function( elem, name, value, pass ) { + // don't set attributes on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) { + return undefined; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery(elem)[name](value); + } + + var notxml = elem.nodeType !== 1 || !jQuery.isXMLDoc( elem ), + // Whether we are setting (or getting) + set = value !== undefined; + + // Try to normalize/fix the name + name = notxml && jQuery.props[ name ] || name; + + // Only do all the following if this is a node (faster for style) + if ( elem.nodeType === 1 ) { + // These attributes require special treatment + var special = rspecialurl.test( name ); + + // Safari mis-reports the default selected property of an option + // Accessing the parent's selectedIndex property fixes it + if ( name === "selected" && !jQuery.support.optSelected ) { + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + + // If applicable, access the attribute via the DOM 0 way + if ( name in elem && notxml && !special ) { + if ( set ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } + + elem[ name ] = value; + } + + // browsers index elements by id/name on forms, give priority to attributes. + if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) { + return elem.getAttributeNode( name ).nodeValue; + } + + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + if ( name === "tabIndex" ) { + var attributeNode = elem.getAttributeNode( "tabIndex" ); + + return attributeNode && attributeNode.specified ? + attributeNode.value : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + + return elem[ name ]; + } + + if ( !jQuery.support.style && notxml && name === "style" ) { + if ( set ) { + elem.style.cssText = "" + value; + } + + return elem.style.cssText; + } + + if ( set ) { + // convert the value to a string (all browsers do this but IE) see #1070 + elem.setAttribute( name, "" + value ); + } + + var attr = !jQuery.support.hrefNormalized && notxml && special ? + // Some attributes require a special call on IE + elem.getAttribute( name, 2 ) : + elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return attr === null ? undefined : attr; + } + + // elem is actually elem.style ... set the style + // Using attr for specific style information is now deprecated. Use style instead. + return jQuery.style( elem, name, value ); + } +}); +var rnamespaces = /\.(.*)$/, + fcleanup = function( nm ) { + return nm.replace(/[^\w\s\.\|`]/g, function( ch ) { + return "\\" + ch; + }); + }; + +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function( elem, types, handler, data ) { + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // For whatever reason, IE has trouble passing the window object + // around, causing it to be cloned in the process + if ( elem.setInterval && ( elem !== window && !elem.frameElement ) ) { + elem = window; + } + + var handleObjIn, handleObj; + + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure + var elemData = jQuery.data( elem ); + + // If no elemData is found then we must be trying to bind to one of the + // banned noData elements + if ( !elemData ) { + return; + } + + var events = elemData.events = elemData.events || {}, + eventHandle = elemData.handle, eventHandle; + + if ( !eventHandle ) { + elemData.handle = eventHandle = function() { + // Handle the second event of a trigger and when + // an event is called after a page has unloaded + return typeof jQuery !== "undefined" && !jQuery.event.triggered ? + jQuery.event.handle.apply( eventHandle.elem, arguments ) : + undefined; + }; + } + + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native events in IE. + eventHandle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = types.split(" "); + + var type, i = 0, namespaces; + + while ( (type = types[ i++ ]) ) { + handleObj = handleObjIn ? + jQuery.extend({}, handleObjIn) : + { handler: handler, data: data }; + + // Namespaced event handlers + if ( type.indexOf(".") > -1 ) { + namespaces = type.split("."); + type = namespaces.shift(); + handleObj.namespace = namespaces.slice(0).sort().join("."); + + } else { + namespaces = []; + handleObj.namespace = ""; + } + + handleObj.type = type; + handleObj.guid = handler.guid; + + // Get the current list of functions bound to this event + var handlers = events[ type ], + special = jQuery.event.special[ type ] || {}; + + // Init the event handler queue + if ( !handlers ) { + handlers = events[ type ] = []; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add the function to the element's handler list + handlers.push( handleObj ); + + // Keep track of which events have been used, for global triggering + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, pos ) { + // don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + var ret, type, fn, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, + elemData = jQuery.data( elem ), + events = elemData && elemData.events; + + if ( !elemData || !events ) { + return; + } + + // types is actually an event object here + if ( types && types.type ) { + handler = types.handler; + types = types.type; + } + + // Unbind all events for the element + if ( !types || typeof types === "string" && types.charAt(0) === "." ) { + types = types || ""; + + for ( type in events ) { + jQuery.event.remove( elem, type + types ); + } + + return; + } + + // Handle multiple events separated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + types = types.split(" "); + + while ( (type = types[ i++ ]) ) { + origType = type; + handleObj = null; + all = type.indexOf(".") < 0; + namespaces = []; + + if ( !all ) { + // Namespaced event handlers + namespaces = type.split("."); + type = namespaces.shift(); + + namespace = new RegExp("(^|\\.)" + + jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)") + } + + eventType = events[ type ]; + + if ( !eventType ) { + continue; + } + + if ( !handler ) { + for ( var j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( all || namespace.test( handleObj.namespace ) ) { + jQuery.event.remove( elem, origType, handleObj.handler, j ); + eventType.splice( j--, 1 ); + } + } + + continue; + } + + special = jQuery.event.special[ type ] || {}; + + for ( var j = pos || 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( handler.guid === handleObj.guid ) { + // remove the given handler for the given type + if ( all || namespace.test( handleObj.namespace ) ) { + if ( pos == null ) { + eventType.splice( j--, 1 ); + } + + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + + if ( pos != null ) { + break; + } + } + } + + // remove generic event handler if no more handlers exist + if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + removeEvent( elem, type, elemData.handle ); + } + + ret = null; + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + var handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + delete elemData.events; + delete elemData.handle; + + if ( jQuery.isEmptyObject( elemData ) ) { + jQuery.removeData( elem ); + } + } + }, + + // bubbling is internal + trigger: function( event, data, elem /*, bubbling */ ) { + // Event object or event type + var type = event.type || event, + bubbling = arguments[3]; + + if ( !bubbling ) { + event = typeof event === "object" ? + // jQuery.Event object + event[expando] ? event : + // Object literal + jQuery.extend( jQuery.Event(type), event ) : + // Just the event type (string) + jQuery.Event(type); + + if ( type.indexOf("!") >= 0 ) { + event.type = type = type.slice(0, -1); + event.exclusive = true; + } + + // Handle a global trigger + if ( !elem ) { + // Don't bubble custom events when global (to avoid too much overhead) + event.stopPropagation(); + + // Only trigger if we've ever bound an event for it + if ( jQuery.event.global[ type ] ) { + jQuery.each( jQuery.cache, function() { + if ( this.events && this.events[type] ) { + jQuery.event.trigger( event, data, this.handle.elem ); + } + }); + } + } + + // Handle triggering a single element + + // don't do events on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) { + return undefined; + } + + // Clean up in case it is reused + event.result = undefined; + event.target = elem; + + // Clone the incoming data, if any + data = jQuery.makeArray( data ); + data.unshift( event ); + } + + event.currentTarget = elem; + + // Trigger the event, it is assumed that "handle" is a function + var handle = jQuery.data( elem, "handle" ); + if ( handle ) { + handle.apply( elem, data ); + } + + var parent = elem.parentNode || elem.ownerDocument; + + // Trigger an inline bound script + try { + if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) { + if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) { + event.result = false; + } + } + + // prevent IE from throwing an error for some elements with some event types, see #3533 + } catch (e) {} + + if ( !event.isPropagationStopped() && parent ) { + jQuery.event.trigger( event, data, parent, true ); + + } else if ( !event.isDefaultPrevented() ) { + var target = event.target, old, + isClick = jQuery.nodeName(target, "a") && type === "click", + special = jQuery.event.special[ type ] || {}; + + if ( (!special._default || special._default.call( elem, event ) === false) && + !isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) { + + try { + if ( target[ type ] ) { + // Make sure that we don't accidentally re-trigger the onFOO events + old = target[ "on" + type ]; + + if ( old ) { + target[ "on" + type ] = null; + } + + jQuery.event.triggered = true; + target[ type ](); + } + + // prevent IE from throwing an error for some elements with some event types, see #3533 + } catch (e) {} + + if ( old ) { + target[ "on" + type ] = old; + } + + jQuery.event.triggered = false; + } + } + }, + + handle: function( event ) { + var all, handlers, namespaces, namespace, events; + + event = arguments[0] = jQuery.event.fix( event || window.event ); + event.currentTarget = this; + + // Namespaced event handlers + all = event.type.indexOf(".") < 0 && !event.exclusive; + + if ( !all ) { + namespaces = event.type.split("."); + event.type = namespaces.shift(); + namespace = new RegExp("(^|\\.)" + namespaces.slice(0).sort().join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + var events = jQuery.data(this, "events"), handlers = events[ event.type ]; + + if ( events && handlers ) { + // Clone the handlers to prevent manipulation + handlers = handlers.slice(0); + + for ( var j = 0, l = handlers.length; j < l; j++ ) { + var handleObj = handlers[ j ]; + + // Filter the functions by class + if ( all || namespace.test( handleObj.namespace ) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handleObj.handler; + event.data = handleObj.data; + event.handleObj = handleObj; + + var ret = handleObj.handler.apply( this, arguments ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + } + + return event.result; + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function( event ) { + if ( event[ expando ] ) { + return event; + } + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ) { + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) { + event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either + } + + // check if target is a textnode (safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) { + event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; + } + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var doc = document.documentElement, body = document.body; + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); + } + + // Add which for key events + if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) ) { + event.which = event.charCode || event.keyCode; + } + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) { + event.metaKey = event.ctrlKey; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button !== undefined ) { + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + } + + return event; + }, + + // Deprecated, use jQuery.guid instead + guid: 1E8, + + // Deprecated, use jQuery.proxy instead + proxy: jQuery.proxy, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady, + teardown: jQuery.noop + }, + + live: { + add: function( handleObj ) { + jQuery.event.add( this, handleObj.origType, jQuery.extend({}, handleObj, {handler: liveHandler}) ); + }, + + remove: function( handleObj ) { + var remove = true, + type = handleObj.origType.replace(rnamespaces, ""); + + jQuery.each( jQuery.data(this, "events").live || [], function() { + if ( type === this.origType.replace(rnamespaces, "") ) { + remove = false; + return false; + } + }); + + if ( remove ) { + jQuery.event.remove( this, handleObj.origType, liveHandler ); + } + } + + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( this.setInterval ) { + this.onbeforeunload = eventHandle; + } + + return false; + }, + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + } +}; + +var removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + elem.removeEventListener( type, handle, false ); + } : + function( elem, type, handle ) { + elem.detachEvent( "on" + type, handle ); + }; + +jQuery.Event = function( src ) { + // Allow instantiation without the 'new' keyword + if ( !this.preventDefault ) { + return new jQuery.Event( src ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + // Event type + } else { + this.type = src; + } + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = now(); + + // Mark it as fixed + this[ expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + } + // otherwise set the returnValue property of the original event to false (IE) + e.returnValue = false; + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function( event ) { + // Check if mouse(over|out) are still within the same parent element + var parent = event.relatedTarget; + + // Firefox sometimes assigns relatedTarget a XUL element + // which we cannot access the parentNode property of + try { + // Traverse up the tree + while ( parent && parent !== this ) { + parent = parent.parentNode; + } + + if ( parent !== this ) { + // set the correct event type + event.type = event.data; + + // handle event if we actually just moused on to a non sub-element + jQuery.event.handle.apply( this, arguments ); + } + + // assuming we've left the element since we most likely mousedover a xul element + } catch(e) { } +}, + +// In case of event delegation, we only need to rename the event.type, +// liveHandler will take care of the rest. +delegate = function( event ) { + event.type = event.data; + jQuery.event.handle.apply( this, arguments ); +}; + +// Create mouseenter and mouseleave events +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + setup: function( data ) { + jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); + }, + teardown: function( data ) { + jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); + } + }; +}); + +// submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function( data, namespaces ) { + if ( this.nodeName.toLowerCase() !== "form" ) { + jQuery.event.add(this, "click.specialSubmit", function( e ) { + var elem = e.target, type = elem.type; + + if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { + return trigger( "submit", this, arguments ); + } + }); + + jQuery.event.add(this, "keypress.specialSubmit", function( e ) { + var elem = e.target, type = elem.type; + + if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { + return trigger( "submit", this, arguments ); + } + }); + + } else { + return false; + } + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialSubmit" ); + } + }; + +} + +// change delegation, happens here so we have bind. +if ( !jQuery.support.changeBubbles ) { + + var formElems = /textarea|input|select/i, + + changeFilters, + + getVal = function( elem ) { + var type = elem.type, val = elem.value; + + if ( type === "radio" || type === "checkbox" ) { + val = elem.checked; + + } else if ( type === "select-multiple" ) { + val = elem.selectedIndex > -1 ? + jQuery.map( elem.options, function( elem ) { + return elem.selected; + }).join("-") : + ""; + + } else if ( elem.nodeName.toLowerCase() === "select" ) { + val = elem.selectedIndex; + } + + return val; + }, + + testChange = function testChange( e ) { + var elem = e.target, data, val; + + if ( !formElems.test( elem.nodeName ) || elem.readOnly ) { + return; + } + + data = jQuery.data( elem, "_change_data" ); + val = getVal(elem); + + // the current data will be also retrieved by beforeactivate + if ( e.type !== "focusout" || elem.type !== "radio" ) { + jQuery.data( elem, "_change_data", val ); + } + + if ( data === undefined || val === data ) { + return; + } + + if ( data != null || val ) { + e.type = "change"; + return jQuery.event.trigger( e, arguments[1], elem ); + } + }; + + jQuery.event.special.change = { + filters: { + focusout: testChange, + + click: function( e ) { + var elem = e.target, type = elem.type; + + if ( type === "radio" || type === "checkbox" || elem.nodeName.toLowerCase() === "select" ) { + return testChange.call( this, e ); + } + }, + + // Change has to be called before submit + // Keydown will be called before keypress, which is used in submit-event delegation + keydown: function( e ) { + var elem = e.target, type = elem.type; + + if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") || + (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || + type === "select-multiple" ) { + return testChange.call( this, e ); + } + }, + + // Beforeactivate happens also before the previous element is blurred + // with this event you can't trigger a change event, but you can store + // information/focus[in] is not needed anymore + beforeactivate: function( e ) { + var elem = e.target; + jQuery.data( elem, "_change_data", getVal(elem) ); + } + }, + + setup: function( data, namespaces ) { + if ( this.type === "file" ) { + return false; + } + + for ( var type in changeFilters ) { + jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); + } + + return formElems.test( this.nodeName ); + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialChange" ); + + return formElems.test( this.nodeName ); + } + }; + + changeFilters = jQuery.event.special.change.filters; +} + +function trigger( type, elem, args ) { + args[0].type = type; + return jQuery.event.handle.apply( elem, args ); +} + +// Create "bubbling" focus and blur events +if ( document.addEventListener ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + jQuery.event.special[ fix ] = { + setup: function() { + this.addEventListener( orig, handler, true ); + }, + teardown: function() { + this.removeEventListener( orig, handler, true ); + } + }; + + function handler( e ) { + e = jQuery.event.fix( e ); + e.type = fix; + return jQuery.event.handle.call( this, e ); + } + }); +} + +jQuery.each(["bind", "one"], function( i, name ) { + jQuery.fn[ name ] = function( type, data, fn ) { + // Handle object literals + if ( typeof type === "object" ) { + for ( var key in type ) { + this[ name ](key, data, type[key], fn); + } + return this; + } + + if ( jQuery.isFunction( data ) ) { + fn = data; + data = undefined; + } + + var handler = name === "one" ? jQuery.proxy( fn, function( event ) { + jQuery( this ).unbind( event, handler ); + return fn.apply( this, arguments ); + }) : fn; + + if ( type === "unload" && name !== "one" ) { + this.one( type, data, fn ); + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.add( this[i], type, handler, data ); + } + } + + return this; + }; +}); + +jQuery.fn.extend({ + unbind: function( type, fn ) { + // Handle object literals + if ( typeof type === "object" && !type.preventDefault ) { + for ( var key in type ) { + this.unbind(key, type[key]); + } + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.remove( this[i], type, fn ); + } + } + + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.live( types, data, fn, selector ); + }, + + undelegate: function( selector, types, fn ) { + if ( arguments.length === 0 ) { + return this.unbind( "live" ); + + } else { + return this.die( types, null, fn, selector ); + } + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if ( this[0] ) { + var event = jQuery.Event( type ); + event.preventDefault(); + event.stopPropagation(); + jQuery.event.trigger( event, data, this[0] ); + return event.result; + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, i = 1; + + // link all the functions, so any of them can unbind this click handler + while ( i < args.length ) { + jQuery.proxy( fn, args[ i++ ] ); + } + + return this.click( jQuery.proxy( fn, function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + })); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +var liveMap = { + focus: "focusin", + blur: "focusout", + mouseenter: "mouseover", + mouseleave: "mouseout" +}; + +jQuery.each(["live", "die"], function( i, name ) { + jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { + var type, i = 0, match, namespaces, preType, + selector = origSelector || this.selector, + context = origSelector ? this : jQuery( this.context ); + + if ( jQuery.isFunction( data ) ) { + fn = data; + data = undefined; + } + + types = (types || "").split(" "); + + while ( (type = types[ i++ ]) != null ) { + match = rnamespaces.exec( type ); + namespaces = ""; + + if ( match ) { + namespaces = match[0]; + type = type.replace( rnamespaces, "" ); + } + + if ( type === "hover" ) { + types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); + continue; + } + + preType = type; + + if ( type === "focus" || type === "blur" ) { + types.push( liveMap[ type ] + namespaces ); + type = type + namespaces; + + } else { + type = (liveMap[ type ] || type) + namespaces; + } + + if ( name === "live" ) { + // bind live handler + context.each(function(){ + jQuery.event.add( this, liveConvert( type, selector ), + { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); + }); + + } else { + // unbind live handler + context.unbind( liveConvert( type, selector ), fn ); + } + } + + return this; + } +}); + +function liveHandler( event ) { + var stop, elems = [], selectors = [], args = arguments, + related, match, handleObj, elem, j, i, l, data, + events = jQuery.data( this, "events" ); + + // Make sure we avoid non-left-click bubbling in Firefox (#3861) + if ( event.liveFired === this || !events || !events.live || event.button && event.type === "click" ) { + return; + } + + event.liveFired = this; + + var live = events.live.slice(0); + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { + selectors.push( handleObj.selector ); + + } else { + live.splice( j--, 1 ); + } + } + + match = jQuery( event.target ).closest( selectors, event.currentTarget ); + + for ( i = 0, l = match.length; i < l; i++ ) { + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( match[i].selector === handleObj.selector ) { + elem = match[i].elem; + related = null; + + // Those two events require additional checking + if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { + related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; + } + + if ( !related || related !== elem ) { + elems.push({ elem: elem, handleObj: handleObj }); + } + } + } + } + + for ( i = 0, l = elems.length; i < l; i++ ) { + match = elems[i]; + event.currentTarget = match.elem; + event.data = match.handleObj.data; + event.handleObj = match.handleObj; + + if ( match.handleObj.origHandler.apply( match.elem, args ) === false ) { + stop = false; + break; + } + } + + return stop; +} + +function liveConvert( type, selector ) { + return "live." + (type && type !== "*" ? type + "." : "") + selector.replace(/\./g, "`").replace(/ /g, "&"); +} + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( fn ) { + return fn ? this.bind( name, fn ) : this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } +}); + +// Prevent memory leaks in IE +// Window isn't included so as not to unbind existing unload events +// More info: +// - http://isaacschlueter.com/2006/10/msie-memory-leaks/ +if ( window.attachEvent && !window.addEventListener ) { + window.attachEvent("onunload", function() { + for ( var id in jQuery.cache ) { + if ( jQuery.cache[ id ].handle ) { + // Try/Catch is to handle iframes being unloaded, see #4280 + try { + jQuery.event.remove( jQuery.cache[ id ].handle.elem ); + } catch(e) {} + } + } + }); +} +/*! + * Sizzle CSS Selector Engine - v1.0 + * Copyright 2009, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function(){ + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function(selector, context, results, seed) { + results = results || []; + var origContext = context = context || document; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var parts = [], m, set, checkSet, extra, prune = true, contextXML = isXML(context), + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + while ( (chunker.exec(""), m = chunker.exec(soFar)) !== null ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set ); + } + } + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + var ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? Sizzle.filter( ret.expr, ret.set )[0] : ret.set[0]; + } + + if ( context ) { + var ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + set = ret.expr ? Sizzle.filter( ret.expr, ret.set ) : ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray(set); + } else { + prune = false; + } + + while ( parts.length ) { + var cur = parts.pop(), pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + } else if ( context && context.nodeType === 1 ) { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + } else { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function(results){ + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort(sortOrder); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[i-1] ) { + results.splice(i--, 1); + } + } + } + } + + return results; +}; + +Sizzle.matches = function(expr, set){ + return Sizzle(expr, null, null, set); +}; + +Sizzle.find = function(expr, context, isXML){ + var set, match; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var type = Expr.order[i], match; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + var left = match[1]; + match.splice(1,1); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace(/\\/g, ""); + set = Expr.find[ type ]( match, context, isXML ); + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = context.getElementsByTagName("*"); + } + + return {set: set, expr: expr}; +}; + +Sizzle.filter = function(expr, set, inplace, not){ + var old = expr, result = [], curLoop = set, match, anyFound, + isXMLFilter = set && set[0] && isXML(set[0]); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + var filter = Expr.filter[ type ], found, item, left = match[1]; + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + } else { + curLoop[i] = false; + } + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw "Syntax error, unrecognized expression: " + msg; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + match: { + ID: /#((?:[\w\u00c0-\uFFFF-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + leftMatch: {}, + attrMap: { + "class": "className", + "for": "htmlFor" + }, + attrHandle: { + href: function(elem){ + return elem.getAttribute("href"); + } + }, + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !/\W/.test(part), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + ">": function(checkSet, part){ + var isPartStr = typeof part === "string"; + + if ( isPartStr && !/\W/.test(part) ) { + part = part.toLowerCase(); + + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + } else { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + "": function(checkSet, part, isXML){ + var doneName = done++, checkFn = dirCheck; + + if ( typeof part === "string" && !/\W/.test(part) ) { + var nodeCheck = part = part.toLowerCase(); + checkFn = dirNodeCheck; + } + + checkFn("parentNode", part, doneName, checkSet, nodeCheck, isXML); + }, + "~": function(checkSet, part, isXML){ + var doneName = done++, checkFn = dirCheck; + + if ( typeof part === "string" && !/\W/.test(part) ) { + var nodeCheck = part = part.toLowerCase(); + checkFn = dirNodeCheck; + } + + checkFn("previousSibling", part, doneName, checkSet, nodeCheck, isXML); + } + }, + find: { + ID: function(match, context, isXML){ + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + return m ? [m] : []; + } + }, + NAME: function(match, context){ + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], results = context.getElementsByName(match[1]); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + TAG: function(match, context){ + return context.getElementsByTagName(match[1]); + } + }, + preFilter: { + CLASS: function(match, curLoop, inplace, result, not, isXML){ + match = " " + match[1].replace(/\\/g, "") + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + ID: function(match){ + return match[1].replace(/\\/g, ""); + }, + TAG: function(match, curLoop){ + return match[1].toLowerCase(); + }, + CHILD: function(match){ + if ( match[1] === "nth" ) { + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + ATTR: function(match, curLoop, inplace, result, not, isXML){ + var name = match[1].replace(/\\/g, ""); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + PSEUDO: function(match, curLoop, inplace, result, not){ + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + if ( !inplace ) { + result.push.apply( result, ret ); + } + return false; + } + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + POS: function(match){ + match.unshift( true ); + return match; + } + }, + filters: { + enabled: function(elem){ + return elem.disabled === false && elem.type !== "hidden"; + }, + disabled: function(elem){ + return elem.disabled === true; + }, + checked: function(elem){ + return elem.checked === true; + }, + selected: function(elem){ + // Accessing this property makes selected-by-default + // options in Safari work properly + elem.parentNode.selectedIndex; + return elem.selected === true; + }, + parent: function(elem){ + return !!elem.firstChild; + }, + empty: function(elem){ + return !elem.firstChild; + }, + has: function(elem, i, match){ + return !!Sizzle( match[3], elem ).length; + }, + header: function(elem){ + return /h\d/i.test( elem.nodeName ); + }, + text: function(elem){ + return "text" === elem.type; + }, + radio: function(elem){ + return "radio" === elem.type; + }, + checkbox: function(elem){ + return "checkbox" === elem.type; + }, + file: function(elem){ + return "file" === elem.type; + }, + password: function(elem){ + return "password" === elem.type; + }, + submit: function(elem){ + return "submit" === elem.type; + }, + image: function(elem){ + return "image" === elem.type; + }, + reset: function(elem){ + return "reset" === elem.type; + }, + button: function(elem){ + return "button" === elem.type || elem.nodeName.toLowerCase() === "button"; + }, + input: function(elem){ + return /input|select|textarea|button/i.test(elem.nodeName); + } + }, + setFilters: { + first: function(elem, i){ + return i === 0; + }, + last: function(elem, i, match, array){ + return i === array.length - 1; + }, + even: function(elem, i){ + return i % 2 === 0; + }, + odd: function(elem, i){ + return i % 2 === 1; + }, + lt: function(elem, i, match){ + return i < match[3] - 0; + }, + gt: function(elem, i, match){ + return i > match[3] - 0; + }, + nth: function(elem, i, match){ + return match[3] - 0 === i; + }, + eq: function(elem, i, match){ + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function(elem, match, i, array){ + var name = match[1], filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0; + } else if ( name === "not" ) { + var not = match[3]; + + for ( var i = 0, l = not.length; i < l; i++ ) { + if ( not[i] === elem ) { + return false; + } + } + + return true; + } else { + Sizzle.error( "Syntax error, unrecognized expression: " + name ); + } + }, + CHILD: function(elem, match){ + var type = match[1], node = elem; + switch (type) { + case 'only': + case 'first': + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + if ( type === "first" ) { + return true; + } + node = elem; + case 'last': + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + return true; + case 'nth': + var first = match[2], last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + if ( first === 0 ) { + return diff === 0; + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + ID: function(elem, match){ + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + TAG: function(elem, match){ + return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; + }, + CLASS: function(elem, match){ + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + ATTR: function(elem, match){ + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + POS: function(elem, match, i, array){ + var name = match[2], filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, function(all, num){ + return "\\" + (num - 0 + 1); + })); +} + +var makeArray = function(array, results) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch(e){ + makeArray = function(array, results) { + var ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + } else { + if ( typeof array.length === "number" ) { + for ( var i = 0, l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + } else { + for ( var i = 0; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + if ( a == b ) { + hasDuplicate = true; + } + return a.compareDocumentPosition ? -1 : 1; + } + + var ret = a.compareDocumentPosition(b) & 4 ? -1 : a === b ? 0 : 1; + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} else if ( "sourceIndex" in document.documentElement ) { + sortOrder = function( a, b ) { + if ( !a.sourceIndex || !b.sourceIndex ) { + if ( a == b ) { + hasDuplicate = true; + } + return a.sourceIndex ? -1 : 1; + } + + var ret = a.sourceIndex - b.sourceIndex; + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} else if ( document.createRange ) { + sortOrder = function( a, b ) { + if ( !a.ownerDocument || !b.ownerDocument ) { + if ( a == b ) { + hasDuplicate = true; + } + return a.ownerDocument ? -1 : 1; + } + + var aRange = a.ownerDocument.createRange(), bRange = b.ownerDocument.createRange(); + aRange.setStart(a, 0); + aRange.setEnd(a, 0); + bRange.setStart(b, 0); + bRange.setEnd(b, 0); + var ret = aRange.compareBoundaryPoints(Range.START_TO_END, bRange); + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} + +// Utility function for retreiving the text value of an array of DOM nodes +function getText( elems ) { + var ret = "", elem; + + for ( var i = 0; elems[i]; i++ ) { + elem = elems[i]; + + // Get the text from text nodes and CDATA nodes + if ( elem.nodeType === 3 || elem.nodeType === 4 ) { + ret += elem.nodeValue; + + // Traverse everything else, except comment nodes + } else if ( elem.nodeType !== 8 ) { + ret += getText( elem.childNodes ); + } + } + + return ret; +} + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date).getTime(); + form.innerHTML = ""; + + // Inject it into the root element, check its status, and remove it quickly + var root = document.documentElement; + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function(match, context, isXML){ + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + return m ? m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? [m] : undefined : []; + } + }; + + Expr.filter.ID = function(elem, match){ + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + root = form = null; // release memory in IE +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function(match, context){ + var results = context.getElementsByTagName(match[1]); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = ""; + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + Expr.attrHandle.href = function(elem){ + return elem.getAttribute("href", 2); + }; + } + + div = null; // release memory in IE +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, div = document.createElement("div"); + div.innerHTML = "

    "; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function(query, context, extra, seed){ + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && context.nodeType === 9 && !isXML(context) ) { + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(e){} + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + div = null; // release memory in IE + })(); +} + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "
    "; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function(match, context, isXML) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + div = null; // release memory in IE +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + elem = elem[dir]; + var match = false; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + elem = elem[dir]; + var match = false; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +var contains = document.compareDocumentPosition ? function(a, b){ + return !!(a.compareDocumentPosition(b) & 16); +} : function(a, b){ + return a !== b && (a.contains ? a.contains(b) : true); +}; + +var isXML = function(elem){ + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function(selector, context){ + var tmpSet = [], later = "", match, + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = getText; +jQuery.isXMLDoc = isXML; +jQuery.contains = contains; + +return; + +window.Sizzle = Sizzle; + +})(); +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + slice = Array.prototype.slice; + +// Implement the identical functionality for filter and not +var winnow = function( elements, qualifier, keep ) { + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return (elem === qualifier) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return (jQuery.inArray( elem, qualifier ) >= 0) === keep; + }); +}; + +jQuery.fn.extend({ + find: function( selector ) { + var ret = this.pushStack( "", "find", selector ), length = 0; + + for ( var i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( var n = length; n < ret.length; n++ ) { + for ( var r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && jQuery.filter( selector, this ).length > 0; + }, + + closest: function( selectors, context ) { + if ( jQuery.isArray( selectors ) ) { + var ret = [], cur = this[0], match, matches = {}, selector; + + if ( cur && selectors.length ) { + for ( var i = 0, l = selectors.length; i < l; i++ ) { + selector = selectors[i]; + + if ( !matches[selector] ) { + matches[selector] = jQuery.expr.match.POS.test( selector ) ? + jQuery( selector, context || this.context ) : + selector; + } + } + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( selector in matches ) { + match = matches[selector]; + + if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) { + ret.push({ selector: selector, elem: cur }); + delete matches[selector]; + } + } + cur = cur.parentNode; + } + } + + return ret; + } + + var pos = jQuery.expr.match.POS.test( selectors ) ? + jQuery( selectors, context || this.context ) : null; + + return this.map(function( i, cur ) { + while ( cur && cur.ownerDocument && cur !== context ) { + if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selectors) ) { + return cur; + } + cur = cur.parentNode; + } + return null; + }); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + if ( !elem || typeof elem === "string" ) { + return jQuery.inArray( this[0], + // If it receives a string, the selector is used + // If it receives nothing, the siblings are used + elem ? jQuery( elem ) : this.parent().children() ); + } + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context || this.context ) : + jQuery.makeArray( selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, slice.call(arguments).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], cur = elem[dir]; + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); +var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /(<([\w:]+)[^>]*?)\/>/g, + rselfClosing = /^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i, + rtagName = /<([\w:]+)/, + rtbody = /"; + }, + wrapMap = { + option: [ 1, "" ], + legend: [ 1, "
    ", "
    " ], + thead: [ 1, "", "
    " ], + tr: [ 2, "", "
    " ], + td: [ 3, "", "
    " ], + col: [ 2, "", "
    " ], + area: [ 1, "", "" ], + _default: [ 0, "", "" ] + }; + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize and '; + } + return html; + } + // Load asynchronously after doumument ready + if ( ready ) { + setTimeout( function() { $( 'body' ).append( request() ); }, 0 ) + } else { + document.write( request() ); + } + } + }; + /** + * Registers a module, letting the system know about it and it's dependencies. loader.js files contain calls + * to this function. + */ + this.register = function( module, version, dependencies, status ) { + // Allow multiple registration + if ( typeof module === 'object' ) { + for ( var m = 0; m < module.length; m++ ) { + if ( typeof module[m] === 'string' ) { + that.register( module[m] ); + } else if ( typeof module[m] === 'object' ) { + that.register.apply( that, module[m] ); + } + } + return; + } + // Validate input + if ( typeof module !== 'string' ) { + throw new Error( 'module must be a string, not a ' + typeof module ); + } + if ( typeof registry[module] !== 'undefined' && typeof status === 'undefined' ) { + throw new Error( 'module already implemeneted: ' + module ); + } + // List the module as registered + registry[module] = { + 'state': typeof status === 'string' ? status : 'registered', + 'dependencies': [], + 'version': typeof version !== 'undefined' ? parseInt( version ) : 0 + }; + if ( typeof dependencies === 'string' ) { + // Allow dependencies to be given as a single module name + registry[module].dependencies = [dependencies]; + } else if ( typeof dependencies === 'object' || typeof dependencies === 'function' ) { + // Allow dependencies to be given as an array of module names or a function which returns an array + registry[module].dependencies = dependencies; + } + }; + /** + * Implements a module, giving the system a course of action to take upon loading. Results of a request for + * one or more modules contain calls to this function. + */ + this.implement = function( module, script, style, localization ) { + // Automaically register module + if ( typeof registry[module] === 'undefined' ) { + that.register( module ); + } + // Validate input + if ( typeof script !== 'function' ) { + throw new Error( 'script must be a function, not a ' + typeof script ); + } + if ( typeof style !== 'undefined' && typeof style !== 'string' ) { + throw new Error( 'style must be a string, not a ' + typeof style ); + } + if ( typeof localization !== 'undefined' && typeof localization !== 'object' ) { + throw new Error( 'localization must be an object, not a ' + typeof localization ); + } + if ( typeof registry[module] !== 'undefined' && typeof registry[module].script !== 'undefined' ) { + throw new Error( 'module already implemeneted: ' + module ); + } + // Mark module as loaded + registry[module].state = 'loaded'; + // Attach components + registry[module].script = script; + if ( typeof style === 'string' ) { + registry[module].style = style; + } + if ( typeof localization === 'object' ) { + registry[module].messages = localization; + } + // Execute or queue callback + if ( filter( ['ready'], registry[module].dependencies ).compare( registry[module].dependencies ) ) { + execute( module ); + } else { + request( module ); + } + }; + /** + * Executes a function as soon as one or more required modules are ready + * + * @param mixed string or array of strings of modules names the callback dependencies to be ready before + * executing + * @param function callback to execute when all dependencies are ready (optional) + * @param function callback to execute when if dependencies have a errors (optional) + */ + this.using = function( dependencies, ready, error ) { + // Validate input + if ( typeof dependencies !== 'object' && typeof dependencies !== 'string' ) { + throw new Error( 'dependencies must be a string or an array, not a ' + typeof dependencies ) + } + // Allow calling with a single dependency as a string + if ( typeof dependencies === 'string' ) { + dependencies = [dependencies]; + } + // Resolve entire dependency map + dependencies = resolve( dependencies ); + // If all dependencies are met, execute ready immediately + if ( filter( ['ready'], dependencies ).compare( dependencies ) ) { + if ( typeof ready !== 'function' ) { + ready(); + } + } + // If any dependencies have errors execute error immediately + else if ( filter( ['error'], dependencies ).length ) { + if ( typeof error === 'function' ) { + error(); + } + } + // Since some dependencies are not yet ready, queue up a request + else { + request( dependencies, ready, error ); + } + }; + /** + * Loads one or more modules for future use + */ + this.load = function( modules ) { + // Validate input + if ( typeof modules !== 'object' && typeof modules !== 'string' ) { + throw new Error( 'dependencies must be a string or an array, not a ' + typeof dependencies ) + } + // Allow calling with a single dependency as a string + if ( typeof modules === 'string' ) { + modules = [modules]; + } + // Resolve entire dependency map + modules = resolve( modules ); + // If all modules are ready, nothing dependency be done + if ( filter( ['ready'], modules ).compare( modules ) ) { + return true; + } + // If any modules have errors return false + else if ( filter( ['error'], modules ).length ) { + return false; + } + // Since some modules are not yet ready, queue up a request + else { + request( modules ); + return true; + } + }; + /** + * Flushes the request queue and begin executing load requests on demand + */ + this.go = function() { + suspended = false; + that.work(); + }; + /** + * Changes the state of a module + * + * @param mixed module string module name or object of module name/state pairs + * @param string state string state name + */ + this.state = function( module, state ) { + if ( typeof module === 'object' ) { + for ( var m in module ) { + that.state( m, module[m] ); + } + return; + } + if ( module in registry ) { + registry[module].state = state; + } + }; + + /* Cache document ready status */ + + $(document).ready( function() { ready = true; } ); + } )(); + + /* Extension points */ + + this.util = {}; + this.legacy = {}; + +} )( jQuery ); + + +/* Auto-register from pre-loaded startup scripts */ + +if ( typeof window['startUp'] === 'function' ) { + window['startUp'](); + delete window['startUp']; +} \ No newline at end of file diff --git a/resources/mediawiki/mediawiki.log.js b/resources/mediawiki/mediawiki.log.js new file mode 100644 index 00000000000..0fef8c6f502 --- /dev/null +++ b/resources/mediawiki/mediawiki.log.js @@ -0,0 +1,63 @@ +/* + * Debug output logging + */ + +( function( $, mw ) { + +/* Extension */ + +$.extend( mw, { + + /* Functions */ + + /** + * Log output to the console + * + * In the case that the browser does not have a console available, one is created by appending a
    element to + * the bottom of the body and then appending a
    element to that for each message. + * + * @author Michael Dale , Trevor Parscal + * @param {string} string message to output to console + */ + 'log': function( string ) { + // Allow log messages to use a configured prefix + if ( mw.config.exists( 'mw.log.prefix' ) ) { + string = mw.config.get( 'mw.log.prefix' ) + string; + } + // Try to use an existing console + if ( typeof window.console !== 'undefined' && typeof window.console.log == 'function' ) { + window.console.log( string ); + } else { + // Show a log box for console-less browsers + var $log = $( '#mw_log_console' ); + if ( !$log.length ) { + $log = $( '
    ' ) + .css( { + 'position': 'absolute', + 'overflow': 'auto', + 'z-index': 500, + 'bottom': '0px', + 'left': '0px', + 'right': '0px', + 'height': '150px', + 'background-color': 'white', + 'border-top': 'solid 1px #DDDDDD' + } ) + .appendTo( $( 'body' ) ); + } + if ( $log.length ) { + $log.append( + $( '
    ' + string + '
    ' ) + .css( { + 'border-bottom': 'solid 1px #DDDDDD', + 'font-size': 'small', + 'font-family': 'monospace', + 'padding': '0.125em 0.25em' + } ) + ); + } + } + } +} ); + +} )( jQuery, mediaWiki ); \ No newline at end of file diff --git a/resources/mediawiki/utilities/mediawiki.utilities.client.js b/resources/mediawiki/utilities/mediawiki.utilities.client.js new file mode 100644 index 00000000000..384338f9d60 --- /dev/null +++ b/resources/mediawiki/utilities/mediawiki.utilities.client.js @@ -0,0 +1,185 @@ +/* + * User-agent detection + */ + +( function( $, mw ) { + +/* Extension */ + +$.extend( mw.utilities, { + 'client': { + /** + * Returns an object containing information about the browser + * + * The resulting client object will be in the following format: + * { + * 'name': 'firefox', + * 'layout': 'gecko', + * 'os': 'linux' + * 'version': '3.5.1', + * 'versionBase': '3', + * 'versionNumber': 3.5, + * } + */ + this.profile = function() { + // Use the cached version if possible + if ( typeof this.profile === 'undefined' ) { + + /* Configuration */ + + // Name of browsers or layout engines we don't recognize + var uk = 'unknown'; + // Generic version digit + var x = 'x'; + // Strings found in user agent strings that need to be conformed + var wildUserAgents = [ 'Opera', 'Navigator', 'Minefield', 'KHTML', 'Chrome', 'PLAYSTATION 3']; + // Translations for conforming user agent strings + var userAgentTranslations = [ + // Tons of browsers lie about being something they are not + [/(Firefox|MSIE|KHTML,\slike\sGecko|Konqueror)/, ''], + // Chrome lives in the shadow of Safari still + ['Chrome Safari', 'Chrome'], + // KHTML is the layout engine not the browser - LIES! + ['KHTML', 'Konqueror'], + // Firefox nightly builds + ['Minefield', 'Firefox'], + // This helps keep differnt versions consistent + ['Navigator', 'Netscape'], + // This prevents version extraction issues, otherwise translation would happen later + ['PLAYSTATION 3', 'PS3'], + ]; + // Strings which precede a version number in a user agent string - combined and used as match 1 in + // version detectection + var versionPrefixes = [ + 'camino', 'chrome', 'firefox', 'netscape', 'netscape6', 'opera', 'version', 'konqueror', 'lynx', + 'msie', 'safari', 'ps3' + ]; + // Used as matches 2, 3 and 4 in version extraction - 3 is used as actual version number + var versionSuffix = '(\/|\;?\s|)([a-z0-9\.\+]*?)(\;|dev|rel|\\)|\s|$)'; + // Names of known browsers + var browserNames = [ + 'camino', 'chrome', 'firefox', 'netscape', 'konqueror', 'lynx', 'msie', 'opera', 'safari', 'ipod', + 'iphone', 'blackberry', 'ps3' + ]; + // Tanslations for conforming browser names + var browserTranslations = []; + // Names of known layout engines + var layoutNames = ['gecko', 'konqueror', 'msie', 'opera', 'webkit']; + // Translations for conforming layout names + var layoutTranslations = [['konqueror', 'khtml'], ['msie', 'trident'], ['opera', 'presto']]; + // Names of known operating systems + var osNames = ['win', 'mac', 'linux', 'sunos', 'solaris', 'iphone']; + // Translations for conforming operating system names + var osTranslations = [['sunos', 'solaris']]; + + /* Methods */ + + // Performs multiple replacements on a string + function translate( source, translations ) { + for ( var i = 0; i < translations.length; i++ ) { + source = source.replace( translations[i][0], translations[i][1] ); + } + return source; + }; + + /* Pre-processing */ + + var userAgent = navigator.userAgent, match, browser = uk, layout = uk, os = uk, version = x; + if ( match = new RegExp( '(' + wildUserAgents.join( '|' ) + ')' ).exec( userAgent ) ) { + // Takes a userAgent string and translates given text into something we can more easily work with + userAgent = translate( userAgent, userAgentTranslations ); + } + // Everything will be in lowercase from now on + userAgent = userAgent.toLowerCase(); + + /* Extraction */ + + if ( match = new RegExp( '(' + browserNames.join( '|' ) + ')' ).exec( userAgent ) ) { + browser = translate( match[1], browserTranslations ); + } + if ( match = new RegExp( '(' + layoutNames.join( '|' ) + ')' ).exec( userAgent ) ) { + layout = translate( match[1], layoutTranslations ); + } + if ( match = new RegExp( '(' + osNames.join( '|' ) + ')' ).exec( navigator.platform.toLowerCase() ) ) { + var os = translate( match[1], osTranslations ); + } + if ( match = new RegExp( '(' + versionPrefixes.join( '|' ) + ')' + versionSuffix ).exec( userAgent ) ) { + version = match[3]; + } + + /* Edge Cases -- did I mention about how user agent string lie? */ + + // Decode Safari's crazy 400+ version numbers + if ( name.match( /safari/ ) && version > 400 ) { + version = '2.0'; + } + // Expose Opera 10's lies about being Opera 9.8 + if ( name === 'opera' && version >= 9.8) { + version = userAgent.match( /version\/([0-9\.]*)/i )[1] || 10; + } + + /* Caching */ + + this.profile = { + 'browser': browser, + 'layout': layout, + 'os': os, + 'version': version, + 'versionBase': ( version !== x ? new String( version ).substr( 0, 1 ) : x ), + 'versionNumber': ( parseFloat( version, 10 ) || 0.0 ) + }; + } + return this.profile; + }; + /** + * Checks the current browser against a support map object to determine if the browser has been black-listed or + * not. If the browser was not configured specifically it is assumed to work. It is assumed that the body + * element is classified as either "ltr" or "rtl". If neither is set, "ltr" is assumed. + * + * A browser map is in the following format: + * { + * 'ltr': { + * // Multiple rules with configurable operators + * 'msie': [['>=', 7], ['!=', 9]], + * // Blocked entirely + * 'iphone': false + * }, + * 'rtl': { + * // Test against a string + * 'msie': [['!==', '8.1.2.3']], + * // RTL rules do not fall through to LTR rules, you must explicity set each of them + * 'iphone': false + * } + * } + * + * @param map Object of browser support map + * + * @return Boolean true if browser known or assumed to be supported, false if blacklisted + */ + this.test = function( map ) { + var client = this.client(); + // Check over each browser condition to determine if we are running in a compatible client + var browser = map[$( 'body' ).is( '.rtl' ) ? 'rtl' : 'ltr'][client.browser]; + if ( typeof browser !== 'object' ) { + // Unknown, so we assume it's working + return true; + } + for ( var condition in browser ) { + var op = browser[condition][0]; + var val = browser[condition][1]; + if ( val === false ) { + return false; + } else if ( typeof val == 'string' ) { + if ( !( eval( 'client.version' + op + '"' + val + '"' ) ) ) { + return false; + } + } else if ( typeof val == 'number' ) { + if ( !( eval( 'client.versionNumber' + op + val ) ) ) { + return false; + } + } + } + return true; + }; + } +} ); \ No newline at end of file diff --git a/resources/mediawiki/views/mediawiki.views.diff.js b/resources/mediawiki/views/mediawiki.views.diff.js new file mode 100644 index 00000000000..ab1cc3b3cbf --- /dev/null +++ b/resources/mediawiki/views/mediawiki.views.diff.js @@ -0,0 +1,30 @@ +/* + * Diff-view progressive enhancement (ported from skins/common/diff.js) + * + * Fixes an overflow bug in old versions of Firefox + */ + +( function( $, mw ) { + +/* Initialization */ + +$( document ).ready( function() { + /* + * Workaround for overflow bug in Mozilla 1.1 and earlier, where scrolling
    s in cells collapse their + * height to a single line. + * + * Known to be fixed in 1.2.1 (Gecko 20021130), but the CSS hacks I've tried with overflow-x disable the scrolling + * all the way until Mozilla 1.8 / FF 1.5 and break Opera as well. + * + * So... we check for reaaaally old Gecko and hack in an alternate rule to let the wide cells spill instead of + * scrolling them. Not ideal as it won't work if JS is disabled, of course. + */ + if ( window.navigator && window.navigator.product == 'Gecko' && window.navigator.productSub < '20021130' ) { + document.styleSheets[document.styleSheets.length - 1].insertRule( + 'table.diff td div { overflow: visible; }', + document.styleSheets[document.styleSheets.length - 1].cssRules.length + ); + } +} ); + +} )( jQuery, mediaWiki ); \ No newline at end of file diff --git a/resources/mediawiki/views/mediawiki.views.install.js b/resources/mediawiki/views/mediawiki.views.install.js new file mode 100644 index 00000000000..c13373f8766 --- /dev/null +++ b/resources/mediawiki/views/mediawiki.views.install.js @@ -0,0 +1,100 @@ +/* + * Web-installer progressive enhancement (ported from skins/common/config.js) + * + * Makes elements in the configuration form interactive and hides portions of the form when not in-use + */ + +( function( $, mw ) { + +/* Initialization */ + +$( document ).ready( function() { + // Show/hide code for help text + $( '.config-show-help a' ).click( function() { + $(this).parent().siblings( '.config-help-message' ).show( 'slow' ); + $(this).parent().siblings( '.config-hide-help' ).show(); + $(this).parent().hide(); + return false; + } ); + $( '.config-hide-help a' ).click( function() { + $(this).parent().siblings( '.config-help-message' ).hide( 'slow' ); + $(this).parent().siblings( '.config-show-help' ).show(); + $(this).parent().hide(); + return false; + } ); + // Show/hide code for DB-specific options + // FIXME: Do we want slow, fast, or even non-animated (instantaneous) showing/hiding here? + $( '.dbRadio' ).each( function() { $( '#' + $(this).attr( 'rel' ) ).hide(); } ); + $( '#' + $( '.dbRadio:checked' ).attr( 'rel' ) ).show(); + $( '.dbRadio' ).click( function() { + var $checked = $( '.dbRadio:checked' ); + var $wrapper = $( '#' + $checked.attr( 'rel' ) ); + if ( !$wrapper.is( ':visible' ) ) { + $( '.dbWrapper' ).hide( 'slow' ); + $wrapper.show( 'slow' ); + } + } ); + // Scroll to the bottom of upgrade log + $( "#config-update-log" ).each( function() { this.scrollTop = this.scrollHeight; } ); + // Show/hide Creative Commons thingy + $( '.licenseRadio' ).click( function() { + var $wrapper = $( '#config-cc-wrapper' ); + if ( $( '#config__LicenseCode_cc-choose' ).is( ':checked' ) ) { + $wrapper.show( 'slow' ); + } else { + $wrapper.hide( 'slow' ); + } + } ); + // Show/hide random stuff (email, upload) + $( '.showHideRadio' ).click( function() { + var $wrapper = $( '#' + $(this).attr( 'rel' ) ); + if ( $(this).is( ':checked' ) ) { + $wrapper.show( 'slow' ); + } else { + $wrapper.hide( 'slow' ); + } + } ); + $( '.hideShowRadio' ).click( function() { + var $wrapper = $( '#' + $(this).attr( 'rel' ) ); + if ( $(this).is( ':checked' ) ) { + $wrapper.hide( 'slow' ); + } else { + $wrapper.show( 'slow' ); + } + } ); + // Enable/disable "other" textboxes + $( '.enableForOther' ).click( function() { + var $textbox = $( '#' + $(this).attr( 'rel' ) ); + if ( $(this).val() == 'other' ) { // FIXME: Ugh, this is ugly + $textbox.removeAttr( 'disabled' ); + } else { + $textbox.attr( 'disabled', 'disabled' ); + } + } ); + // Synchronize radio button label for sitename with textbox + $label = $( 'label[for=config__NamespaceType_site-name]' ); + labelText = $label.text(); + $label.text( labelText.replace( '$1', '' ) ); + $( '#config_wgSitename' ).bind( 'keyup change', syncText ).each( syncText ); + function syncText() { + var value = $(this).val() + .replace( /[\[\]\{\}|#<>%+? ]/g, '_' ) + .replace( /&/, '&' ) + .replace( /__+/g, '_' ) + .replace( /^_+/, '' ) + .replace( /_+$/, '' ); + value = value.substr( 0, 1 ).toUpperCase() + value.substr( 1 ); + $label.text( labelText.replace( '$1', value ) ); + } + // Show/Hide memcached servers when needed + $( "input[name$='config_wgMainCacheType']" ).change( function() { + var $memc = $( "#config-memcachewrapper" ); + if ( $( "input[name$='config_wgMainCacheType']:checked" ).val() == 'memcached' ) { + $memc.show( 'slow' ); + } else { + $memc.hide( 'slow' ); + } + } ); +} ); + +} )( jQuery, mediaWiki ); \ No newline at end of file diff --git a/resources/mw/mw.diff.js b/resources/mw/mw.diff.js new file mode 100644 index 00000000000..a87530263fc --- /dev/null +++ b/resources/mw/mw.diff.js @@ -0,0 +1,30 @@ +/* + * Diff tweaks (used to be diff.js) + * + * Ported by: Trevor Parscal + */ + +( function( $ ) { + +/* Initialization */ + +$( document ).ready( function() { + /* + * Workaround for overflow bug in Mozilla 1.1 and earlier, where scrolling
    s in cells collapse their + * height to a single line. + * + * Known to be fixed in 1.2.1 (Gecko 20021130), but the CSS hacks I've tried with overflow-x disable the scrolling + * all the way until Mozilla 1.8 / FF 1.5 and break Opera as well. + * + * So... we check for reaaaally old Gecko and hack in an alternate rule to let the wide cells spill instead of + * scrolling them. Not ideal as it won't work if JS is disabled, of course. + */ + if ( window.navigator && window.navigator.product == 'Gecko' && window.navigator.productSub < '20021130' ) { + document.styleSheets[document.styleSheets.length - 1].insertRule( + 'table.diff td div { overflow: visible; }', + document.styleSheets[document.styleSheets.length - 1].cssRules.length + ); + } +} ); + +} )( jQuery ); \ No newline at end of file diff --git a/resources/mw/mw.installer.js b/resources/mw/mw.installer.js new file mode 100644 index 00000000000..28a1bec2f53 --- /dev/null +++ b/resources/mw/mw.installer.js @@ -0,0 +1,100 @@ +/* + * Installer configuration (used to be config.js) + * + * Ported by: Trevor Parscal + */ + +( function( $ ) { + +/* Initialization */ + +$( document ).ready( function() { + // Show/hide code for help text + $( '.config-show-help a' ).click( function() { + $(this).parent().siblings( '.config-help-message' ).show( 'slow' ); + $(this).parent().siblings( '.config-hide-help' ).show(); + $(this).parent().hide(); + return false; + } ); + $( '.config-hide-help a' ).click( function() { + $(this).parent().siblings( '.config-help-message' ).hide( 'slow' ); + $(this).parent().siblings( '.config-show-help' ).show(); + $(this).parent().hide(); + return false; + } ); + // Show/hide code for DB-specific options + // FIXME: Do we want slow, fast, or even non-animated (instantaneous) showing/hiding here? + $( '.dbRadio' ).each( function() { $( '#' + $(this).attr( 'rel' ) ).hide(); } ); + $( '#' + $( '.dbRadio:checked' ).attr( 'rel' ) ).show(); + $( '.dbRadio' ).click( function() { + var $checked = $( '.dbRadio:checked' ); + var $wrapper = $( '#' + $checked.attr( 'rel' ) ); + if ( !$wrapper.is( ':visible' ) ) { + $( '.dbWrapper' ).hide( 'slow' ); + $wrapper.show( 'slow' ); + } + } ); + // Scroll to the bottom of upgrade log + $( "#config-update-log" ).each( function() { this.scrollTop = this.scrollHeight; } ); + // Show/hide Creative Commons thingy + $( '.licenseRadio' ).click( function() { + var $wrapper = $( '#config-cc-wrapper' ); + if ( $( '#config__LicenseCode_cc-choose' ).is( ':checked' ) ) { + $wrapper.show( 'slow' ); + } else { + $wrapper.hide( 'slow' ); + } + } ); + // Show/hide random stuff (email, upload) + $( '.showHideRadio' ).click( function() { + var $wrapper = $( '#' + $(this).attr( 'rel' ) ); + if ( $(this).is( ':checked' ) ) { + $wrapper.show( 'slow' ); + } else { + $wrapper.hide( 'slow' ); + } + } ); + $( '.hideShowRadio' ).click( function() { + var $wrapper = $( '#' + $(this).attr( 'rel' ) ); + if ( $(this).is( ':checked' ) ) { + $wrapper.hide( 'slow' ); + } else { + $wrapper.show( 'slow' ); + } + } ); + // Enable/disable "other" textboxes + $( '.enableForOther' ).click( function() { + var $textbox = $( '#' + $(this).attr( 'rel' ) ); + if ( $(this).val() == 'other' ) { // FIXME: Ugh, this is ugly + $textbox.removeAttr( 'disabled' ); + } else { + $textbox.attr( 'disabled', 'disabled' ); + } + } ); + // Synchronize radio button label for sitename with textbox + $label = $( 'label[for=config__NamespaceType_site-name]' ); + labelText = $label.text(); + $label.text( labelText.replace( '$1', '' ) ); + $( '#config_wgSitename' ).bind( 'keyup change', syncText ).each( syncText ); + function syncText() { + var value = $(this).val() + .replace( /[\[\]\{\}|#<>%+? ]/g, '_' ) + .replace( /&/, '&' ) + .replace( /__+/g, '_' ) + .replace( /^_+/, '' ) + .replace( /_+$/, '' ); + value = value.substr( 0, 1 ).toUpperCase() + value.substr( 1 ); + $label.text( labelText.replace( '$1', value ) ); + } + // Show/Hide memcached servers when needed + $( "input[name$='config_wgMainCacheType']" ).change( function() { + var $memc = $( "#config-memcachewrapper" ); + if ( $( "input[name$='config_wgMainCacheType']:checked" ).val() == 'memcached' ) { + $memc.show( 'slow' ); + } else { + $memc.hide( 'slow' ); + } + } ); +} ); + +} )( jQuery ); diff --git a/resources/mw/mw.js b/resources/mw/mw.js new file mode 100644 index 00000000000..1070ecd4b44 --- /dev/null +++ b/resources/mw/mw.js @@ -0,0 +1,751 @@ +/* + * JavaScript Backwards Compatibility + */ + +// Make calling .indexOf() on an array work on older browsers +if ( typeof Array.prototype.indexOf === 'undefined' ) { + Array.prototype.indexOf = function( needle ) { + for ( var i = 0; i < this.length; i++ ) { + if ( this[i] === needle ) { + return i; + } + } + return -1; + }; +} + +/* + * Core MediaWiki JavaScript Library + */ +( function() { + + /* Constants */ + + // This will not change until we are 100% ready to turn off legacy globals + const LEGACY_GLOBALS = true; + + /* Members */ + + this.legacy = LEGACY_GLOBALS ? window : {}; + + /* Methods */ + + /** + * Log a string msg to the console + * + * All mw.log statements will be removed on minification so lots of mw.log calls will not impact performance in non-debug + * mode. This is done using simple regular expressions, so the input of this function needs to not contain things like a + * self-executing closure. In the case that the browser does not have a console available, one is created by appending a + *
    element to the bottom of the body and then appending a
    element to that for each message. In the case that + * the browser does have a console available + * + * @author Michael Dale , Trevor Parscal + * @param {String} string String to output to console + */ + this.log = function( string ) { + // Allow log messages to use a configured prefix + if ( mw.config.exists( 'mw.log.prefix' ) ) { + string = mw.config.get( 'mw.log.prefix' ) + string; + } + // Try to use an existing console + if ( typeof window.console !== 'undefined' && typeof window.console.log == 'function' ) { + window.console.log( string ); + } else { + // Show a log box for console-less browsers + var $log = $( '#mw_log_console' ); + if ( !$log.length ) { + $log = $( '
    ' ) + .css( { + 'position': 'absolute', + 'overflow': 'auto', + 'z-index': 500, + 'bottom': '0px', + 'left': '0px', + 'right': '0px', + 'height': '150px', + 'background-color': 'white', + 'border-top': 'solid 1px #DDDDDD' + } ) + .appendTo( $( 'body' ) ); + } + if ( $log.length ) { + $log.append( + $( '
    ' + string + '
    ' ) + .css( { + 'border-bottom': 'solid 1px #DDDDDD', + 'font-size': 'small', + 'font-family': 'monospace', + 'padding': '0.125em 0.25em' + } ) + ); + } + } + }; + /* + * An object which allows single and multiple existence, setting and getting on a list of key / value pairs + */ + this.config = new ( function() { + + /* Private Members */ + + var that = this; + // List of configuration values - in legacy mode these configurations were ALL in the global space + var values = LEGACY_GLOBALS ? window : {}; + + /* Public Methods */ + + /** + * Sets one or multiple configuration values using a key and a value or an object of keys and values + */ + this.set = function( keys, value ) { + if ( typeof keys === 'object' ) { + for ( var key in keys ) { + values[key] = keys[key]; + } + } else if ( typeof keys === 'string' && typeof value !== 'undefined' ) { + values[keys] = value; + } + }; + /** + * Gets one or multiple configuration values using a key and an optional fallback or an array of keys + */ + this.get = function( keys, fallback ) { + if ( typeof keys === 'object' ) { + var result = {}; + for ( var k = 0; k < keys.length; k++ ) { + if ( typeof values[keys[k]] !== 'undefined' ) { + result[keys[k]] = values[keys[k]]; + } + } + return result; + } else if ( typeof values[keys] === 'undefined' ) { + return typeof fallback !== 'undefined' ? fallback : null; + } else { + return values[keys]; + } + }; + /** + * Checks if one or multiple configuration fields exist + */ + this.exists = function( keys ) { + if ( typeof keys === 'object' ) { + for ( var k = 0; k < keys.length; k++ ) { + if ( !( keys[k] in values ) ) { + return false; + } + } + return true; + } else { + return keys in values; + } + }; + } )(); + /* + * Localization system + */ + this.msg = new ( function() { + + /* Private Members */ + + var that = this; + // List of localized messages + var messages = {}; + + /* Public Methods */ + + this.set = function( keys, value ) { + if ( typeof keys === 'object' ) { + for ( var key in keys ) { + messages[key] = keys[key]; + } + } else if ( typeof keys === 'string' && typeof value !== 'undefined' ) { + messages[keys] = value; + } + }; + this.get = function( key, args ) { + if ( !( key in messages ) ) { + return '<' + key + '>'; + } + var msg = messages[key]; + if ( typeof args == 'object' || typeof args == 'array' ) { + for ( var argKey in args ) { + msg = msg.replace( '\$' + ( parseInt( argKey ) + 1 ), args[argKey] ); + } + } else if ( typeof args == 'string' || typeof args == 'number' ) { + msg = msg.replace( '$1', args ); + } + return msg; + }; + } )(); + /* + * Client-side module loader which integrates with the MediaWiki ResourceLoader + */ + this.loader = new ( function() { + + /* Private Members */ + + var that = this; + var server = 'load.php'; + /* + * Mapping of registered modules + * + * Format: + * { + * 'moduleName': { + * 'needs': ['required module', 'required module', ...], + * 'state': 'registered, loading, loaded, or ready', + * 'script': function() {}, + * 'style': 'css code string', + * 'localization': { 'key': 'value' } + * } + * } + */ + var registry = {}; + // List of callbacks waiting on dependent modules to be loaded so they can be executed + var queue = []; + // Until document ready, load requests will be collected in a batch queue + var batch = []; + // True after document ready occurs + var ready = false; + + /* Private Methods */ + + /** + * Gets a list of modules names that a module needs in their proper dependency order + * + * @param string module name + * @return + * @throws Error if circular reference is detected + */ + function needs( module ) { + if ( !( module in registry ) ) { + // Undefined modules have no needs + return []; + } + var resolved = []; + var unresolved = []; + if ( arguments.length === 3 ) { + // Use arguemnts on inner call + resolved = arguments[1]; + unresolved = arguments[2]; + } + unresolved[unresolved.length] = module; + for ( n in registry[module].needs ) { + if ( resolved.indexOf( registry[module].needs[n] ) === -1 ) { + if ( unresolved.indexOf( registry[module].needs[n] ) !== -1 ) { + throw new Error( + 'Circular reference detected: ' + module + ' -> ' + registry[module].needs[n] + ); + } + needs( registry[module].needs[n], resolved, unresolved ); + } + } + resolved[resolved.length] = module; + unresolved.slice( unresolved.indexOf( module ), 1 ); + if ( arguments.length === 1 ) { + // Return resolved list on outer call + return resolved; + } + }; + /** + * Narrows a list of module names down to those matching a specific state. Possible states are 'undefined', + * 'registered', 'loading', 'loaded', or 'ready' + * + * @param mixed string or array of strings of module states to filter by + * @param array list of module names to filter (optional, all modules will be used by default) + * @return array list of filtered module names + */ + function filter( states, modules ) { + var list = []; + if ( typeof modules === 'undefined' ) { + modules = []; + for ( module in registry ) { + modules[modules.length] = module; + } + } + for ( var s in states ) { + for ( var m in modules ) { + if ( + ( states[s] == 'undefined' && typeof registry[modules[m]] === 'undefined' ) || + ( typeof registry[modules[m]] === 'object' && registry[modules[m]].state === states[s] ) + ) { + list[list.length] = modules[m]; + } + } + } + return list; + } + /** + * Executes a loaded module, making it ready to use + * + * @param string module name to execute + */ + function execute( module ) { + if ( typeof registry[module] === 'undefined' ) { + throw new Error( 'module has not been registered: ' + module ); + } + switch ( registry[module].state ) { + case 'registered': + throw new Error( 'module has not completed loading: ' + module ); + break; + case 'loading': + throw new Error( 'module has not completed loading: ' + module ); + break; + case 'ready': + throw new Error( 'module has already been loaded: ' + module ); + break; + } + // Add style sheet to document + if ( typeof registry[module].style === 'string' && registry[module].style.length ) { + $( 'head' ).append( '' ); + } + // Add localizations to message system + if ( typeof registry[module].localization === 'object' ) { + mw.msg.set( registry[module].localization ); + } + // Execute script + try { + registry[module].script(); + } catch( e ) { + mw.log( 'Exception thrown by ' + module + ': ' + e.message ); + } + // Change state + registry[module].state = 'ready'; + + // Execute all modules which were waiting for this to be ready + for ( r in registry ) { + if ( registry[r].state == 'loaded' ) { + if ( filter( ['ready'], registry[r].needs ).length == registry[r].needs.length ) { + execute( r ); + } + } + } + } + /** + * Adds a callback and it's needs to the queue + * + * @param array list of module names the callback needs to be ready before being executed + * @param function callback to execute when needs are met + */ + function request( needs, callback ) { + queue[queue.length] = { 'needs': filter( ['undefined', 'registered'], needs ), 'callback': callback }; + } + + /* Public Methods */ + + /** + * Processes the queue, loading and executing when things when ready. + */ + this.work = function() { + // Appends a list of modules to the batch + function append( modules ) { + for ( m in modules ) { + // Prevent requesting modules which are loading, loaded or ready + if ( modules[m] in registry && registry[modules[m]].state == 'registered' ) { + // Since the batch can live between calls to work until document ready, we need to make sure + // we aren't making a duplicate entry + if ( batch.indexOf( modules[m] ) == -1 ) { + batch[batch.length] = modules[m]; + registry[modules[m]].state = 'loading'; + } + } + } + } + // Fill batch with modules that need to be loaded + for ( var q in queue ) { + append( queue[q].needs ); + for ( n in queue[q].needs ) { + append( needs( queue[q].needs[n] ) ); + } + } + // After document ready, handle the batch + if ( ready && batch.length ) { + // Always order modules alphabetically to help reduce cache misses for otherwise identical content + batch.sort(); + + var base = $.extend( {}, + // Pass configuration values through the URL + mw.config.get( [ 'user', 'skin', 'space', 'view', 'language' ] ), + // Ensure request comes back in the proper mode (debug or not) + { 'debug': typeof mw.debug !== 'undefined' ? '1' : '0' } + ); + var requests = []; + if ( base.debug == '1' ) { + for ( b in batch ) { + requests[requests.length] = $.extend( { 'modules': batch[b] }, base ); + } + } else { + requests[requests.length] = $.extend( { 'modules': batch.join( '|' ) }, base ); + } + // It may be more performant to do this with an Ajax call, but that's limited to same-domain, so we + // can either auto-detect (if there really is any benefit) or just use this method, which is safe + setTimeout( function() { + // Clear the batch - this MUST happen before we append the script element to the body or it's + // possible that the script will be locally cached, instantly load, and work the batch again, + // all before we've cleared it causing each request to include modules which are already loaded + batch = []; + var html = ''; + for ( r in requests ) { + // Build out the HTML + var src = mw.util.buildUrlString( { + 'path': mw.config.get( 'wgScriptPath' ) + '/load.php', + 'query': requests[r] + } ); + html += ''; + } + // Append script to head + $( 'head' ).append( html ); + }, 0 ) + } + }; + /** + * Registers a module, letting the system know about it and it's dependencies. loader.js files contain calls + * to this function. + */ + this.register = function( name, needs ) { + // Validate input + if ( typeof name !== 'string' ) { + throw new Error( 'name must be a string, not a ' + typeof name ); + } + if ( typeof registry[name] !== 'undefined' ) { + throw new Error( 'module already implemeneted: ' + name ); + } + // List the module as registered + registry[name] = { 'state': 'registered', 'needs': [] }; + // Allow needs to be given as a function which returns a string or array + if ( typeof needs === 'function' ) { + needs = needs(); + } + if ( typeof needs === 'string' ) { + // Allow needs to be given as a single module name + registry[name].needs = [needs]; + } else if ( typeof needs === 'object' ) { + // Allow needs to be given as an array of module names + registry[name].needs = needs; + } + }; + /** + * Implements a module, giving the system a course of action to take upon loading. Results of a request for + * one or more modules contain calls to this function. + */ + this.implement = function( name, script, style, localization ) { + // Automaically register module + if ( typeof registry[name] === 'undefined' ) { + that.register( name, needs ); + } + // Validate input + if ( typeof script !== 'function' ) { + throw new Error( 'script must be a function, not a ' + typeof script ); + } + if ( typeof style !== 'undefined' && typeof style !== 'string' ) { + throw new Error( 'style must be a string, not a ' + typeof style ); + } + if ( typeof localization !== 'undefined' && typeof localization !== 'object' ) { + throw new Error( 'localization must be an object, not a ' + typeof localization ); + } + if ( typeof registry[name] !== 'undefined' && typeof registry[name].script !== 'undefined' ) { + throw new Error( 'module already implemeneted: ' + name ); + } + // Mark module as loaded + registry[name].state = 'loaded'; + // Attach components + registry[name].script = script; + if ( typeof style === 'string' ) { + registry[name].style = style; + } + if ( typeof localization === 'object' ) { + registry[name].localization = localization; + } + // Execute or queue callback + if ( filter( ['ready'], registry[name].needs ).length == registry[name].needs.length ) { + execute( name ); + } else { + request( registry[name].needs, function() { execute( name ); } ); + } + }; + /** + * Executes a function as soon as one or more required modules are ready + * + * @param mixed string or array of strings of modules names the callback needs to be ready before executing + * @param function callback to execute when all needs are met + */ + this.using = function( needs, callback ) { + // Validate input + if ( typeof needs !== 'object' && typeof needs !== 'string' ) { + throw new Error( 'needs must be a string or an array, not a ' + typeof needs ) + } + if ( typeof callback !== 'function' ) { + throw new Error( 'callback must be a function, not a ' + typeof callback ) + } + if ( typeof needs === 'string' ) { + needs = [needs]; + } + // Execute or queue callback + if ( filter( ['ready'], needs ).length == needs.length ) { + callback(); + } else { + request( needs, callback ); + } + }; + + /* Event Bindings */ + + $( document ).ready( function() { + ready = true; + that.work(); + } ); + } )(); + /** + * General purpose utilities + */ + this.util = new ( function() { + + /* Private Members */ + + var that = this; + // Decoded user agent string cache + var client = null; + + /* Public Methods */ + + /** + * Builds a url string from an object containing any of the following components: + * + * Component Example + * scheme "http" + * server "www.domain.com" + * path "path/to/my/file.html" + * query "this=thåt" or { 'this': 'thåt' } + * fragment "place_on_the_page" + * + * Results in: "http://www.domain.com/path/to/my/file.html?this=th%C3%A5t#place_on_the_page" + * + * All arguments to this function are assumed to be URL-encoded already, except for the + * query parameter if provided in object form. + */ + this.buildUrlString = function( components ) { + var url = ''; + if ( typeof components.scheme === 'string' ) { + url += components.scheme + '://'; + } + if ( typeof components.server === 'string' ) { + url += components.server + '/'; + } + if ( typeof components.path === 'string' ) { + url += components.path; + } + if ( typeof components.query === 'string' ) { + url += '?' + components.query; + } else if ( typeof components.query === 'object' ) { + url += '?' + that.buildQueryString( components.query ); + } + if ( typeof components.fragment === 'string' ) { + url += '#' + components.fragment; + } + return url; + }; + /** + * RFC 3986 compliant URI component encoder - with identical behavior as PHP's urlencode function. Note: PHP's + * urlencode function prior to version 5.3 also escapes tildes, this does not. The naming here is not the same + * as PHP because PHP can't decide out to name things (underscores sometimes?), much less set a reasonable + * precedence for how things should be named in other environments. We use camelCase and action-subject here. + */ + this.encodeUrlComponent = function( string ) { + return encodeURIComponent( new String( string ) ) + .replace(/!/g, '%21') + .replace(/'/g, '%27') + .replace(/\(/g, '%28') + .replace(/\)/g, '%29') + .replace(/\*/g, '%2A') + .replace(/%20/g, '+'); + }; + /** + * Builds a query string from an object with key and values + */ + this.buildQueryString = function( parameters ) { + if ( typeof parameters === 'object' ) { + var parts = []; + for ( var p in parameters ) { + parts[parts.length] = that.encodeUrlComponent( p ) + '=' + that.encodeUrlComponent( parameters[p] ); + } + return parts.join( '&' ); + } + return ''; + }; + /** + * Returns an object containing information about the browser + * + * The resulting client object will be in the following format: + * { + * 'name': 'firefox', + * 'layout': 'gecko', + * 'os': 'linux' + * 'version': '3.5.1', + * 'versionBase': '3', + * 'versionNumber': 3.5, + * } + */ + this.client = function() { + // Use the cached version if possible + if ( client === null ) { + + /* Configuration */ + + // Name of browsers or layout engines we don't recognize + var uk = 'unknown'; + // Generic version digit + var x = 'x'; + // Strings found in user agent strings that need to be conformed + var wildUserAgents = [ 'Opera', 'Navigator', 'Minefield', 'KHTML', 'Chrome', 'PLAYSTATION 3']; + // Translations for conforming user agent strings + var userAgentTranslations = [ + // Tons of browsers lie about being something they are not + [/(Firefox|MSIE|KHTML,\slike\sGecko|Konqueror)/, ''], + // Chrome lives in the shadow of Safari still + ['Chrome Safari', 'Chrome'], + // KHTML is the layout engine not the browser - LIES! + ['KHTML', 'Konqueror'], + // Firefox nightly builds + ['Minefield', 'Firefox'], + // This helps keep differnt versions consistent + ['Navigator', 'Netscape'], + // This prevents version extraction issues, otherwise translation would happen later + ['PLAYSTATION 3', 'PS3'], + ]; + // Strings which precede a version number in a user agent string - combined and used as match 1 in + // version detectection + var versionPrefixes = [ + 'camino', 'chrome', 'firefox', 'netscape', 'netscape6', 'opera', 'version', 'konqueror', 'lynx', + 'msie', 'safari', 'ps3' + ]; + // Used as matches 2, 3 and 4 in version extraction - 3 is used as actual version number + var versionSuffix = '(\/|\;?\s|)([a-z0-9\.\+]*?)(\;|dev|rel|\\)|\s|$)'; + // Names of known browsers + var browserNames = [ + 'camino', 'chrome', 'firefox', 'netscape', 'konqueror', 'lynx', 'msie', 'opera', 'safari', 'ipod', + 'iphone', 'blackberry', 'ps3' + ]; + // Tanslations for conforming browser names + var browserTranslations = []; + // Names of known layout engines + var layoutNames = ['gecko', 'konqueror', 'msie', 'opera', 'webkit']; + // Translations for conforming layout names + var layoutTranslations = [['konqueror', 'khtml'], ['msie', 'trident'], ['opera', 'presto']]; + // Names of known operating systems + var osNames = ['win', 'mac', 'linux', 'sunos', 'solaris', 'iphone']; + // Translations for conforming operating system names + var osTranslations = [['sunos', 'solaris']]; + + /* Methods */ + + // Performs multiple replacements on a string + function translate( source, translations ) { + for ( var i = 0; i < translations.length; i++ ) { + source = source.replace( translations[i][0], translations[i][1] ); + } + return source; + }; + + /* Pre-processing */ + + var userAgent = navigator.userAgent, match, browser = uk, layout = uk, os = uk, version = x; + if ( match = new RegExp( '(' + wildUserAgents.join( '|' ) + ')' ).exec( userAgent ) ) { + // Takes a userAgent string and translates given text into something we can more easily work with + userAgent = translate( userAgent, userAgentTranslations ); + } + // Everything will be in lowercase from now on + userAgent = userAgent.toLowerCase(); + + /* Extraction */ + + if ( match = new RegExp( '(' + browserNames.join( '|' ) + ')' ).exec( userAgent ) ) { + browser = translate( match[1], browserTranslations ); + } + if ( match = new RegExp( '(' + layoutNames.join( '|' ) + ')' ).exec( userAgent ) ) { + layout = translate( match[1], layoutTranslations ); + } + if ( match = new RegExp( '(' + osNames.join( '|' ) + ')' ).exec( navigator.platform.toLowerCase() ) ) { + var os = translate( match[1], osTranslations ); + } + if ( match = new RegExp( '(' + versionPrefixes.join( '|' ) + ')' + versionSuffix ).exec( userAgent ) ) { + version = match[3]; + } + + /* Edge Cases -- did I mention about how user agent string lie? */ + + // Decode Safari's crazy 400+ version numbers + if ( name.match( /safari/ ) && version > 400 ) { + version = '2.0'; + } + // Expose Opera 10's lies about being Opera 9.8 + if ( name === 'opera' && version >= 9.8) { + version = userAgent.match( /version\/([0-9\.]*)/i )[1] || 10; + } + + /* Caching */ + + client = { + 'browser': browser, + 'layout': layout, + 'os': os, + 'version': version, + 'versionBase': ( version !== x ? new String( version ).substr( 0, 1 ) : x ), + 'versionNumber': ( parseFloat( version, 10 ) || 0.0 ) + }; + } + return client; + }; + /** + * Checks the current browser against a support map object to determine if the browser has been black-listed or + * not. If the browser was not configured specifically it is assumed to work. It is assumed that the body + * element is classified as either "ltr" or "rtl". If neither is set, "ltr" is assumed. + * + * A browser map is in the following format: + * { + * 'ltr': { + * // Multiple rules with configurable operators + * 'msie': [['>=', 7], ['!=', 9]], + * // Blocked entirely + * 'iphone': false + * }, + * 'rtl': { + * // Test against a string + * 'msie': [['!==', '8.1.2.3']], + * // RTL rules do not fall through to LTR rules, you must explicity set each of them + * 'iphone': false + * } + * } + * + * @param map Object of browser support map + * + * @return Boolean true if browser known or assumed to be supported, false if blacklisted + */ + this.testClient = function( map ) { + var client = this.client(); + // Check over each browser condition to determine if we are running in a compatible client + var browser = map[$( 'body' ).is( '.rtl' ) ? 'rtl' : 'ltr'][client.browser]; + if ( typeof browser !== 'object' ) { + // Unknown, so we assume it's working + return true; + } + for ( var condition in browser ) { + var op = browser[condition][0]; + var val = browser[condition][1]; + if ( val === false ) { + return false; + } else if ( typeof val == 'string' ) { + if ( !( eval( 'client.version' + op + '"' + val + '"' ) ) ) { + return false; + } + } else if ( typeof val == 'number' ) { + if ( !( eval( 'client.versionNumber' + op + val ) ) ) { + return false; + } + } + } + return true; + }; + } )(); + // Attach to window + window.mw = $.extend( 'mw' in window ? window.mw : {}, this ); +} )(); \ No newline at end of file diff --git a/resources/mw/mw.legacy.IEFixes.js b/resources/mw/mw.legacy.IEFixes.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.ajax.js b/resources/mw/mw.legacy.ajax.js new file mode 100644 index 00000000000..a4f29fd9e2b --- /dev/null +++ b/resources/mw/mw.legacy.ajax.js @@ -0,0 +1,176 @@ +/* + * Legacy emulation for the now depricated ajax.js + * + * Original licensing information: + * remote scripting library + * (c) copyright 2005 modernmethod, inc + * + * Ported by: Trevor Parscal + */ + +( function( $ ) { + +$.extend( mw.legacy, { + + /* Global Variables */ + + 'sajax_debug_mode': false, + 'sajax_debug_mode': "GET", + + /* Functions */ + + /** + * If sajax_debug_mode is true, this function outputs given the message into the element with id = sajax_debug; if no + * such element exists in the document, it is injected + * + * @param string text debug message to append to log + * @return boolean true when in debug mode, false when not + */ + 'sajax_debug': function( text ) { + if ( mw.legacy.sajax_debug_mode ) { + var $e = $( '#sajax_debug' ); + if ( !$e.length ) { + $e = $( '

    ' ).prependTo( $( 'body' ) ); + } + $e.append( $( '
    ' ).text( text ) ); + return true; + } + return false; + } + /** + * Gets an XMLHttpRequest or equivilant ActiveXObject + * + * @reuturn mixed request object on success, boolean false on failure + */ + 'sajax_init_object': function() { + mw.legacy.sajax_debug( 'sajax_init_object() called..' ); + var request = false; + try { + // Try the "new" style before ActiveX so we don't unnecessarily trigger warnings in IE 7 when the user's + // security settings are set to prompt about ActiveX usage + request = new XMLHttpRequest(); + } catch ( e ) { + try { + request = new ActiveXObject( 'Msxml2.XMLHTTP' ); + } catch ( e ) { + try { + request = new ActiveXObject( 'Microsoft.XMLHTTP' ); + } catch ( oc ) { + request = null; + } + } + } + if ( !request ) { + mw.legacy.sajax_debug( 'Could not create connection object.' ); + } + return request; + }, + /** + * Performs an ajax call to mediawiki. Calls are handeled by AjaxDispatcher.php + * + * @param string method name of the function to call. Must be registered in $wgAjaxExportList + * @param array arguments arguments to that function + * @param mixed target the target that will handle the result of the call. If this is a function, if will be called + * with the XMLHttpRequest as a parameter; if it's an input element, its value will be set to the resultText; if + * it's another type of element, its innerHTML will be set to the resultText. + * + * @example + * // This will call the doFoo function via MediaWiki's AjaxDispatcher, with (1, 2, 3) as the parameter list, + * // and will show the result in the element with id = showFoo + * sajax_do_call( 'doFoo', [1, 2, 3], document.getElementById( 'showFoo' ) ); + */ + 'sajax_do_call': function( method, arguments, target ) { + var post_data; + var uri = mw.legacy.wgServer + + ( ( mw.legacy.wgScript == null ) ? ( mw.legacy.wgScriptPath + '/index.php' ) : mw.legacy.wgScript ) + + '?action=ajax'; + if ( mw.legacy.sajax_request_type == 'GET' ) { + if ( uri.indexOf( '?' ) == -1 ) { + uri = uri + '?rs=' + encodeURIComponent( method ); + } else { + uri = uri + '&rs=' + encodeURIComponent( method ); + } + for ( var i = 0; i < arguments.length; i++ ) { + uri = uri + '&rsargs[]=' + encodeURIComponent( arguments[i] ); + } + post_data = null; + } else { + post_data = 'rs=' + encodeURIComponent( method ); + for ( var i = 0; i < arguments.length; i++ ) { + post_data = post_data + '&rsargs[]=' + encodeURIComponent( arguments[i] ); + } + } + var request = mw.legacy.sajax_init_object(); + if ( !request ) { + alert( 'AJAX not supported' ); + return false; + } + try { + request.open( mw.legacy.sajax_request_type, uri, true ); + } catch ( e ) { + if ( window.location.hostname == "localhost" ) { + alert( + 'Your browser blocks XMLHttpRequest to \'localhost\', ' + + 'try using a real hostname for development/testing.' + ); + } + throw e; + } + if ( mw.legacy.sajax_request_type == 'POST' ) { + request.setRequestHeader( 'Method', 'POST ' + uri + ' HTTP/1.1' ); + request.setRequestHeader( 'Content-Type', 'application/x-www-form-urlencoded' ); + } + request.setRequestHeader( 'Pragma', 'cache=yes' ); + request.setRequestHeader( 'Cache-Control', 'no-transform' ); + request.onreadystatechange = function() { + if ( request.readyState != 4 ) { + return; + } + mw.legacy.sajax_debug( + 'received (' + request.status + ' ' + request.statusText + ') ' + request.responseText + ); + if ( typeof( target ) == 'function' ) { + target( request ); + } else if ( typeof( target ) == 'object' ) { + $target = $( target ); + if ( $target.is( 'input' ) ) { + if ( request.status == 200 ) { + $target.val(); + } + } else { + if ( request.status == 200 ) { + $target.html( request.responseText ); + } else { + $target.html( + '
    ' + + 'Error: ' + request.status + ' ' + request.statusText + + ' (' + request.responseText + ')' + + '
    ' + ); + } + } + } else { + alert( 'Bad target for sajax_do_call: not a function or object: ' + target ); + } + return; + } + mw.legacy.sajax_debug( method + ' uri = ' + uri + ' / post = ' + post_data ); + request.send( post_data ); + mw.legacy.sajax_debug( method + ' waiting..' ); + delete x; + return true; + }, + /** + * Ajax compatibility test + * + * @return boolean whether the browser supports XMLHttpRequest + */ + 'wfSupportsAjax': function() { + var request = mw.legacy.sajax_init_object(); + var result = request ? true : false; + delete request; + return result; + } +} ); + +} )( jQuery ); \ No newline at end of file diff --git a/resources/mw/mw.legacy.ajaxwatch.js b/resources/mw/mw.legacy.ajaxwatch.js new file mode 100644 index 00000000000..eafdd4e43b2 --- /dev/null +++ b/resources/mw/mw.legacy.ajaxwatch.js @@ -0,0 +1,119 @@ +/* + * Legacy emulation for the now depricated ajaxwatch.js + * + * Ported by: Trevor Parscal + * + * Animate watch/unwatch links to use asynchronous API requests to watch pages, rather than clicking on links + * + * Warning: Uses mw.legacy.jsMsg() from mw.legacy.wikibits.js + */ + +( function( $ ) { + +if ( typeof mw.legacy.wgAjaxWatch === "undefined" || !mw.legacy.wgAjaxWatch ) { + $.extend( mw.legacy, { + 'wgAjaxWatch': { + 'watchMsg': 'Watch', + 'unwatchMsg': 'Unwatch', + 'watchingMsg': 'Watching...', + 'unwatchingMsg': 'Unwatching...', + 'tooltip-ca-watchMsg': 'Add this page to your watchlist', + 'tooltip-ca-unwatchMsg': 'Remove this page from your watchlist' + } + } ); +} +$.extend( mw.legacy.wgAjaxWatch, { + 'setLinkText': function( $link, action ) { + if ( action == 'watch' || action == 'unwatch' ) { + // save the accesskey from the title + var keyCommand = $link.attr( 'title' ).match( /\[.*?\]$/ ) ? + $link.attr( 'title' ).match( /\[.*?\]$/ )[0] : ''; + $link.attr( 'title', wgAjaxWatch['tooltip-ca-' + action + 'Msg'] + ' ' + keyCommand ); + } + if ( $link.data( 'icon' ) ) { + $link.attr( 'alt', wgAjaxWatch[action + 'Msg'] ); + if ( action == 'watching' || action == 'unwatching' ) { + $link.addClass( 'loading' ); + } else { + $link.removeClass( 'loading' ); + } + } else { + $link.html( wgAjaxWatch[action+'Msg'] ); + } + }, + 'processResult': function( response ) { + response = response.watch; + var $link = $(this); + // To ensure we set the same status for all watch links with the same target we trigger a custom event on + // *all* watch links. + if ( response.watched !== undefined ) { + wgAjaxWatch.$links.trigger( 'mw-ajaxwatch', [response.title, 'watch'] ); + } else if ( response.unwatched !== undefined ){ + wgAjaxWatch.$links.trigger( 'mw-ajaxwatch', [response.title, 'unwatch'] ); + } else { + // Either we got an error code or it just plain broke. + window.location.href = $link.attr( 'href' ); + return; + } + mw.legacy.jsMsg( response.message, 'watch' ); + // Bug 12395 - update the watch checkbox on edit pages when the page is watched or unwatched via the tab. + if ( response.watched !== undefined ) { + $j("#wpWatchthis").attr( 'checked', '1' ); + } else { + $j("#wpWatchthis").removeAttr( 'checked' ); + } + } +} ); + +/* Initialization */ + +$( document ).ready( function() { + var $links = $( '.mw-watchlink a, a.mw-watchlink' ); + // BC with older skins... + $links = $links + .add( $( '#ca-watch a, #ca-unwatch a, a#mw-unwatch-link1' ) ) + .add( $( 'a#mw-unwatch-link2, a#mw-watch-link2, a#mw-watch-link1' ) ); + // ...allowing people to add inline animated links is a little scary + $links = $links.filter( ':not( #bodyContent *, #content * )' ); + $links.each( function() { + var $link = $(this); + $link + .data( 'icon', $link.parent().hasClass( 'icon' ) ) + .data( 'action', $link.attr( 'href' ).match( /[\?\&]action=unwatch/i ) ? 'unwatch' : 'watch' ); + var title = $link.attr( 'href' ).match( /[\?\&]title=(.*?)&/i )[1]; + $link.data( 'target', decodeURIComponent( title ).replace( /_/g, ' ' ) ); + } ); + $links.click( function( event ) { + var $link = $(this); + if ( mw.legacy.wgAjaxWatch.supported === false || !mw.legacy.wgEnableWriteAPI || !mw.legacy.wfSupportsAjax() ) { + // Lazy initialization so we don't toss up ActiveX warnings on initial page load for IE 6 users with + // security settings. + mw.legacy.wgAjaxWatch.$links.unbind( 'click' ); + return true; + } + mw.legacy.wgAjaxWatch.setLinkText( $link, $link.data( 'action' ) + 'ing' ); + var url = mw.legacy.wgScriptPath + '/api' + mw.legacy.wgScriptExtension + '?action=watch&format=json&title=' + + encodeURIComponent( $link.data( 'target' ) ) + ( $link.data( 'action' ) == 'unwatch' ? '&unwatch' : '' ); + $.get( url, {}, mw.legacy.wgAjaxWatch.processResult, 'json' ); + return false; + } ); + // When a request returns, a custom event 'mw-ajaxwatch' is triggered on *all* watch links, so they can be updated + // if necessary + $links.bind( 'mw-ajaxwatch', function( event, target, action ) { + var $link = $(this); + var foo = $link.data( 'target' ); + if ( $link.data( 'target' ) == target ) { + var otheraction = action == 'watch' ? 'unwatch' : 'watch'; + $link.data( 'action', otheraction ); + wgAjaxWatch.setLinkText( $link, otheraction ); + $link.attr( 'href', $link.attr( 'href' ).replace( '/&action=' + action + '/', '&action=' + otheraction ) ); + if ( $link.parent().attr( 'id' ) == 'ca-' + action ){ + $link.parent().attr( 'id', 'ca-' + otheraction ); + } + } + return false; + } ); + mw.legacy.wgAjaxWatch.$links = $links; +} ); + +} )( jQuery ); \ No newline at end of file diff --git a/resources/mw/mw.legacy.block.js b/resources/mw/mw.legacy.block.js new file mode 100644 index 00000000000..83594f3a939 --- /dev/null +++ b/resources/mw/mw.legacy.block.js @@ -0,0 +1,42 @@ +/* + * Legacy emulation for the now depricated block.js + * + * Ported by: Trevor Parscal + */ + +( function( $ ) { + +$.extend( mw.legacy, { + 'considerChangingExpiryFocus': function() { + var $expiry = $( '#wpBlockExpiry' ); + var $other = $( '#wpBlockOther' ); + if ( $expiry.length && $other.length ) { + if ( $expiry.val() == 'other' ) { + $other.css( 'display', '' ); + } else { + $other.css( 'display', 'none' ); + } + } + }, + 'updateBlockOptions': function() { + var $target = $( '#mw-bi-target' ); + if ( $target.length ) { + var address = $target.val(); + var isEmpty = address.match( /^\s*$/ ); + var isIp = address.match( /^(\d{1,3}\.\d{1,3}\.\d{1,3}\.\d{1,3}|:(:[0-9A-Fa-f]{1,4}){1,7}|[0-9A-Fa-f]{1,4}(:{1,2}[0-9A-Fa-f]{1,4}|::$){1,7})(\/\d+)?$/ ); + var isIpRange = isIp && address.match( /\/\d+$/ ); + + $( '#wpAnonOnlyRow' ).css( 'display', !isIp && !isEmpty ? 'none' : '' ); + $( '#wpEnableAutoblockRow,#wpEnableHideUser' ).css( 'display', isIp && !isEmpty ? 'none' : '' ); + $( '#wpEnableWatchUser' ).css( 'display', isIpRange && !isEmpty ? 'none' : '' ); + } + } +} ); + +/* Initialization */ + +$( document ).ready( function() { + mw.legacy.considerChangingExpiryFocus(); +} ); + +} )( jQuery ); \ No newline at end of file diff --git a/resources/mw/mw.legacy.changepassword.js b/resources/mw/mw.legacy.changepassword.js new file mode 100644 index 00000000000..89894495797 --- /dev/null +++ b/resources/mw/mw.legacy.changepassword.js @@ -0,0 +1,26 @@ +/* + * Legacy emulation for the now depricated changepassword.js + * + * Ported by: Trevor Parscal + */ + +( function( $ ) { + +$.extend( mw.legacy, { + 'onNameChange': function() { + var state = mw.legacy.wgUserName != $( '#wpName' ).val(); + $( '#wpPassword' ).attr( 'disabled', state ); + $( '#wpComment' ).attr( 'disabled', !state ); + }, + 'onNameChangeHook': function() { + $( '#wpName' ).blur( mw.legacy.onNameChange ); + } +} ); + +/* Initialization */ + +$( document ).ready( function() { + mw.legacy.onNameChangeHook(); +} ); + +} )( jQuery ); \ No newline at end of file diff --git a/resources/mw/mw.legacy.edit.js b/resources/mw/mw.legacy.edit.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.enhancedchanges.js b/resources/mw/mw.legacy.enhancedchanges.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.history.js b/resources/mw/mw.legacy.history.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.htmlform.js b/resources/mw/mw.legacy.htmlform.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.metadata.js b/resources/mw/mw.legacy.metadata.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.mwsuggest.js b/resources/mw/mw.legacy.mwsuggest.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.prefs.js b/resources/mw/mw.legacy.prefs.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.preview.js b/resources/mw/mw.legacy.preview.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.protect.js b/resources/mw/mw.legacy.protect.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.rightclickedit.js b/resources/mw/mw.legacy.rightclickedit.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.search.js b/resources/mw/mw.legacy.search.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.upload.js b/resources/mw/mw.legacy.upload.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/mw/mw.legacy.wikibits.js b/resources/mw/mw.legacy.wikibits.js new file mode 100644 index 00000000000..e69de29bb2d diff --git a/resources/startup.js b/resources/startup.js new file mode 100644 index 00000000000..572ef69accc --- /dev/null +++ b/resources/startup.js @@ -0,0 +1,30 @@ +/** + * This script provides a function which is run to evaluate whether or not to continue loading the jquery and mediawiki + * modules. This code should work on even the most anchient of browsers, so be very careful when editing. + */ +/** + * Returns false when run in a black-listed browser + * + * This function will be deleted after it's used, so do not expand it to be generally useful beyond startup + * + * jQuery has minimum requirements of: + * * Firefox 2.0+ + * * Internet Explorer 6+ + * * Safari 3+ + * * Opera 9+ + * * Chrome 1+ + */ +window.isCompatible = function() { + // IE < 6 + if ( navigator.appVersion.indexOf( 'MSIE' ) !== -1 && parseFloat( navigator.appVersion.split( 'MSIE' )[1] ) < 6 ) { + return false; + } + // TODO: Firefox < 2 + // TODO: Safari < 3 + // TODO: Opera < 9 + // TODO: Chrome < 1 + return true; +}; +/** + * The startUp() function will be generated and added here (at the bottom) + */ diff --git a/resources/test/bar.css b/resources/test/bar.css new file mode 100644 index 00000000000..ca352c68b24 --- /dev/null +++ b/resources/test/bar.css @@ -0,0 +1,5 @@ +@CHARSET "UTF-8"; + +#tests li.bar { + color: yellow; +} \ No newline at end of file diff --git a/resources/test/bar.js b/resources/test/bar.js new file mode 100644 index 00000000000..1d771dc9f56 --- /dev/null +++ b/resources/test/bar.js @@ -0,0 +1,2 @@ +// Test output +$( '#tests' ).append( '
  • Bar (3)
  • ' ); \ No newline at end of file diff --git a/resources/test/baz.css b/resources/test/baz.css new file mode 100644 index 00000000000..fb6c853320f --- /dev/null +++ b/resources/test/baz.css @@ -0,0 +1,5 @@ +@CHARSET "UTF-8"; + +#tests li.baz { + color: blue; +} \ No newline at end of file diff --git a/resources/test/baz.js b/resources/test/baz.js new file mode 100644 index 00000000000..e37529d88c4 --- /dev/null +++ b/resources/test/baz.js @@ -0,0 +1,2 @@ +// Test output +$( '#tests' ).append( '
  • Baz (1)
  • ' ); \ No newline at end of file diff --git a/resources/test/buz.css b/resources/test/buz.css new file mode 100644 index 00000000000..07b08bab0dc --- /dev/null +++ b/resources/test/buz.css @@ -0,0 +1,5 @@ +@CHARSET "UTF-8"; + +#tests li.buz { + color: green; +} \ No newline at end of file diff --git a/resources/test/buz.js b/resources/test/buz.js new file mode 100644 index 00000000000..a0ea30ad80e --- /dev/null +++ b/resources/test/buz.js @@ -0,0 +1,2 @@ +// Test output +$( '#tests' ).append( '
  • Buz (2)
  • ' ); \ No newline at end of file diff --git a/resources/test/foo.css b/resources/test/foo.css new file mode 100644 index 00000000000..c9519076f2e --- /dev/null +++ b/resources/test/foo.css @@ -0,0 +1,5 @@ +@CHARSET "UTF-8"; + +#tests li.foo { + color: orange; +} \ No newline at end of file diff --git a/resources/test/foo.js b/resources/test/foo.js new file mode 100644 index 00000000000..d3c2bfe9721 --- /dev/null +++ b/resources/test/foo.js @@ -0,0 +1,2 @@ +// Test output +$( '#tests' ).append( '
  • Foo (4)
  • ' ); diff --git a/resources/test/index.html b/resources/test/index.html new file mode 100644 index 00000000000..448ee2abbd4 --- /dev/null +++ b/resources/test/index.html @@ -0,0 +1,21 @@ + + + + + Resource Loader Test + + + + + + +

    Resource Loader Tests

    +
      + + \ No newline at end of file diff --git a/resources/test/loader.js b/resources/test/loader.js new file mode 100644 index 00000000000..3db724b1064 --- /dev/null +++ b/resources/test/loader.js @@ -0,0 +1,6 @@ +// Registers the modules with the loading system +mw.loader.register( 'test', ['foo'] ); +mw.loader.register( 'foo', ['bar'] ); +mw.loader.register( 'bar', ['buz'] ); +mw.loader.register( 'buz', ['baz'] ); +mw.loader.register( 'baz', [] ); \ No newline at end of file diff --git a/resources/test/test.css b/resources/test/test.css new file mode 100644 index 00000000000..33e8a731bbc --- /dev/null +++ b/resources/test/test.css @@ -0,0 +1,5 @@ +@CHARSET "UTF-8"; + +#tests li.test { + color: red; +} \ No newline at end of file diff --git a/resources/test/test.js b/resources/test/test.js new file mode 100644 index 00000000000..f351c8777b3 --- /dev/null +++ b/resources/test/test.js @@ -0,0 +1,2 @@ +// Test output +$( '#tests' ).append( '
    • Test (5)
    • ' ); \ No newline at end of file diff --git a/skins/Vector.php b/skins/Vector.php index db95d6fdaa0..d21bade9869 100644 --- a/skins/Vector.php +++ b/skins/Vector.php @@ -50,10 +50,8 @@ class SkinVector extends SkinTemplate { global $wgVectorExtraStyles; parent::setupSkinUserCss( $out ); - - // Append skin-specific styles - $out->addStyle( "{$this->stylename}/main-rtl.css", 'screen', '', 'rtl' ); - $out->addStyle( "{$this->stylename}/main-ltr.css", 'screen', '', 'ltr' ); + + $out->addModuleStyles( 'vector' ); // Add extra stylesheets // THIS IS ONLY USEFUL FOR EXPERIMENTING WITH DIFFERNT STYLE OPTIONS! THIS WILL BE REMOVED IN THE NEAR FUTURE. diff --git a/skins/common/IEFixes.js b/skins/common/IEFixes.js index 762d7a780e6..7aa883ef887 100644 --- a/skins/common/IEFixes.js +++ b/skins/common/IEFixes.js @@ -1,14 +1,14 @@ // IE fixes javascript -var isMSIE55 = ( window.showModalDialog && window.clipboardData && window.createPopup ); -var doneIETransform; -var doneIEAlphaFix; +window.isMSIE55 = ( window.showModalDialog && window.clipboardData && window.createPopup ); +window.doneIETransform; +window.doneIEAlphaFix; if ( document.attachEvent ) { document.attachEvent( 'onreadystatechange', hookit ); } -function hookit() { +window.hookit = function() { if ( !doneIETransform && document.getElementById && document.getElementById( 'bodyContent' ) ) { doneIETransform = true; relativeforfloats(); @@ -17,7 +17,7 @@ function hookit() { } // png alpha transparency fixes -function fixalpha( logoId ) { +window.fixalpha = function( logoId ) { // bg if ( isMSIE55 && !doneIEAlphaFix ) { var plogo = document.getElementById( logoId || 'p-logo' ); @@ -64,7 +64,7 @@ function fixalpha( logoId ) { } // fix ie6 disappering float bug -function relativeforfloats() { +window.relativeforfloats = function() { var bc = document.getElementById( 'bodyContent' ); if ( bc ) { var tables = bc.getElementsByTagName( 'table' ); @@ -73,7 +73,7 @@ function relativeforfloats() { setrelative( tables ); setrelative( divs ); } -function setrelative( nodes ) { +window.setrelative = function( nodes ) { var i = 0; while ( i < nodes.length ) { if( ( ( nodes[i].style.float && nodes[i].style.float != ( 'none' ) || @@ -97,9 +97,9 @@ String.prototype.hasClass = function( classWanted ) { return false; } -var expandedURLs; +window.expandedURLs = undefined; -onbeforeprint = function() { +window.onbeforeprint = function() { expandedURLs = []; var contentEl = document.getElementById( 'content' ); @@ -119,7 +119,7 @@ onbeforeprint = function() { } } -onafterprint = function() { +window.onafterprint = function() { for ( var i = 0; i < expandedURLs.length; i++ ) { if ( expandedURLs[i] ) { expandedURLs[i].removeNode( true ); diff --git a/skins/common/ajax.js b/skins/common/ajax.js index dcb97c131f7..d43f135b2b6 100644 --- a/skins/common/ajax.js +++ b/skins/common/ajax.js @@ -1,17 +1,15 @@ // remote scripting library // (c) copyright 2005 modernmethod, inc -var sajax_debug_mode = false; -var sajax_request_type = 'GET'; +window.sajax_debug_mode = false; +window.sajax_request_type = 'GET'; /** * if sajax_debug_mode is true, this function outputs given the message into * the element with id = sajax_debug; if no such element exists in the document, * it is injected. */ -function sajax_debug( text ) { - if ( !sajax_debug_mode ) { - return false; - } +window.sajax_debug = function(text) { + if (!sajax_debug_mode) return false; var e = document.getElementById( 'sajax_debug' ); @@ -40,7 +38,7 @@ function sajax_debug( text ) { /** * Compatibility wrapper for creating a new XMLHttpRequest object. */ -function sajax_init_object() { +window.sajax_init_object = function() { sajax_debug( 'sajax_init_object() called..' ); var A; try { @@ -82,7 +80,7 @@ function sajax_init_object() { * (1, 2, 3) as the parameter list, and will show the result in the element * with id = showFoo */ -function sajax_do_call( func_name, args, target ) { +window.sajax_do_call = function(func_name, args, target) { var i, x, n; var uri; var post_data; @@ -171,7 +169,7 @@ function sajax_do_call( func_name, args, target ) { /** * @return boolean whether the browser supports XMLHttpRequest */ -function wfSupportsAjax() { +window.wfSupportsAjax = function() { var request = sajax_init_object(); var supportsAjax = request ? true : false; delete request; diff --git a/skins/common/ajaxwatch.js b/skins/common/ajaxwatch.js index 7d0babfd916..5394851460c 100644 --- a/skins/common/ajaxwatch.js +++ b/skins/common/ajaxwatch.js @@ -4,15 +4,8 @@ * Uses jsMsg() from wikibits.js. */ -if( typeof wgAjaxWatch === 'undefined' || !wgAjaxWatch ) { - var wgAjaxWatch = { - watchMsg: 'Watch', - unwatchMsg: 'Unwatch', - watchingMsg: 'Watching...', - unwatchingMsg: 'Unwatching...', - 'tooltip-ca-watchMsg': 'Add this page to your watchlist', - 'tooltip-ca-unwatchMsg': 'Remove this page from your watchlist' - }; +if ( typeof wgAjaxWatch === 'undefined' || !wgAjaxWatch ) { + window.wgAjaxWatch = { }; } wgAjaxWatch.setLinkText = function( $link, action ) { @@ -21,23 +14,23 @@ wgAjaxWatch.setLinkText = function( $link, action ) { var keyCommand = $link.attr( 'title' ).match( /\[.*?\]$/ ) ? $link.attr( 'title' ).match( /\[.*?\]$/ )[0] : ''; - $link.attr( 'title', wgAjaxWatch['tooltip-ca-' + action + 'Msg'] + ' ' + keyCommand ); + $link.attr( 'title', mediaWiki.msg.get( 'tooltip-ca-' + action + 'Msg') + ' ' + keyCommand ); } if( $link.data( 'icon' ) ) { - $link.attr( 'alt', wgAjaxWatch[action + 'Msg'] ); + $link.attr( 'alt', mediaWiki.msg.get( action + 'Msg' ) ); if ( action == 'watching' || action == 'unwatching' ) { $link.addClass( 'loading' ); } else { $link.removeClass( 'loading' ); } } else { - $link.html( wgAjaxWatch[action + 'Msg'] ); + $link.html( mediaWiki.msg.get( action + 'Msg' ) ); } }; wgAjaxWatch.processResult = function( response ) { response = response.watch; - var $link = $j( this ); + var $link = $( this ); // To ensure we set the same status for all watch links with the // same target we trigger a custom event on *all* watch links. if( response.watched !== undefined ) { @@ -55,23 +48,23 @@ wgAjaxWatch.processResult = function( response ) { // Bug 12395 - update the watch checkbox on edit pages when the // page is watched or unwatched via the tab. if( response.watched !== undefined ) { - $j( '#wpWatchthis' ).attr( 'checked', '1' ); + $( '#wpWatchthis' ).attr( 'checked', '1' ); } else { - $j( '#wpWatchthis' ).removeAttr( 'checked' ); + $( '#wpWatchthis' ).removeAttr( 'checked' ); } }; -$j( document ).ready( function() { - var $links = $j( '.mw-watchlink a, a.mw-watchlink' ); +$( document ).ready( function() { + var $links = $( '.mw-watchlink a, a.mw-watchlink' ); // BC with older skins $links = $links - .add( $j( '#ca-watch a, #ca-unwatch a, a#mw-unwatch-link1' ) ) - .add( $j( 'a#mw-unwatch-link2, a#mw-watch-link2, a#mw-watch-link1' ) ); + .add( $( '#ca-watch a, #ca-unwatch a, a#mw-unwatch-link1' ) ) + .add( $( 'a#mw-unwatch-link2, a#mw-watch-link2, a#mw-watch-link1' ) ); // allowing people to add inline animated links is a little scary $links = $links.filter( ':not( #bodyContent *, #content * )' ); $links.each( function() { - var $link = $j( this ); + var $link = $( this ); $link .data( 'icon', $link.parents( 'li' ).hasClass( 'icon' ) ) .data( 'action', $link.attr( 'href' ).match( /[\?\&]action=unwatch/i ) ? 'unwatch' : 'watch' ); @@ -80,7 +73,7 @@ $j( document ).ready( function() { }); $links.click( function( event ) { - var $link = $j( this ); + var $link = $( this ); if( wgAjaxWatch.supported === false || !wgEnableWriteAPI || !wfSupportsAjax() ) { // Lazy initialization so we don't toss up @@ -91,7 +84,7 @@ $j( document ).ready( function() { } wgAjaxWatch.setLinkText( $link, $link.data( 'action' ) + 'ing' ); - $j.get( wgScriptPath + $.get( wgScriptPath + '/api' + wgScriptExtension + '?action=watch&format=json&title=' + encodeURIComponent( $link.data( 'target' ) ) + ( $link.data( 'action' ) == 'unwatch' ? '&unwatch' : '' ), @@ -106,7 +99,7 @@ $j( document ).ready( function() { // When a request returns, a custom event 'mw-ajaxwatch' is triggered // on *all* watch links, so they can be updated if necessary $links.bind( 'mw-ajaxwatch', function( event, target, action ) { - var $link = $j( this ); + var $link = $( this ); var foo = $link.data( 'target' ); if( $link.data( 'target' ) == target ) { var otheraction = action == 'watch' @@ -119,7 +112,7 @@ $j( document ).ready( function() { if( $link.parents( 'li' ).attr( 'id' ) == 'ca-' + action ) { $link.parents( 'li' ).attr( 'id', 'ca-' + otheraction ); // update the link text with the new message - $link.text( wgAjaxWatch[ otheraction + 'Msg'] ); + $link.text( mediaWiki.msg.get( otheraction + 'Msg' ) ); } }; return false; diff --git a/skins/common/block.js b/skins/common/block.js index ad04f8103be..73ed71e2df1 100644 --- a/skins/common/block.js +++ b/skins/common/block.js @@ -1,6 +1,4 @@ -addOnloadHook( considerChangingExpiryFocus ); - -function considerChangingExpiryFocus() { +window.considerChangingExpiryFocus = function() { if ( !document.getElementById ) { return; } @@ -19,8 +17,7 @@ function considerChangingExpiryFocus() { field.style.display = 'none'; } } - -function updateBlockOptions() { +window.updateBlockOptions = function() { if ( !document.getElementById ) { return; } @@ -55,3 +52,5 @@ function updateBlockOptions() { watchuserRow.style.display = isIpRange && !isEmpty ? 'none' : ''; } } + +addOnloadHook( considerChangingExpiryFocus ); \ No newline at end of file diff --git a/skins/common/changepassword.js b/skins/common/changepassword.js index 1e3e2069664..f1b4b3e3b86 100644 --- a/skins/common/changepassword.js +++ b/skins/common/changepassword.js @@ -1,5 +1,5 @@ -function onNameChange() { +window.onNameChange = function() { if ( wgUserName != document.getElementById('wpName').value ) { document.getElementById('wpPassword').disabled = true; document.getElementById('wpComment').disabled = false; @@ -9,7 +9,7 @@ function onNameChange() { } } -function onNameChangeHook() { +window.onNameChangeHook = function() { document.getElementById( 'wpName' ).onblur = onNameChange; } diff --git a/skins/common/edit.js b/skins/common/edit.js index 5d30844f657..f752454a68f 100644 --- a/skins/common/edit.js +++ b/skins/common/edit.js @@ -1,7 +1,7 @@ -var currentFocused; +window.currentFocused = undefined; // this function adds a toolbar button to the mwEditButtons list -function addButton( imageFile, speedTip, tagOpen, tagClose, sampleText, imageId ) { +window.addButton = function( imageFile, speedTip, tagOpen, tagClose, sampleText, imageId ) { // Don't generate buttons for browsers which don't fully // support it. mwEditButtons.push({ @@ -15,7 +15,7 @@ function addButton( imageFile, speedTip, tagOpen, tagClose, sampleText, imageId } // this function adds one toolbar button from a mwEditButtons/mwCustomEditButtons item -function mwInsertEditButton( parent, item ) { +window.mwInsertEditButton = function( parent, item ) { var image = document.createElement( 'img' ); image.width = 23; image.height = 22; @@ -31,8 +31,8 @@ function mwInsertEditButton( parent, item ) { image.onclick = function() { insertTags( item.tagOpen, item.tagClose, item.sampleText ); // click tracking - if ( ( typeof $j != 'undefined' ) && ( typeof $j.trackAction != 'undefined' ) ) { - $j.trackAction( 'oldedit.' + item.speedTip.replace(/ /g, "-") ); + if ( ( typeof $ != 'undefined' ) && ( typeof $.trackAction != 'undefined' ) ) { + $.trackAction( 'oldedit.' + item.speedTip.replace(/ /g, "-") ); } return false; }; @@ -43,7 +43,7 @@ function mwInsertEditButton( parent, item ) { // this function generates the actual toolbar buttons with localized text // we use it to avoid creating the toolbar where javascript is not enabled -function mwSetupToolbar() { +window.mwSetupToolbar = function() { var toolbar = document.getElementById( 'toolbar' ); if ( !toolbar ) { return false; @@ -77,10 +77,10 @@ function mwSetupToolbar() { // apply tagOpen/tagClose to selection in textarea, // use sampleText instead of selection if there is none -function insertTags( tagOpen, tagClose, sampleText ) { - if ( typeof $j != 'undefined' && typeof $j.fn.textSelection != 'undefined' && +window.insertTags = function( tagOpen, tagClose, sampleText ) { + if ( typeof $ != 'undefined' && typeof $.fn.textSelection != 'undefined' && ( currentFocused.nodeName.toLowerCase() == 'iframe' || currentFocused.id == 'wpTextbox1' ) ) { - $j( '#wpTextbox1' ).textSelection( + $( '#wpTextbox1' ).textSelection( 'encapsulateSelection', { 'pre': tagOpen, 'peri': sampleText, 'post': tagClose } ); return; @@ -166,7 +166,7 @@ function insertTags( tagOpen, tagClose, sampleText ) { * Restore the edit box scroll state following a preview operation, * and set up a form submission handler to remember this state */ -function scrollEditBox() { +window.scrollEditBox = function() { var editBox = document.getElementById( 'wpTextbox1' ); var scrollTop = document.getElementById( 'wpScrolltop' ); var editForm = document.getElementById( 'editform' ); @@ -217,10 +217,10 @@ hookEvent( 'load', function() { // HACK: make currentFocused work with the usability iframe // With proper focus detection support (HTML 5!) this'll be much cleaner - if ( typeof $j != 'undefined' ) { - var iframe = $j( '.wikiEditor-ui-text iframe' ); + if ( typeof $ != 'undefined' ) { + var iframe = $( '.wikiEditor-ui-text iframe' ); if ( iframe.length > 0 ) { - $j( iframe.get( 0 ).contentWindow.document ) + $( iframe.get( 0 ).contentWindow.document ) .add( iframe.get( 0 ).contentWindow.document.body ) // for IE .focus( function() { currentFocused = iframe.get( 0 ); } ); } diff --git a/skins/common/enhancedchanges.js b/skins/common/enhancedchanges.js index b1789c9e06e..d583cdf0b6e 100644 --- a/skins/common/enhancedchanges.js +++ b/skins/common/enhancedchanges.js @@ -24,7 +24,7 @@ appendCSS('.mw-changeslist-hidden {'+ * Switch an RC line between hidden/shown * @param int idNumber : the id number of the RC group */ -function toggleVisibility(idNumber) { +window.toggleVisibility = function(idNumber) { var openarrow = document.getElementById("mw-rc-openarrow-"+idNumber); var closearrow = document.getElementById("mw-rc-closearrow-"+idNumber); var subentries = document.getElementById("mw-rc-subentries-"+idNumber); diff --git a/skins/common/history.js b/skins/common/history.js index 026512254ca..9bc8f4d8cb8 100644 --- a/skins/common/history.js +++ b/skins/common/history.js @@ -1,4 +1,4 @@ -function historyRadios(parent) { +window.historyRadios = function(parent) { var inputs = parent.getElementsByTagName('input'); var radios = []; for (var i = 0; i < inputs.length; i++) { @@ -10,7 +10,7 @@ function historyRadios(parent) { } // check selection and tweak visibility/class onclick -function diffcheck() { +window.diffcheck = function() { var dli = false; // the li where the diff radio is checked var oli = false; // the li where the oldid radio is checked var hf = document.getElementById('pagehistory'); @@ -77,7 +77,7 @@ function diffcheck() { } // Attach event handlers to the input elements on history page -function histrowinit() { +window.histrowinit = function() { var hf = document.getElementById('pagehistory'); if (!hf) return; var lis = hf.getElementsByTagName('li'); diff --git a/skins/common/htmlform.js b/skins/common/htmlform.js index 2045ab48457..075ae3209bc 100644 --- a/skins/common/htmlform.js +++ b/skins/common/htmlform.js @@ -12,7 +12,7 @@ addOnloadHook( function() { } } ); -var htmlforms = { +window.htmlforms = { 'selectOrOtherSelectChanged' : function( e ) { var select; if ( !e ) { diff --git a/skins/common/jquery-1.3.2.js b/skins/common/jquery-1.3.2.js deleted file mode 100644 index c25ee31c89c..00000000000 --- a/skins/common/jquery-1.3.2.js +++ /dev/null @@ -1,4384 +0,0 @@ -/*! - * jQuery JavaScript Library v1.3.2 - * http://jquery.com/ - * - * Copyright (c) 2009 John Resig - * Dual licensed under the MIT and GPL licenses. - * http://docs.jquery.com/License - * - * Date: 2009-02-19 17:34:21 -0500 (Thu, 19 Feb 2009) - * Revision: 6246 - */ -(function(){ - -var - // Will speed up references to window, and allows munging its name. - window = this, - // Will speed up references to undefined, and allows munging its name. - undefined, - // Map over jQuery in case of overwrite - _jQuery = window.jQuery, - // Map over the $ in case of overwrite - _$ = window.$, - - jQuery = window.jQuery = window.$ = function( selector, context ) { - // The jQuery object is actually just the init constructor 'enhanced' - return new jQuery.fn.init( selector, context ); - }, - - // A simple way to check for HTML strings or ID strings - // (both of which we optimize for) - quickExpr = /^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/, - // Is it a simple selector - isSimple = /^.[^:#\[\.,]*$/; - -jQuery.fn = jQuery.prototype = { - init: function( selector, context ) { - // Make sure that a selection was provided - selector = selector || document; - - // Handle $(DOMElement) - if ( selector.nodeType ) { - this[0] = selector; - this.length = 1; - this.context = selector; - return this; - } - // Handle HTML strings - if ( typeof selector === "string" ) { - // Are we dealing with HTML string or an ID? - var match = quickExpr.exec( selector ); - - // Verify a match, and that no context was specified for #id - if ( match && (match[1] || !context) ) { - - // HANDLE: $(html) -> $(array) - if ( match[1] ) - selector = jQuery.clean( [ match[1] ], context ); - - // HANDLE: $("#id") - else { - var elem = document.getElementById( match[3] ); - - // Handle the case where IE and Opera return items - // by name instead of ID - if ( elem && elem.id != match[3] ) - return jQuery().find( selector ); - - // Otherwise, we inject the element directly into the jQuery object - var ret = jQuery( elem || [] ); - ret.context = document; - ret.selector = selector; - return ret; - } - - // HANDLE: $(expr, [context]) - // (which is just equivalent to: $(content).find(expr) - } else - return jQuery( context ).find( selector ); - - // HANDLE: $(function) - // Shortcut for document ready - } else if ( jQuery.isFunction( selector ) ) - return jQuery( document ).ready( selector ); - - // Make sure that old selector state is passed along - if ( selector.selector && selector.context ) { - this.selector = selector.selector; - this.context = selector.context; - } - - return this.setArray(jQuery.isArray( selector ) ? - selector : - jQuery.makeArray(selector)); - }, - - // Start with an empty selector - selector: "", - - // The current version of jQuery being used - jquery: "1.3.2", - - // The number of elements contained in the matched element set - size: function() { - return this.length; - }, - - // Get the Nth element in the matched element set OR - // Get the whole matched element set as a clean array - get: function( num ) { - return num === undefined ? - - // Return a 'clean' array - Array.prototype.slice.call( this ) : - - // Return just the object - this[ num ]; - }, - - // Take an array of elements and push it onto the stack - // (returning the new matched element set) - pushStack: function( elems, name, selector ) { - // Build a new jQuery matched element set - var ret = jQuery( elems ); - - // Add the old object onto the stack (as a reference) - ret.prevObject = this; - - ret.context = this.context; - - if ( name === "find" ) - ret.selector = this.selector + (this.selector ? " " : "") + selector; - else if ( name ) - ret.selector = this.selector + "." + name + "(" + selector + ")"; - - // Return the newly-formed element set - return ret; - }, - - // Force the current matched set of elements to become - // the specified array of elements (destroying the stack in the process) - // You should use pushStack() in order to do this, but maintain the stack - setArray: function( elems ) { - // Resetting the length to 0, then using the native Array push - // is a super-fast way to populate an object with array-like properties - this.length = 0; - Array.prototype.push.apply( this, elems ); - - return this; - }, - - // Execute a callback for every element in the matched set. - // (You can seed the arguments with an array of args, but this is - // only used internally.) - each: function( callback, args ) { - return jQuery.each( this, callback, args ); - }, - - // Determine the position of an element within - // the matched set of elements - index: function( elem ) { - // Locate the position of the desired element - return jQuery.inArray( - // If it receives a jQuery object, the first element is used - elem && elem.jquery ? elem[0] : elem - , this ); - }, - - attr: function( name, value, type ) { - var options = name; - - // Look for the case where we're accessing a style value - if ( typeof name === "string" ) - if ( value === undefined ) - return this[0] && jQuery[ type || "attr" ]( this[0], name ); - - else { - options = {}; - options[ name ] = value; - } - - // Check to see if we're setting style values - return this.each(function(i){ - // Set all the styles - for ( name in options ) - jQuery.attr( - type ? - this.style : - this, - name, jQuery.prop( this, options[ name ], type, i, name ) - ); - }); - }, - - css: function( key, value ) { - // ignore negative width and height values - if ( (key == 'width' || key == 'height') && parseFloat(value) < 0 ) - value = undefined; - return this.attr( key, value, "curCSS" ); - }, - - text: function( text ) { - if ( typeof text !== "object" && text != null ) - return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); - - var ret = ""; - - jQuery.each( text || this, function(){ - jQuery.each( this.childNodes, function(){ - if ( this.nodeType != 8 ) - ret += this.nodeType != 1 ? - this.nodeValue : - jQuery.fn.text( [ this ] ); - }); - }); - - return ret; - }, - - wrapAll: function( html ) { - if ( this[0] ) { - // The elements to wrap the target around - var wrap = jQuery( html, this[0].ownerDocument ).clone(); - - if ( this[0].parentNode ) - wrap.insertBefore( this[0] ); - - wrap.map(function(){ - var elem = this; - - while ( elem.firstChild ) - elem = elem.firstChild; - - return elem; - }).append(this); - } - - return this; - }, - - wrapInner: function( html ) { - return this.each(function(){ - jQuery( this ).contents().wrapAll( html ); - }); - }, - - wrap: function( html ) { - return this.each(function(){ - jQuery( this ).wrapAll( html ); - }); - }, - - append: function() { - return this.domManip(arguments, true, function(elem){ - if (this.nodeType == 1) - this.appendChild( elem ); - }); - }, - - prepend: function() { - return this.domManip(arguments, true, function(elem){ - if (this.nodeType == 1) - this.insertBefore( elem, this.firstChild ); - }); - }, - - before: function() { - return this.domManip(arguments, false, function(elem){ - this.parentNode.insertBefore( elem, this ); - }); - }, - - after: function() { - return this.domManip(arguments, false, function(elem){ - this.parentNode.insertBefore( elem, this.nextSibling ); - }); - }, - - end: function() { - return this.prevObject || jQuery( [] ); - }, - - // For internal use only. - // Behaves like an Array's method, not like a jQuery method. - push: [].push, - sort: [].sort, - splice: [].splice, - - find: function( selector ) { - if ( this.length === 1 ) { - var ret = this.pushStack( [], "find", selector ); - ret.length = 0; - jQuery.find( selector, this[0], ret ); - return ret; - } else { - return this.pushStack( jQuery.unique(jQuery.map(this, function(elem){ - return jQuery.find( selector, elem ); - })), "find", selector ); - } - }, - - clone: function( events ) { - // Do the clone - var ret = this.map(function(){ - if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) { - // IE copies events bound via attachEvent when - // using cloneNode. Calling detachEvent on the - // clone will also remove the events from the orignal - // In order to get around this, we use innerHTML. - // Unfortunately, this means some modifications to - // attributes in IE that are actually only stored - // as properties will not be copied (such as the - // the name attribute on an input). - var html = this.outerHTML; - if ( !html ) { - var div = this.ownerDocument.createElement("div"); - div.appendChild( this.cloneNode(true) ); - html = div.innerHTML; - } - - return jQuery.clean([html.replace(/ jQuery\d+="(?:\d+|null)"/g, "").replace(/^\s*/, "")])[0]; - } else - return this.cloneNode(true); - }); - - // Copy the events from the original to the clone - if ( events === true ) { - var orig = this.find("*").andSelf(), i = 0; - - ret.find("*").andSelf().each(function(){ - if ( this.nodeName !== orig[i].nodeName ) - return; - - var events = jQuery.data( orig[i], "events" ); - - for ( var type in events ) { - for ( var handler in events[ type ] ) { - jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data ); - } - } - - i++; - }); - } - - // Return the cloned set - return ret; - }, - - filter: function( selector ) { - return this.pushStack( - jQuery.isFunction( selector ) && - jQuery.grep(this, function(elem, i){ - return selector.call( elem, i ); - }) || - - jQuery.multiFilter( selector, jQuery.grep(this, function(elem){ - return elem.nodeType === 1; - }) ), "filter", selector ); - }, - - closest: function( selector ) { - var pos = jQuery.expr.match.POS.test( selector ) ? jQuery(selector) : null, - closer = 0; - - return this.map(function(){ - var cur = this; - while ( cur && cur.ownerDocument ) { - if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selector) ) { - jQuery.data(cur, "closest", closer); - return cur; - } - cur = cur.parentNode; - closer++; - } - }); - }, - - not: function( selector ) { - if ( typeof selector === "string" ) - // test special case where just one selector is passed in - if ( isSimple.test( selector ) ) - return this.pushStack( jQuery.multiFilter( selector, this, true ), "not", selector ); - else - selector = jQuery.multiFilter( selector, this ); - - var isArrayLike = selector.length && selector[selector.length - 1] !== undefined && !selector.nodeType; - return this.filter(function() { - return isArrayLike ? jQuery.inArray( this, selector ) < 0 : this != selector; - }); - }, - - add: function( selector ) { - return this.pushStack( jQuery.unique( jQuery.merge( - this.get(), - typeof selector === "string" ? - jQuery( selector ) : - jQuery.makeArray( selector ) - ))); - }, - - is: function( selector ) { - return !!selector && jQuery.multiFilter( selector, this ).length > 0; - }, - - hasClass: function( selector ) { - return !!selector && this.is( "." + selector ); - }, - - val: function( value ) { - if ( value === undefined ) { - var elem = this[0]; - - if ( elem ) { - if( jQuery.nodeName( elem, 'option' ) ) - return (elem.attributes.value || {}).specified ? elem.value : elem.text; - - // We need to handle select boxes special - if ( jQuery.nodeName( elem, "select" ) ) { - var index = elem.selectedIndex, - values = [], - options = elem.options, - one = elem.type == "select-one"; - - // Nothing was selected - if ( index < 0 ) - return null; - - // Loop through all the selected options - for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { - var option = options[ i ]; - - if ( option.selected ) { - // Get the specifc value for the option - value = jQuery(option).val(); - - // We don't need an array for one selects - if ( one ) - return value; - - // Multi-Selects return an array - values.push( value ); - } - } - - return values; - } - - // Everything else, we just grab the value - return (elem.value || "").replace(/\r/g, ""); - - } - - return undefined; - } - - if ( typeof value === "number" ) - value += ''; - - return this.each(function(){ - if ( this.nodeType != 1 ) - return; - - if ( jQuery.isArray(value) && /radio|checkbox/.test( this.type ) ) - this.checked = (jQuery.inArray(this.value, value) >= 0 || - jQuery.inArray(this.name, value) >= 0); - - else if ( jQuery.nodeName( this, "select" ) ) { - var values = jQuery.makeArray(value); - - jQuery( "option", this ).each(function(){ - this.selected = (jQuery.inArray( this.value, values ) >= 0 || - jQuery.inArray( this.text, values ) >= 0); - }); - - if ( !values.length ) - this.selectedIndex = -1; - - } else - this.value = value; - }); - }, - - html: function( value ) { - return value === undefined ? - (this[0] ? - this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g, "") : - null) : - this.empty().append( value ); - }, - - replaceWith: function( value ) { - return this.after( value ).remove(); - }, - - eq: function( i ) { - return this.slice( i, +i + 1 ); - }, - - slice: function() { - return this.pushStack( Array.prototype.slice.apply( this, arguments ), - "slice", Array.prototype.slice.call(arguments).join(",") ); - }, - - map: function( callback ) { - return this.pushStack( jQuery.map(this, function(elem, i){ - return callback.call( elem, i, elem ); - })); - }, - - andSelf: function() { - return this.add( this.prevObject ); - }, - - domManip: function( args, table, callback ) { - if ( this[0] ) { - var fragment = (this[0].ownerDocument || this[0]).createDocumentFragment(), - scripts = jQuery.clean( args, (this[0].ownerDocument || this[0]), fragment ), - first = fragment.firstChild; - - if ( first ) - for ( var i = 0, l = this.length; i < l; i++ ) - callback.call( root(this[i], first), this.length > 1 || i > 0 ? - fragment.cloneNode(true) : fragment ); - - if ( scripts ) - jQuery.each( scripts, evalScript ); - } - - return this; - - function root( elem, cur ) { - return table && jQuery.nodeName(elem, "table") && jQuery.nodeName(cur, "tr") ? - (elem.getElementsByTagName("tbody")[0] || - elem.appendChild(elem.ownerDocument.createElement("tbody"))) : - elem; - } - } -}; - -// Give the init function the jQuery prototype for later instantiation -jQuery.fn.init.prototype = jQuery.fn; - -function evalScript( i, elem ) { - if ( elem.src ) - jQuery.ajax({ - url: elem.src, - async: false, - dataType: "script" - }); - - else - jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" ); - - if ( elem.parentNode ) - elem.parentNode.removeChild( elem ); -} - -function now(){ - return +new Date; -} - -jQuery.extend = jQuery.fn.extend = function() { - // copy reference to target object - var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options; - - // Handle a deep copy situation - if ( typeof target === "boolean" ) { - deep = target; - target = arguments[1] || {}; - // skip the boolean and the target - i = 2; - } - - // Handle case when target is a string or something (possible in deep copy) - if ( typeof target !== "object" && !jQuery.isFunction(target) ) - target = {}; - - // extend jQuery itself if only one argument is passed - if ( length == i ) { - target = this; - --i; - } - - for ( ; i < length; i++ ) - // Only deal with non-null/undefined values - if ( (options = arguments[ i ]) != null ) - // Extend the base object - for ( var name in options ) { - var src = target[ name ], copy = options[ name ]; - - // Prevent never-ending loop - if ( target === copy ) - continue; - - // Recurse if we're merging object values - if ( deep && copy && typeof copy === "object" && !copy.nodeType ) - target[ name ] = jQuery.extend( deep, - // Never move original objects, clone them - src || ( copy.length != null ? [ ] : { } ) - , copy ); - - // Don't bring in undefined values - else if ( copy !== undefined ) - target[ name ] = copy; - - } - - // Return the modified object - return target; -}; - -// exclude the following css properties to add px -var exclude = /z-?index|font-?weight|opacity|zoom|line-?height/i, - // cache defaultView - defaultView = document.defaultView || {}, - toString = Object.prototype.toString; - -jQuery.extend({ - noConflict: function( deep ) { - window.$ = _$; - - if ( deep ) - window.jQuery = _jQuery; - - return jQuery; - }, - - // See test/unit/core.js for details concerning isFunction. - // Since version 1.3, DOM methods and functions like alert - // aren't supported. They return false on IE (#2968). - isFunction: function( obj ) { - return toString.call(obj) === "[object Function]"; - }, - - isArray: function( obj ) { - return toString.call(obj) === "[object Array]"; - }, - - // check if an element is in a (or is an) XML document - isXMLDoc: function( elem ) { - return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" || - !!elem.ownerDocument && jQuery.isXMLDoc( elem.ownerDocument ); - }, - - // Evalulates a script in a global context - globalEval: function( data ) { - if ( data && /\S/.test(data) ) { - // Inspired by code by Andrea Giammarchi - // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html - var head = document.getElementsByTagName("head")[0] || document.documentElement, - script = document.createElement("script"); - - script.type = "text/javascript"; - if ( jQuery.support.scriptEval ) - script.appendChild( document.createTextNode( data ) ); - else - script.text = data; - - // Use insertBefore instead of appendChild to circumvent an IE6 bug. - // This arises when a base node is used (#2709). - head.insertBefore( script, head.firstChild ); - head.removeChild( script ); - } - }, - - nodeName: function( elem, name ) { - return elem.nodeName && elem.nodeName.toUpperCase() == name.toUpperCase(); - }, - - // args is for internal usage only - each: function( object, callback, args ) { - var name, i = 0, length = object.length; - - if ( args ) { - if ( length === undefined ) { - for ( name in object ) - if ( callback.apply( object[ name ], args ) === false ) - break; - } else - for ( ; i < length; ) - if ( callback.apply( object[ i++ ], args ) === false ) - break; - - // A special, fast, case for the most common use of each - } else { - if ( length === undefined ) { - for ( name in object ) - if ( callback.call( object[ name ], name, object[ name ] ) === false ) - break; - } else - for ( var value = object[0]; - i < length && callback.call( value, i, value ) !== false; value = object[++i] ){} - } - - return object; - }, - - prop: function( elem, value, type, i, name ) { - // Handle executable functions - if ( jQuery.isFunction( value ) ) - value = value.call( elem, i ); - - // Handle passing in a number to a CSS property - return typeof value === "number" && type == "curCSS" && !exclude.test( name ) ? - value + "px" : - value; - }, - - className: { - // internal only, use addClass("class") - add: function( elem, classNames ) { - jQuery.each((classNames || "").split(/\s+/), function(i, className){ - if ( elem.nodeType == 1 && !jQuery.className.has( elem.className, className ) ) - elem.className += (elem.className ? " " : "") + className; - }); - }, - - // internal only, use removeClass("class") - remove: function( elem, classNames ) { - if (elem.nodeType == 1) - elem.className = classNames !== undefined ? - jQuery.grep(elem.className.split(/\s+/), function(className){ - return !jQuery.className.has( classNames, className ); - }).join(" ") : - ""; - }, - - // internal only, use hasClass("class") - has: function( elem, className ) { - return elem && jQuery.inArray( className, (elem.className || elem).toString().split(/\s+/) ) > -1; - } - }, - - // A method for quickly swapping in/out CSS properties to get correct calculations - swap: function( elem, options, callback ) { - var old = {}; - // Remember the old values, and insert the new ones - for ( var name in options ) { - old[ name ] = elem.style[ name ]; - elem.style[ name ] = options[ name ]; - } - - callback.call( elem ); - - // Revert the old values - for ( var name in options ) - elem.style[ name ] = old[ name ]; - }, - - css: function( elem, name, force, extra ) { - if ( name == "width" || name == "height" ) { - var val, props = { position: "absolute", visibility: "hidden", display:"block" }, which = name == "width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ]; - - function getWH() { - val = name == "width" ? elem.offsetWidth : elem.offsetHeight; - - if ( extra === "border" ) - return; - - jQuery.each( which, function() { - if ( !extra ) - val -= parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0; - if ( extra === "margin" ) - val += parseFloat(jQuery.curCSS( elem, "margin" + this, true)) || 0; - else - val -= parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0; - }); - } - - if ( elem.offsetWidth !== 0 ) - getWH(); - else - jQuery.swap( elem, props, getWH ); - - return Math.max(0, Math.round(val)); - } - - return jQuery.curCSS( elem, name, force ); - }, - - curCSS: function( elem, name, force ) { - var ret, style = elem.style; - - // We need to handle opacity special in IE - if ( name == "opacity" && !jQuery.support.opacity ) { - ret = jQuery.attr( style, "opacity" ); - - return ret == "" ? - "1" : - ret; - } - - // Make sure we're using the right name for getting the float value - if ( name.match( /float/i ) ) - name = styleFloat; - - if ( !force && style && style[ name ] ) - ret = style[ name ]; - - else if ( defaultView.getComputedStyle ) { - - // Only "float" is needed here - if ( name.match( /float/i ) ) - name = "float"; - - name = name.replace( /([A-Z])/g, "-$1" ).toLowerCase(); - try{ - var computedStyle = defaultView.getComputedStyle( elem, null ); - }catch(e){ - // Error in getting computedStyle - } - if ( computedStyle ) - ret = computedStyle.getPropertyValue( name ); - - // We should always get a number back from opacity - if ( name == "opacity" && ret == "" ) - ret = "1"; - - } else if ( elem.currentStyle ) { - var camelCase = name.replace(/\-(\w)/g, function(all, letter){ - return letter.toUpperCase(); - }); - - ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ]; - - // From the awesome hack by Dean Edwards - // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 - - // If we're not dealing with a regular pixel number - // but a number that has a weird ending, we need to convert it to pixels - if ( !/^\d+(px)?$/i.test( ret ) && /^\d/.test( ret ) ) { - // Remember the original values - var left = style.left, rsLeft = elem.runtimeStyle.left; - - // Put in the new values to get a computed value out - elem.runtimeStyle.left = elem.currentStyle.left; - style.left = ret || 0; - ret = style.pixelLeft + "px"; - - // Revert the changed values - style.left = left; - elem.runtimeStyle.left = rsLeft; - } - } - - return ret; - }, - - clean: function( elems, context, fragment ) { - context = context || document; - - // !context.createElement fails in IE with an error but returns typeof 'object' - if ( typeof context.createElement === "undefined" ) - context = context.ownerDocument || context[0] && context[0].ownerDocument || document; - - // If a single string is passed in and it's a single tag - // just do a createElement and skip the rest - if ( !fragment && elems.length === 1 && typeof elems[0] === "string" ) { - var match = /^<(\w+)\s*\/?>$/.exec(elems[0]); - if ( match ) - return [ context.createElement( match[1] ) ]; - } - - var ret = [], scripts = [], div = context.createElement("div"); - - jQuery.each(elems, function(i, elem){ - if ( typeof elem === "number" ) - elem += ''; - - if ( !elem ) - return; - - // Convert html string into DOM nodes - if ( typeof elem === "string" ) { - // Fix "XHTML"-style tags in all browsers - elem = elem.replace(/(<(\w+)[^>]*?)\/>/g, function(all, front, tag){ - return tag.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i) ? - all : - front + ">"; - }); - - // Trim whitespace, otherwise indexOf won't work as expected - var tags = elem.replace(/^\s+/, "").substring(0, 10).toLowerCase(); - - var wrap = - // option or optgroup - !tags.indexOf("", "" ] || - - !tags.indexOf("", "" ] || - - tags.match(/^<(thead|tbody|tfoot|colg|cap)/) && - [ 1, "", "
      " ] || - - !tags.indexOf("", "" ] || - - // matched above - (!tags.indexOf("", "" ] || - - !tags.indexOf("", "" ] || - - // IE can't serialize and